- A method for the regioselective synthesis of 1-alkyl-1H-indazolesLiu, Han-Jun; Hung, Shiang-Fu; Chen, Chuan-Lin; Lin, Mei-Huey, Tetrahedron, 2013, 69(19), 3907-3912
Cas no 959240-93-8 (4-Chloro-1-methyl-1H-indazol-3-amine)
4-Chloro-1-methyl-1H-indazol-3-amine Chemical and Physical Properties
Names and Identifiers
-
- 4-Chloro-1-methyl-1H-indazol-3-amine
- 4-chloro-1-methylindazol-3-amine
- 3-Amino-4-chloro-1-methyl-1H-indazole
- 4-Chloro-1-methyl-1H-indazol-3-amine (ACI)
-
- MDL: MFCD09864571
- Inchi: 1S/C8H8ClN3/c1-12-6-4-2-3-5(9)7(6)8(10)11-12/h2-4H,1H3,(H2,10,11)
- InChI Key: QAPUYNUPNBARPB-UHFFFAOYSA-N
- SMILES: ClC1C2C(N)=NN(C=2C=CC=1)C
Computed Properties
- Exact Mass: 181.04100
- Hydrogen Bond Donor Count: 2
- Hydrogen Bond Acceptor Count: 3
- Heavy Atom Count: 12
- Rotatable Bond Count: 0
Experimental Properties
- PSA: 43.84000
- LogP: 2.39010
4-Chloro-1-methyl-1H-indazol-3-amine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Chemenu | CM237238-1g |
4-Chloro-1-methyl-1H-indazol-3-amine |
959240-93-8 | 95% | 1g |
$303 | 2021-08-04 | |
| eNovation Chemicals LLC | Y1232799-5g |
4-CHLORO-1-METHYL-1H-INDAZOL-3-AMINE |
959240-93-8 | 95% | 5g |
$315 | 2024-06-06 | |
| abcr | AB217981-1 g |
4-Chloro-1-methyl-1H-indazol-3-amine; 95% |
959240-93-8 | 1 g |
€137.20 | 2023-07-20 | ||
| abcr | AB217981-5 g |
4-Chloro-1-methyl-1H-indazol-3-amine; 95% |
959240-93-8 | 5 g |
€381.90 | 2023-07-20 | ||
| abcr | AB217981-10 g |
4-Chloro-1-methyl-1H-indazol-3-amine; 95% |
959240-93-8 | 10g |
€563.30 | 2023-01-27 | ||
| Apollo Scientific | OR30983-1g |
3-Amino-4-chloro-1-methyl-1H-indazole |
959240-93-8 | 1g |
£75.00 | 2025-02-20 | ||
| Chemenu | CM237238-1g |
4-Chloro-1-methyl-1H-indazol-3-amine |
959240-93-8 | 95% | 1g |
$78 | 2024-07-18 | |
| Chemenu | CM237238-5g |
4-Chloro-1-methyl-1H-indazol-3-amine |
959240-93-8 | 95% | 5g |
$231 | 2024-07-18 | |
| Fluorochem | 061493-1g |
4-Chloro-1-methyl-1H-indazol-3-amine |
959240-93-8 | 95% | 1g |
£88.00 | 2022-03-01 | |
| Fluorochem | 061493-5g |
4-Chloro-1-methyl-1H-indazol-3-amine |
959240-93-8 | 95% | 5g |
£257.00 | 2022-03-01 |
4-Chloro-1-methyl-1H-indazol-3-amine Production Method
Production Method 1
4-Chloro-1-methyl-1H-indazol-3-amine Raw materials
4-Chloro-1-methyl-1H-indazol-3-amine Preparation Products
4-Chloro-1-methyl-1H-indazol-3-amine Related Literature
-
Kaiyuan Huang,Wangkang Qiu,Meilian Ou,Xiaorui Liu,Zenan Liao,Sheng Chu RSC Adv., 2020,10, 18824-18829
-
Zhonghua Xiang,Chuanqi Fang,Sanhua Leng,Dapeng Cao J. Mater. Chem. A, 2014,2, 7662-7665
-
Eunhak Lim,Jiyoung Heo,Seong Keun Kim Nanoscale, 2019,11, 11369-11378
-
R. M. Pemberton,J. P. Hart,T. T. Mottram Analyst, 2001,126, 1866-1871
-
Yu-Nong Li,Liang-Nian He,Xian-Dong Lang,Xiao-Fang Liu,Shuai Zhang RSC Adv., 2014,4, 49995-50002
Additional information on 4-Chloro-1-methyl-1H-indazol-3-amine
4-Chloro-1-methyl-1H-indazol-3-amine: A Comprehensive Overview
The compound 4-Chloro-1-methyl-1H-indazol-3-amine (CAS No. 959240-93-8) is a fascinating molecule with significant potential in various fields of chemistry and pharmacology. This compound belongs to the indazole family, which is a heterocyclic aromatic system characterized by two nitrogen atoms at positions 1 and 3. The indazole ring system is known for its stability and versatility, making it a popular structure in drug design and organic synthesis.
The indazole core of this compound provides a rigid framework that can be easily modified to introduce various substituents, enhancing its biological activity and functional properties. In the case of 4-Chloro-1-methyl-1H-indazol-3-amine, the substitution pattern includes a chlorine atom at position 4, a methyl group at position 1, and an amine group at position 3. These substituents play a crucial role in determining the compound's chemical reactivity, solubility, and bioavailability.
Recent studies have highlighted the importance of indazole derivatives in medicinal chemistry, particularly in the development of kinase inhibitors, which are critical in cancer therapy. The 4-Chloro substitution introduces electron-withdrawing effects, which can modulate the electronic properties of the molecule, enhancing its binding affinity to target proteins. Similarly, the methyl group at position 1 contributes to steric effects, influencing the overall conformation and stability of the molecule.
The amine group at position 3 is particularly significant as it can act as a hydrogen bond donor, a property that is highly desirable in drug molecules for improving their interaction with biological targets. This feature makes 4-Chloro-1-methyl-1H-indazol-3-amine a promising candidate for further exploration in drug discovery programs targeting diseases such as cancer, inflammation, and neurodegenerative disorders.
From a synthetic perspective, the preparation of 4-Chloro-1-methyl-1H-indazol-3-amine involves multi-step reactions that require precise control over reaction conditions to achieve high yields and purity. Common synthetic strategies include nucleophilic aromatic substitution, coupling reactions, and catalytic hydrogenation. Researchers have also explored green chemistry approaches to synthesize this compound, emphasizing sustainability and environmental friendliness.
In terms of applications, 4-Chloro-1-methyl-1H-indazol-3-amines have shown potential as intermediates in the synthesis of more complex molecules with enhanced biological activities. For instance, they can serve as building blocks for constructing larger heterocyclic systems or for introducing additional functional groups to fine-tune their pharmacokinetic profiles.
Recent advancements in computational chemistry have enabled researchers to perform detailed molecular modeling studies on 4-Chloroindazolamines, providing insights into their binding modes and interactions with target enzymes or receptors. These studies are instrumental in guiding medicinal chemists toward optimizing the compound's structure for improved efficacy and reduced toxicity.
In conclusion, 4-Chloroindazolamines represent a class of compounds with immense potential in both academic research and industrial applications. Their unique chemical properties and versatile substitution patterns make them valuable tools in drug discovery and organic synthesis. As research continues to uncover new insights into their structure-function relationships, it is anticipated that these compounds will play an increasingly important role in advancing modern medicine.
959240-93-8 (4-Chloro-1-methyl-1H-indazol-3-amine) Related Products
- 162502-53-6(4-Chloro-1-methyl-1H-indazole)
- 16889-21-7(6-Chloro-1H-indazol-3-amine)
- 60301-20-4(1-Methyl-1H-indazol-3-amine)
- 1031927-22-6(3-Amino-6-chloro-1-methyl-1H-indazole)
- 20925-60-4(4-Chloro-1H-indazol-3-amine)
- 1335498-11-7(4,5-Dichloro-1H-indazol-3-amine)
- 1626335-83-8(7-Bromo-4-chloro-1-methyl-1H-indazol-3-amine)
- 1499100-99-0(3-Amino-5-chloro-1-methylindazole)
- 1015846-49-7(4-Chloro-1-ethyl-1H-indazol-3-amine)
- 959240-46-1(4-Chloro-1-propyl-1H-indazol-3-amine)