Cas no 70021-34-0 (beta-D-galactopyranuronic acid)
beta-D-galactopyranuronic acid Chemical and Physical Properties
Names and Identifiers
-
- beta-D-galactopyranuronic acid
- beta-D-galacturonic acid
- D-(+)-galacturonic acid
- D-galacturonic acid
- GalA
- galactopyranuronic acid
- galactouronic acid
- A-D-GLUCOPYRANURONIC ACID
- D-(+)-glucuronic acid
- alpha-D-glucopyranuronic acid
- alpha-delta-glucuronic acid
- (2S,3S,4S,5R,6S)-3,4,5,6-tetrahydroxytetrahydro-2H-pyran-2-carboxylic acid
- D-(+)-glucuronate
- GlcAa
- AKOS015855520
- AS-76367
- CHEBI:42717
- delta-glucuronate
- DTXSID201036416
- D93555
- (2S,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid
- .ALPHA.-D-GLUCURONIC ACID
- Glucosiduronate
- alpha-D-Glucopyranosyluronic acid
- SCHEMBL6851
- delta-(+)-glucuronic acid
- M7Y086VB5G
- GCU
- delta-(+)-glucuronate
- .ALPHA.-D-GLUCOPYRANURONIC ACID
- alpha-D-glucuronic acid; D-glucuronic acid; glucuronic acid
- alpha-delta-glucopyranuronic acid
- Glucuronic acid, alpha-D-
- UNII-M7Y086VB5G
- GlcAalpha
- 70021-34-0
- .ALPHA.-D-GLUCOPYRANOSYLURONIC ACID
- alpha-D-glucuronic acid
- GLUCURONIC ACID, ALPHA.-D-
- SBI-0633919.0002
- ALFA-D-GLUCOPYRANURONIC ACID
-
- MDL: MFCD32670673
- Inchi: 1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4-,6-/m0/s1
- InChI Key: AEMOLEFTQBMNLQ-WAXACMCWSA-N
- SMILES: O1[C@@H]([C@@H]([C@H]([C@@H]([C@H]1C(=O)O)O)O)O)O
Computed Properties
- Exact Mass: 194.04265265g/mol
- Monoisotopic Mass: 194.04265265g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 5
- Hydrogen Bond Acceptor Count: 7
- Heavy Atom Count: 13
- Rotatable Bond Count: 1
- Complexity: 205
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 5
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: -2.3
- Topological Polar Surface Area: 127?2
Experimental Properties
- LogP: -2.57
beta-D-galactopyranuronic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| SHANG HAI MAI KE LIN SHENG HUA Technology Co., Ltd. | D907354-250mg |
D-Glucuronic acid |
70021-34-0 | 98% | 250mg |
2,592.00 | 2021-05-17 | |
| A2B Chem LLC | AH20803-100mg |
a-D-Glucopyranuronic acid |
70021-34-0 | 95% | 100mg |
$165.00 | 2024-04-19 | |
| A2B Chem LLC | AH20803-250mg |
a-D-Glucopyranuronic acid |
70021-34-0 | 95% | 250mg |
$315.00 | 2024-04-19 | |
| eNovation Chemicals LLC | D757056-250mg |
a-D-Glucopyranuronic acid |
70021-34-0 | 98% | 250mg |
$55 | 2024-06-06 | |
| eNovation Chemicals LLC | D757056-1g |
a-D-Glucopyranuronic acid |
70021-34-0 | 98% | 1g |
$65 | 2024-06-06 | |
| eNovation Chemicals LLC | D757056-5g |
a-D-Glucopyranuronic acid |
70021-34-0 | 98% | 5g |
$85 | 2024-06-06 | |
| eNovation Chemicals LLC | D757056-10g |
a-D-Glucopyranuronic acid |
70021-34-0 | 98% | 10g |
$110 | 2024-06-06 | |
| A2B Chem LLC | AH20803-1g |
a-D-Glucopyranuronic acid |
70021-34-0 | 95% | 1g |
$847.00 | 2024-04-19 | |
| A2B Chem LLC | AH20803-5g |
a-D-Glucopyranuronic acid |
70021-34-0 | 98% | 5g |
$49.00 | 2023-12-30 | |
| A2B Chem LLC | AH20803-10g |
a-D-Glucopyranuronic acid |
70021-34-0 | 98% | 10g |
$80.00 | 2023-12-30 |
beta-D-galactopyranuronic acid Related Literature
-
Vishwesh Venkatraman,Marco Foscato,Vidar R. Jensen,Bj?rn K?re Alsberg J. Mater. Chem. A, 2015,3, 9851-9860
-
Gloria Belén Ramírez-Rodríguez,José Manuel Delgado-López,Jaime Gómez-Morales CrystEngComm, 2013,15, 2206-2212
-
Long Deng,Qian Zou,Biao Liu,Wenhui Ye,Chengfei Zhuo,Li Chen,Ze-Yuan Deng,Ya-Wei Fan,Jing Li Food Funct., 2018,9, 4234-4245
-
Guiying Zhang,Maosheng Cheng,Yanni Li,Keliang Liu,Lifeng Cai Chem. Commun., 2013,49, 11086-11088
Additional information on beta-D-galactopyranuronic acid
beta-D-galactopyranuronic acid (CAS No. 70021-34-0): An Overview of Its Structure, Properties, and Applications in Biomedical Research
beta-D-galactopyranuronic acid (CAS No. 70021-34-0) is a significant compound in the field of carbohydrate chemistry and biochemistry. This monosaccharide derivative is a uronic acid form of galactose, characterized by its unique structural and functional properties. The compound plays a crucial role in various biological processes and has gained attention for its potential applications in biomedical research and drug development.
Structure and Chemical Properties: beta-D-galactopyranuronic acid is a six-carbon sugar with a carboxylic acid group at the C-6 position. The pyranose ring structure, specifically the beta-anomer, confers stability and reactivity to the molecule. The presence of the carboxylic acid group imparts acidic properties, making it a versatile building block in glycosylation reactions and other biochemical processes. The compound's solubility in water and polar solvents makes it suitable for various experimental conditions.
Synthesis and Isolation: The synthesis of beta-D-galactopyranuronic acid can be achieved through several methods, including chemical synthesis from galactose or enzymatic conversion using specific glycosidases. Enzymatic approaches are often preferred due to their high selectivity and environmental friendliness. Recent advancements in biocatalysis have further optimized the production process, making it more efficient and cost-effective.
Biochemical Significance: In biological systems, beta-D-galactopyranuronic acid is involved in the formation of complex carbohydrates such as pectins and other polysaccharides found in plant cell walls. These polysaccharides play essential roles in cell structure, signaling, and defense mechanisms. The compound's ability to form stable glycosidic linkages with other monosaccharides makes it a key component in the biosynthesis of glycoproteins and glycolipids, which are crucial for cellular functions.
Biomedical Applications: The unique properties of beta-D-galactopyranuronic acid have led to its exploration in various biomedical applications. One notable area is its use as a precursor in the synthesis of therapeutic agents. For example, recent studies have shown that derivatives of this compound exhibit anti-inflammatory and anti-cancer activities. Additionally, beta-D-galactopyranuronic acid has been investigated for its potential as a drug delivery vehicle due to its biocompatibility and ability to enhance the solubility and bioavailability of hydrophobic drugs.
Clinical Trials and Research Developments: Several clinical trials are currently underway to evaluate the safety and efficacy of compounds derived from beta-D-galactopyranuronic acid. Preliminary results have been promising, with some studies reporting significant improvements in patient outcomes. For instance, a recent Phase II trial investigating a novel glycosaminoglycan derivative showed reduced inflammation and improved tissue repair in patients with chronic wounds.
Analytical Techniques: Accurate characterization of beta-D-galactopyranuronic acid is crucial for both research and industrial applications. Advanced analytical techniques such as nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry (MS), and high-performance liquid chromatography (HPLC) are commonly used to determine the purity, structure, and identity of the compound. These techniques provide detailed insights into the molecular composition and help ensure quality control in pharmaceutical formulations.
FUTURE PERSPECTIVES AND CONCLUSIONS: The ongoing research on beta-D-galactopyranuronic acid highlights its potential as a valuable tool in biomedical science. Its unique chemical properties make it an attractive candidate for developing new therapeutic strategies. As our understanding of carbohydrate biology continues to expand, we can expect to see more innovative applications of this compound in areas such as regenerative medicine, immunotherapy, and personalized medicine.
70021-34-0 (beta-D-galactopyranuronic acid) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)