Cas no 61895-35-0 (6-methoxy-5,8-dinitroquinoline)
6-methoxy-5,8-dinitroquinoline Chemical and Physical Properties
Names and Identifiers
-
- 6-methoxy-5,8-dinitroquinoline
- 5,8-Dinitro-6-methoxyquinoline
- 6-Methoxy-5,8-dinitro-chinolin
- 6-methoxy-5,8-dinitro-quinoline
- AC1L86PZ
- CTK2F5219
- NSC405732
- CHEMBL1866414
- SMR001875463
- DTXSID00324096
- WS-02918
- E72040
- MLS003171581
- 61895-35-0
- 6-Methoxy-5,8-dinitroquinoline #
- NSC-405732
- NSC 405732
- PJTNDEYGQDPRNS-UHFFFAOYSA-N
-
- Inchi: 1S/C10H7N3O5/c1-18-8-5-7(12(14)15)9-6(3-2-4-11-9)10(8)13(16)17/h2-5H,1H3
- InChI Key: PJTNDEYGQDPRNS-UHFFFAOYSA-N
- SMILES: O(C)C1C=C(C2C(=CC=CN=2)C=1[N+](=O)[O-])[N+](=O)[O-]
Computed Properties
- Exact Mass: 249.03861
- Monoisotopic Mass: 249.03857033g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 6
- Heavy Atom Count: 18
- Rotatable Bond Count: 1
- Complexity: 339
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 1.8
- Topological Polar Surface Area: 114?2
Experimental Properties
- PSA: 108.4
6-methoxy-5,8-dinitroquinoline Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| eNovation Chemicals LLC | Y1266365-250mg |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 250mg |
$130 | 2023-09-04 | |
| eNovation Chemicals LLC | Y1266365-1g |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 1g |
$215 | 2023-09-04 | |
| 1PlusChem | 1P01IKP6-100mg |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 100mg |
$68.00 | 2023-12-16 | |
| 1PlusChem | 1P01IKP6-250mg |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 250mg |
$106.00 | 2023-12-16 | |
| 1PlusChem | 1P01IKP6-500mg |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 500mg |
$140.00 | 2023-12-16 | |
| 1PlusChem | 1P01IKP6-1g |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 1g |
$192.00 | 2023-12-16 | |
| Aaron | AR01IKXI-100mg |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 100mg |
$61.00 | 2023-12-14 | |
| Aaron | AR01IKXI-250mg |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 250mg |
$105.00 | 2023-12-14 | |
| Aaron | AR01IKXI-500mg |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 500mg |
$144.00 | 2023-12-14 | |
| Aaron | AR01IKXI-1g |
6-methoxy-5,8-dinitro-quinoline |
61895-35-0 | 96% | 1g |
$203.00 | 2023-12-14 |
6-methoxy-5,8-dinitroquinoline Related Literature
-
Michael Kappl,Paul M. Young,Daniela Traini,Sanyog Jain RSC Adv., 2016,6, 25789-25798
-
Luke L. Lairson,Warren W. Wakarchuk Chem. Commun., 2007, 365-367
-
Yang Chen,Di Zhou,Zheyi Meng,Jin Zhai Chem. Commun., 2016,52, 10020-10023
Additional information on 6-methoxy-5,8-dinitroquinoline
Professional Introduction to Compound with CAS No 61895-35-0 and Product Name 6-methoxy-5,8-dinitroquinoline
6-methoxy-5,8-dinitroquinoline, identified by the Chemical Abstracts Service Number (CAS No) 61895-35-0, is a specialized organic compound that has garnered significant attention in the field of medicinal chemistry and pharmaceutical research. This compound belongs to the quinoline family, a class of heterocyclic aromatic compounds known for their diverse biological activities and applications in drug development. The presence of methoxy and nitro substituents in its molecular structure imparts unique chemical properties that make it a valuable intermediate in synthetic chemistry and a potential candidate for further exploration in therapeutic applications.
The structural framework of 6-methoxy-5,8-dinitroquinoline consists of a quinoline core substituted with two nitro groups at the 5th and 8th positions, along with a methoxy group at the 6th position. This specific arrangement of functional groups enhances its reactivity and opens up numerous possibilities for chemical modifications and derivatization. The nitro groups, in particular, are known for their ability to participate in various chemical reactions, including reduction to amino groups, which can be further functionalized to create more complex molecular architectures.
In recent years, there has been growing interest in quinoline derivatives due to their broad spectrum of biological activities. Studies have shown that compounds within this class exhibit properties such as antimicrobial, antiviral, anti-inflammatory, and anticancer effects. The introduction of electron-withdrawing groups like nitro and electron-donating groups like methoxy can significantly influence the pharmacological profile of these compounds. For instance, the nitro groups in 6-methoxy-5,8-dinitroquinoline may enhance its ability to interact with biological targets, while the methoxy group could contribute to metabolic stability and bioavailability.
One of the most compelling aspects of 6-methoxy-5,8-dinitroquinoline is its potential as a building block for more complex drug candidates. Researchers have been exploring its utility in synthesizing novel molecules with enhanced therapeutic efficacy. For example, by selectively reducing the nitro groups to amino groups, chemists can generate derivatives that may exhibit improved solubility or binding affinity to biological targets. Additionally, the methoxy group provides a handle for further functionalization through etherification or sulfonylation reactions, allowing for the creation of diverse pharmacophores.
The synthesis of 6-methoxy-5,8-dinitroquinoline involves multi-step organic transformations that require careful optimization to ensure high yield and purity. Common synthetic routes include nitration of quinoline precursors followed by methylation at the desired position. Advanced techniques such as catalytic hydrogenation or palladium-catalyzed cross-coupling reactions may also be employed to introduce additional functional groups or modify existing ones. The choice of synthetic strategy depends on factors such as cost-effectiveness, scalability, and the desired properties of the final product.
Recent advancements in computational chemistry have further accelerated the discovery process for quinoline derivatives like 6-methoxy-5,8-dinitroquinoline. Molecular modeling studies can predict binding interactions between this compound and potential biological targets, providing insights into its mechanism of action. These computational approaches are particularly valuable in virtual screening campaigns where large libraries of compounds are evaluated for their binding affinity to specific receptors or enzymes. By integrating experimental data with computational predictions, researchers can prioritize promising candidates for further investigation.
The pharmacological evaluation of 6-methoxy-5,8-dinitroquinoline has revealed several interesting findings that warrant further exploration. In vitro studies have demonstrated its ability to inhibit certain enzymes associated with inflammatory pathways, suggesting potential applications in treating inflammatory diseases. Additionally, preliminary cell-based assays indicate that this compound may exhibit antiproliferative effects against cancer cell lines. While these results are encouraging, additional research is needed to confirm these findings and determine optimal dosing regimens.
One area of particular interest is the development of 6-methoxy-5,8-dinitroquinoline as an intermediate for more complex drug candidates. By leveraging its structural features, chemists can design molecules with tailored properties for specific therapeutic applications. For example, incorporating additional functional groups such as hydroxyl or carboxyl moieties could enhance binding interactions with biological targets or improve pharmacokinetic profiles. Such modifications may lead to the discovery of novel drugs with improved efficacy and reduced side effects.
The safety profile of 6-methoxy-5,8-dinitroquinoline is another critical aspect that requires thorough investigation before it can be considered for clinical use. While preliminary studies suggest that this compound is well-tolerated at moderate doses, long-term toxicity studies are essential to assess potential risks associated with repeated exposure. Additionally, efforts should be made to optimize synthetic routes to minimize hazardous byproducts and ensure sustainable production practices.
In conclusion,6-methoxy-5,8-dinitroquinoline (CAS No 61895-35-0) represents a promising compound with significant potential in medicinal chemistry and pharmaceutical research. Its unique structural features make it a valuable intermediate for synthesizing novel drug candidates with diverse therapeutic applications. While further research is needed to fully elucidate its pharmacological properties and safety profile,this compound holds great promise as a building block for future therapies targeting various diseases.
61895-35-0 (6-methoxy-5,8-dinitroquinoline) Related Products
- 6623-91-2(6-Methoxy-5-nitroquinoline)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)