Cas no 58686-65-0 ((3-fluoro-phenyl)-propynoic acid ethyl ester)
(3-fluoro-phenyl)-propynoic acid ethyl ester Chemical and Physical Properties
Names and Identifiers
-
- (3-fluoro-phenyl)-propynoic acid ethyl ester
- LogP
- ethyl 3-(3-fluorophenyl)prop-2-ynoate
-
- Inchi: 1S/C11H9FO2/c1-2-14-11(13)7-6-9-4-3-5-10(12)8-9/h3-5,8H,2H2,1H3
- InChI Key: GVXOYAYMTPAZMN-UHFFFAOYSA-N
- SMILES: FC1=CC=CC(C#CC(=O)OCC)=C1
Computed Properties
- Exact Mass: 192.05900
Experimental Properties
- PSA: 26.30000
- LogP: 1.74030
(3-fluoro-phenyl)-propynoic acid ethyl ester Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-743532-0.05g |
ethyl 3-(3-fluorophenyl)prop-2-ynoate |
58686-65-0 | 95% | 0.05g |
$468.0 | 2024-05-23 | |
| Enamine | EN300-743532-0.1g |
ethyl 3-(3-fluorophenyl)prop-2-ynoate |
58686-65-0 | 95% | 0.1g |
$490.0 | 2024-05-23 | |
| Enamine | EN300-743532-0.25g |
ethyl 3-(3-fluorophenyl)prop-2-ynoate |
58686-65-0 | 95% | 0.25g |
$513.0 | 2024-05-23 | |
| Enamine | EN300-743532-0.5g |
ethyl 3-(3-fluorophenyl)prop-2-ynoate |
58686-65-0 | 95% | 0.5g |
$535.0 | 2024-05-23 | |
| Enamine | EN300-743532-1.0g |
ethyl 3-(3-fluorophenyl)prop-2-ynoate |
58686-65-0 | 95% | 1.0g |
$557.0 | 2024-05-23 | |
| Enamine | EN300-743532-2.5g |
ethyl 3-(3-fluorophenyl)prop-2-ynoate |
58686-65-0 | 95% | 2.5g |
$1089.0 | 2024-05-23 | |
| Enamine | EN300-743532-5.0g |
ethyl 3-(3-fluorophenyl)prop-2-ynoate |
58686-65-0 | 95% | 5.0g |
$1614.0 | 2024-05-23 | |
| Enamine | EN300-743532-10.0g |
ethyl 3-(3-fluorophenyl)prop-2-ynoate |
58686-65-0 | 95% | 10.0g |
$2393.0 | 2024-05-23 | |
| SHANG HAI HAO HONG Biomedical Technology Co., Ltd. | 1418407-50mg |
Ethyl 3-(3-fluorophenyl)propiolate |
58686-65-0 | 95% | 50mg |
¥11232.00 | 2024-05-07 | |
| SHANG HAI HAO HONG Biomedical Technology Co., Ltd. | 1418407-100mg |
Ethyl 3-(3-fluorophenyl)propiolate |
58686-65-0 | 95% | 100mg |
¥11750.00 | 2024-05-07 |
(3-fluoro-phenyl)-propynoic acid ethyl ester Related Literature
-
Yaqing Liu,Jiangtao Ren,Jing Li,Jiyang Liu,Erkang Wang Chem. Commun., 2012,48, 802-804
-
Eunice Y.-L. Hui,Bhimsen Rout,Yaw Sing Tan,Kok-Ping Chan,Charles W. Johannes Org. Biomol. Chem., 2018,16, 389-392
-
Li-Hua Gan,Rui Wu,Jian-Lei Tian,Patrick W. Fowler Phys. Chem. Chem. Phys., 2017,19, 419-425
-
Xue-Ying Wang,Ying Pei,Min Xie,Zi-He Jin,Ya-Shi Xiao,Yang Wang,Li-Na Zhang,Yan Li,Wei-Hua Huang Lab Chip, 2015,15, 1178-1187
-
Chongyang Zhu,Xiaojia Bian,Xin Jia,Ning Tang,Yongqiang Cheng Food Funct., 2020,11, 10635-10644
Additional information on (3-fluoro-phenyl)-propynoic acid ethyl ester
Chemical Profile of (3-fluoro-phenyl)-propynoic acid ethyl ester (CAS No. 58686-65-0)
(3-fluoro-phenyl)-propynoic acid ethyl ester, identified by its CAS number 58686-65-0, is a specialized organic compound that has garnered significant attention in the field of pharmaceutical chemistry and medicinal research. This compound belongs to the class of fluoro-substituted aromatic propynoates, which are known for their diverse biological activities and potential therapeutic applications. The presence of a fluoro group in the phenyl ring and the propynoic acid ethyl ester moiety imparts unique chemical and pharmacological properties, making it a valuable scaffold for drug discovery and development.
The structural features of (3-fluoro-phenyl)-propynoic acid ethyl ester contribute to its reactivity and functionality. The fluoro atom, being highly electronegative, influences the electronic properties of the aromatic ring, enhancing its interaction with biological targets. This characteristic is particularly relevant in the design of small-molecule inhibitors targeting enzymes and receptors involved in critical metabolic pathways. Additionally, the propynoic acid ethyl ester group introduces a polar functional handle, facilitating further chemical modifications and derivatization, which are essential steps in optimizing drug-like properties such as solubility, bioavailability, and metabolic stability.
In recent years, there has been a growing interest in fluoroaromatic compounds due to their enhanced binding affinity and metabolic stability compared to their non-fluorinated counterparts. Studies have demonstrated that the introduction of a fluoro group can significantly improve the pharmacokinetic profile of drug candidates. For instance, fluorinated compounds have been shown to exhibit increased lipophilicity and resistance to enzymatic degradation, which are crucial factors for achieving prolonged therapeutic efficacy. The ethyl ester derivative of propynoic acid further enhances these properties by providing a flexible linker that can be modified to target specific biological processes.
(3-fluoro-phenyl)-propynoic acid ethyl ester has been explored in various research settings, particularly in the development of novel therapeutic agents. Its utility as a building block for more complex molecules has been highlighted in several studies. Researchers have utilized this compound to synthesize derivatives with targeted biological activities, including anti-inflammatory, anticancer, and antimicrobial properties. The versatility of this scaffold allows for the creation of libraries of compounds that can be screened for activity against a wide range of diseases.
The synthesis of (3-fluoro-phenyl)-propynoic acid ethyl ester involves multi-step organic reactions that require precise control over reaction conditions to ensure high yield and purity. Common synthetic routes include halogenation of the phenyl ring followed by condensation with propynoic acid derivatives. Advanced techniques such as palladium-catalyzed cross-coupling reactions have also been employed to introduce the fluoro group efficiently. These synthetic strategies highlight the compound's importance as a precursor in fine chemical synthesis.
The pharmacological potential of (3-fluoro-phenyl)-propynoic acid ethyl ester has been investigated through both computational modeling and experimental studies. Computational approaches have helped elucidate its binding interactions with biological targets at an atomic level, providing insights into its mechanism of action. Experimental validation through enzyme inhibition assays and cell-based assays has further confirmed its efficacy in modulating specific pathways. These findings underscore the compound's significance as a lead molecule in drug discovery programs.
In conclusion, (3-fluoro-phenyl)-propynoic acid ethyl ester (CAS No. 58686-65-0) is a versatile and highly functional compound with significant potential in pharmaceutical research. Its unique structural features, combined with its reactivity and adaptability as a synthetic intermediate, make it an invaluable asset for developing novel therapeutic agents. As research continues to uncover new applications for fluoroaromatic compounds, compounds like this are poised to play a crucial role in addressing unmet medical needs.
58686-65-0 ((3-fluoro-phenyl)-propynoic acid ethyl ester) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)