Cas no 4974-18-9 (2-ethyl-1H-Indole-3-ethanamine)
2-ethyl-1H-Indole-3-ethanamine Chemical and Physical Properties
Names and Identifiers
-
- 2-ethyl-1H-Indole-3-ethanamine
- 1H-Indole-3-ethanamine, 2-ethyl-
-
- Inchi: 1S/C12H16N2/c1-2-11-10(7-8-13)9-5-3-4-6-12(9)14-11/h3-6,14H,2,7-8,13H2,1H3
- InChI Key: NFLAKEISHBZNLS-UHFFFAOYSA-N
- SMILES: N1C2=C(C=CC=C2)C(CCN)=C1CC
Experimental Properties
- Density: 1.099±0.06 g/cm3(Predicted)
- Boiling Point: 357.5±27.0 °C(Predicted)
- pka: 17.74±0.30(Predicted)
2-ethyl-1H-Indole-3-ethanamine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-7472870-0.05g |
2-(2-ethyl-1H-indol-3-yl)ethan-1-amine |
4974-18-9 | 95% | 0.05g |
$1261.0 | 2024-05-23 | |
| Enamine | EN300-7472870-0.1g |
2-(2-ethyl-1H-indol-3-yl)ethan-1-amine |
4974-18-9 | 95% | 0.1g |
$1320.0 | 2024-05-23 | |
| Enamine | EN300-7472870-0.25g |
2-(2-ethyl-1H-indol-3-yl)ethan-1-amine |
4974-18-9 | 95% | 0.25g |
$1381.0 | 2024-05-23 | |
| Enamine | EN300-7472870-0.5g |
2-(2-ethyl-1H-indol-3-yl)ethan-1-amine |
4974-18-9 | 95% | 0.5g |
$1440.0 | 2024-05-23 | |
| Enamine | EN300-7472870-1.0g |
2-(2-ethyl-1H-indol-3-yl)ethan-1-amine |
4974-18-9 | 95% | 1.0g |
$1500.0 | 2024-05-23 | |
| Enamine | EN300-7472870-2.5g |
2-(2-ethyl-1H-indol-3-yl)ethan-1-amine |
4974-18-9 | 95% | 2.5g |
$2940.0 | 2024-05-23 | |
| Enamine | EN300-7472870-5.0g |
2-(2-ethyl-1H-indol-3-yl)ethan-1-amine |
4974-18-9 | 95% | 5.0g |
$4349.0 | 2024-05-23 | |
| Enamine | EN300-7472870-10.0g |
2-(2-ethyl-1H-indol-3-yl)ethan-1-amine |
4974-18-9 | 95% | 10.0g |
$6450.0 | 2024-05-23 |
2-ethyl-1H-Indole-3-ethanamine Related Literature
-
Guiying Zhang,Maosheng Cheng,Yanni Li,Keliang Liu,Lifeng Cai Chem. Commun., 2013,49, 11086-11088
-
David White,Sean R. Stowell Biomater. Sci., 2017,5, 463-474
-
Xiaotong Feng,Lei Bian,Jie Ma,Lei Zhou,Xiayan Wang,Guangsheng Guo,Qiaosheng Pu Chem. Commun., 2019,55, 3963-3966
-
Qiao Song,Angela Bamesberger,Lingyun Yang,Haley Houtwed,Haishi Cao Analyst, 2014,139, 3588-3592
Additional information on 2-ethyl-1H-Indole-3-ethanamine
2-Ethyl-1H-Indole-3-Ethanamine: A Comprehensive Overview
The compound 2-Ethyl-1H-Indole-3-Ethanamine, identified by the CAS number 4974-18-9, is a fascinating molecule with significant applications in various fields of chemistry and pharmacology. This compound belongs to the indole family, which is renowned for its structural versatility and biological activity. The indole ring, a bicyclic structure consisting of a benzene ring fused to a pyrrole ring, forms the core of this molecule. The presence of an ethyl group at the 2-position and an ethanamine group at the 3-position introduces unique chemical properties and functional groups that make this compound highly valuable in research and development.
Recent studies have highlighted the potential of 2-Ethyl-1H-Indole-3-Ethanamine in drug discovery, particularly in the development of novel therapeutic agents. Its structural features allow for diverse interactions with biological targets, making it a promising candidate for designing molecules with specific pharmacological activities. For instance, researchers have explored its role as a precursor in the synthesis of bioactive compounds, such as kinase inhibitors and GPCR modulators, which are critical in treating various diseases including cancer and neurodegenerative disorders.
The synthesis of 2-Ethyl-1H-Indole-3-Ethanamine has been optimized through innovative methodologies that enhance yield and purity. One notable approach involves the use of catalytic asymmetric synthesis, which not only streamlines the production process but also ensures the formation of enantiomerically pure products. This advancement is particularly important for pharmaceutical applications where stereochemistry plays a pivotal role in determining efficacy and safety.
In terms of physical properties, 2-Ethyl-1H-indole-based compounds exhibit interesting behavior under different conditions. For example, their solubility profiles vary significantly depending on the substituents attached to the indole ring. The ethanamine group at position 3 introduces basicity, which can influence both chemical reactivity and biological interactions. This makes CAS No. 4974-18-based compounds ideal for studying structure-property relationships in medicinal chemistry.
The application of computational chemistry tools has further enriched our understanding of 2-Ethyl-indole-related compounds. Advanced molecular modeling techniques have enabled researchers to predict binding affinities, optimize molecular designs, and simulate biological interactions at an unprecedented level. These computational insights have significantly accelerated drug discovery processes by reducing reliance on time-consuming experimental trials.
In conclusion, 2-Ethyl-indole-based compounds like CAS No. 4974 represent a vital area of research with immense potential for advancing therapeutic interventions. Their unique chemical properties, coupled with cutting-edge synthetic and computational methodologies, position them as key players in modern drug development.
4974-18-9 (2-ethyl-1H-Indole-3-ethanamine) Related Products
- 2731-06-8(2-Methyltryptamine)
- 1079-44-3(2-(2,5-dimethyl-1H-indol-3-yl)ethan-1-amine)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)