Cas no 34291-99-1 (2-4-(propan-2-yl)phenylpropanal)
2-4-(propan-2-yl)phenylpropanal Chemical and Physical Properties
Names and Identifiers
-
- Benzeneacetaldehyde, a-methyl-4-(1-methylethyl)-
- 2-(4-propan-2-ylphenyl)propanal
- Α-METHYL-4-(1-METHYLETHYL)-BENZENEACETALDEHYDE
- 2-(4-Isopropylphenyl)propanal
- 2-(4-Isopropylphenyl)propionaldehyde
- EINECS 251-920-6
- Hydratropaldehyde,p-isopropyl
- para-Isopropyl hydroatropic aldehyde
- alpha-methyl-4-(1-methylethyl)-benzeneacetaldehyd
- Benzeneacetaldehyde,.alpha.-methyl-4-(1-methylethyl)-
- 2-4-(propan-2-yl)phenylpropanal
-
- Inchi: 1S/C12H16O/c1-9(2)11-4-6-12(7-5-11)10(3)8-13/h4-10H,1-3H3
- InChI Key: IZQUWQPXCQLTJY-UHFFFAOYSA-N
- SMILES: O=CC(C1C=CC(C(C)C)=CC=1)C
Computed Properties
- Exact Mass: 176.12000
- Monoisotopic Mass: 176.12
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 1
- Heavy Atom Count: 13
- Rotatable Bond Count: 3
- Complexity: 155
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 1
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- Topological Polar Surface Area: 17.1A^2
Experimental Properties
- Density: 0.943
- Boiling Point: 252.5°Cat760mmHg
- Flash Point: 110.9°C
- Refractive Index: 1.498
- PSA: 17.07000
- LogP: 3.11240
2-4-(propan-2-yl)phenylpropanal Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-1836907-0.05g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 0.05g |
$188.0 | 2023-09-19 | |
| Enamine | EN300-1836907-0.1g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 0.1g |
$282.0 | 2023-09-19 | |
| Enamine | EN300-1836907-0.25g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 0.25g |
$403.0 | 2023-09-19 | |
| Enamine | EN300-1836907-0.5g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 0.5g |
$636.0 | 2023-09-19 | |
| Enamine | EN300-1836907-1.0g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 1g |
$813.0 | 2023-06-03 | |
| Enamine | EN300-1836907-2.5g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 2.5g |
$1594.0 | 2023-09-19 | |
| Enamine | EN300-1836907-5.0g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 5g |
$2360.0 | 2023-06-03 | |
| Enamine | EN300-1836907-10.0g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 10g |
$3500.0 | 2023-06-03 | |
| Enamine | EN300-1836907-1g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 1g |
$813.0 | 2023-09-19 | |
| Enamine | EN300-1836907-5g |
2-[4-(propan-2-yl)phenyl]propanal |
34291-99-1 | 95% | 5g |
$2360.0 | 2023-09-19 |
2-4-(propan-2-yl)phenylpropanal Related Literature
-
Tevfik Aysu,Mehmet Ma?uk Kü?ük,Ayhan Demirba? RSC Adv. 2014 4 55912
Additional information on 2-4-(propan-2-yl)phenylpropanal
Introduction to 2-4-(propan-2-yl)phenylpropanal (CAS No. 34291-99-1)
2-4-(propan-2-yl)phenylpropanal, also known by its CAS number 34291-99-1, is a versatile organic compound that has garnered significant attention in the fields of organic chemistry, pharmaceutical research, and materials science. This compound is characterized by its unique molecular structure, which includes a propanal functional group and a substituted phenyl ring. The combination of these features endows 2-4-(propan-2-yl)phenylpropanal with a range of chemical properties that make it valuable for various applications.
In recent years, the study of 2-4-(propan-2-yl)phenylpropanal has been enriched by advances in computational chemistry and experimental techniques. Researchers have utilized sophisticated methods such as nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry (MS), and X-ray crystallography to elucidate its structure and behavior in different environments. These studies have provided valuable insights into the compound's stability, reactivity, and potential interactions with other molecules.
2-4-(propan-2-yl)phenylpropanal is particularly interesting due to its potential applications in the pharmaceutical industry. Its aldehyde functional group can participate in various chemical reactions, making it a useful intermediate in the synthesis of more complex molecules. For instance, it can be used as a building block for the development of new drugs, particularly those targeting specific biological pathways or receptors. Recent research has explored its role in the synthesis of compounds with anti-inflammatory, anti-cancer, and neuroprotective properties.
In the context of drug discovery, 2-4-(propan-2-yl)phenylpropanal has been investigated for its ability to modulate enzyme activity. Enzymes play crucial roles in many biological processes, and their inhibition or activation can have therapeutic benefits. Studies have shown that derivatives of 2-4-(propan-2-yl)phenylpropanal can effectively inhibit certain enzymes involved in disease pathways, making them promising candidates for further development.
Beyond pharmaceutical applications, 2-4-(propan-2-yl)phenylpropanal has also found use in materials science. Its unique chemical structure makes it suitable for the synthesis of polymers and other advanced materials. For example, it can be incorporated into polymer chains to enhance their mechanical properties or to introduce specific functional groups that confer desired characteristics such as biodegradability or biocompatibility.
The environmental impact of 2-4-(propan-2-yl)phenylpropanal is another area of active research. Scientists are investigating its biodegradability and potential effects on ecosystems to ensure its safe use in industrial processes. Preliminary studies suggest that under certain conditions, this compound can be broken down by microorganisms, reducing its environmental footprint.
In conclusion, 2-4-(propan-2-yl)phenylpropanal (CAS No. 34291-99-1) is a multifaceted compound with a wide range of applications in chemistry and related fields. Its unique molecular structure and chemical properties make it a valuable tool for researchers and industry professionals alike. As ongoing research continues to uncover new insights and applications, the importance of this compound is likely to grow even further.
34291-99-1 (2-4-(propan-2-yl)phenylpropanal) Related Products
- 93-53-8(2-Phenylpropanal)
- 947-91-1(Diphenylacetaldehyde (>80%))
- 4395-92-0(2-[4-(propan-2-yl)phenyl]acetaldehyde)
- 27956-35-0(2-(4-Methylphenyl)malonaldehyde)
- 1335-44-0(Benzeneacetaldehyde,ar-(1-methylethyl)-)
- 26591-66-2(2-Phenylmalondialdehyde)
- 109347-45-7(2-(4-tert-butylphenyl)acetaldehyde)
- 849021-24-5(2-(3-Methylphenyl)malondialdehyde)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)