Cas no 2060033-06-7 (2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride)
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride Chemical and Physical Properties
Names and Identifiers
-
- 2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride
-
- MDL: MFCD30535935
- Inchi: 1S/C13H17NO2.ClH/c15-13(16)12(11-5-1-2-6-11)8-10-4-3-7-14-9-10;/h3-4,7,9,11-12H,1-2,5-6,8H2,(H,15,16);1H
- InChI Key: IPUYQGFIMWZEHS-UHFFFAOYSA-N
- SMILES: C(C1CCCC1)(C(=O)O)CC1=CN=CC=C1.Cl
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-344935-0.05g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95.0% | 0.05g |
$205.0 | 2025-03-18 | |
| Enamine | EN300-344935-0.1g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95.0% | 0.1g |
$306.0 | 2025-03-18 | |
| Enamine | EN300-344935-0.25g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95.0% | 0.25g |
$438.0 | 2025-03-18 | |
| Enamine | EN300-344935-0.5g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95.0% | 0.5g |
$691.0 | 2025-03-18 | |
| Enamine | EN300-344935-1.0g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95.0% | 1.0g |
$884.0 | 2025-03-18 | |
| Enamine | EN300-344935-2.5g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95.0% | 2.5g |
$1735.0 | 2025-03-18 | |
| Enamine | EN300-344935-5.0g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95.0% | 5.0g |
$2566.0 | 2025-03-18 | |
| Enamine | EN300-344935-10.0g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95.0% | 10.0g |
$3807.0 | 2025-03-18 | |
| Enamine | EN300-344935-1g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95% | 1g |
$884.0 | 2023-11-13 | |
| Enamine | EN300-344935-5g |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride |
2060033-06-7 | 95% | 5g |
$2566.0 | 2023-11-13 |
2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride Related Literature
-
Luke L. Lairson,Warren W. Wakarchuk Chem. Commun., 2007, 365-367
-
Adeline Huiling Loo,Alessandra Bonanni,Martin Pumera Analyst, 2013,138, 467-471
-
Priyambada Nayak,Tanmaya Badapanda,Anil Kumar Singh,Simanchalo Panigrahi RSC Adv., 2017,7, 16319-16331
-
4. An all-solid-state imprinted polymer-based potentiometric sensor for determination of bisphenol S?Rongning Liang,Tanji Yin,Ruiqing Yao,Wei Qin RSC Adv., 2016,6, 73308-73312
Additional information on 2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride
2-Cyclopentyl-3-(pyridin-3-yl)propanoic Acid Hydrochloride: A Comprehensive Overview
The compound 2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride, identified by the CAS number 2060033-06-7, is a fascinating molecule with significant potential in the fields of pharmacology and organic chemistry. This compound is a hydrochloride salt of a propanoic acid derivative, featuring a cyclopentyl group and a pyridin-3-yl substituent. Its unique structure endows it with intriguing chemical properties and biological activities, making it a subject of interest for researchers and industry professionals alike.
Recent studies have highlighted the importance of cyclopentyl and pyridin-3-yl substituents in modulating the pharmacokinetic and pharmacodynamic profiles of bioactive molecules. The cyclopentyl group, known for its stability and flexibility, contributes to the molecule's ability to interact with biological targets. On the other hand, the pyridin-3-yl group introduces electron-withdrawing effects, which can enhance the compound's solubility and bioavailability. These properties make 2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride a promising candidate for drug development.
The synthesis of this compound involves a multi-step process that combines principles from organic chemistry, including nucleophilic substitution, condensation reactions, and acid-base chemistry. Researchers have optimized synthetic pathways to achieve high yields and purity levels, ensuring that the compound meets rigorous quality standards for pharmaceutical applications. The use of advanced analytical techniques, such as high-performance liquid chromatography (HPLC) and mass spectrometry, has been instrumental in confirming the compound's identity and characterizing its physical properties.
In terms of biological activity, 2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride has demonstrated potential as a modulator of various cellular pathways. Preclinical studies suggest that it may exhibit anti-inflammatory, antioxidant, or neuroprotective effects, depending on its target receptor profile. These findings align with current trends in drug discovery, where small molecules with multiple functional groups are increasingly sought after for their ability to address complex diseases.
The application of computational chemistry tools has further enhanced our understanding of this compound's behavior at the molecular level. Molecular docking studies have provided insights into how the cyclopentyl and pyridin-3-yl groups influence binding affinity to specific protein targets. Additionally, quantum mechanical calculations have shed light on the electronic structure of the molecule, revealing key interactions that contribute to its stability and reactivity.
From an environmental perspective, researchers have also investigated the eco-toxicological profile of 2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride. Studies indicate that it exhibits low toxicity towards aquatic organisms under standard test conditions. This information is crucial for assessing its potential impact on ecosystems during industrial or pharmaceutical processes.
In conclusion, 2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride represents a compelling example of how structural diversity can be leveraged to design molecules with tailored functionalities. As research continues to uncover its full potential, this compound is poised to make significant contributions to both academic research and industrial applications.
2060033-06-7 (2-cyclopentyl-3-(pyridin-3-yl)propanoic acid hydrochloride) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)