Cas no 1806830-25-0 (3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine)
3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine Chemical and Physical Properties
Names and Identifiers
-
- 3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine
-
- Inchi: 1S/C7H2BrF6N/c8-4-3(5(9)10)2(7(12,13)14)1-15-6(4)11/h1,5H
- InChI Key: ATIOPCHMONBDMO-UHFFFAOYSA-N
- SMILES: BrC1=C(N=CC(C(F)(F)F)=C1C(F)F)F
Computed Properties
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 7
- Heavy Atom Count: 15
- Rotatable Bond Count: 1
- Complexity: 220
- XLogP3: 3.5
- Topological Polar Surface Area: 12.9
3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Alichem | A029061692-250mg |
3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine |
1806830-25-0 | 97% | 250mg |
$988.80 | 2022-03-31 | |
| Alichem | A029061692-500mg |
3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine |
1806830-25-0 | 97% | 500mg |
$1,597.40 | 2022-03-31 | |
| Alichem | A029061692-1g |
3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine |
1806830-25-0 | 97% | 1g |
$3,039.60 | 2022-03-31 |
3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine Related Literature
-
Min Kim,Jae-Joon Lee,Tengling Ye,Panagiotis E. Keivanidis,Kilwon Cho J. Mater. Chem. C, 2020,8, 1686-1696
-
Chen-Yu Chien,Sheng-Sheng Yu Chem. Commun., 2020,56, 11949-11952
-
Christopher J. Harrison,Kyle J. Berean,Enrico Della Gaspera,Jian Zhen Ou,Richard B. Kaner,Kourosh Kalantar-zadeh,Torben Daeneke Nanoscale, 2016,8, 16276-16283
-
5. Excimer emission and magnetoluminescence of radical-based zinc(ii) complexes doped in host crystals?Shojiro Kimura,Tetsuro Kusamoto Chem. Commun., 2020,56, 11195-11198
Additional information on 3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine
Introduction to 3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine (CAS No. 1806830-25-0)
3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine, with the CAS number 1806830-25-0, is a highly specialized compound that has garnered significant attention in the fields of medicinal chemistry and pharmaceutical research. This compound is characterized by its unique structural features, including a bromo group, difluoromethyl, fluoro, and trifluoromethyl substituents on a pyridine ring. These functional groups contribute to its diverse chemical properties and potential applications in drug discovery and development.
The synthesis of 3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine involves a series of well-defined chemical reactions. The initial step typically involves the bromination of a pyridine derivative, followed by the introduction of the difluoromethyl and trifluoromethyl groups through specific fluorination techniques. The fluoro substitution is often achieved through electrophilic or nucleophilic fluorination reactions. These synthetic methods are crucial for producing the compound with high purity and yield, which is essential for its use in research and development.
One of the key areas where 3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine has shown promise is in the development of novel pharmaceutical agents. The presence of multiple fluorine atoms in the molecule can significantly enhance its pharmacological properties, such as metabolic stability, bioavailability, and target selectivity. Recent studies have demonstrated that compounds with similar structural features exhibit potent activity against various biological targets, including enzymes, receptors, and ion channels.
In the context of medicinal chemistry, 3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine has been explored as a lead compound for the design of drugs targeting specific diseases. For instance, it has been investigated for its potential as an inhibitor of kinases, which are key enzymes involved in signal transduction pathways and are often dysregulated in diseases such as cancer and inflammatory disorders. The bromo group in the molecule can facilitate binding to specific protein pockets, enhancing its efficacy as a therapeutic agent.
Beyond its use in drug discovery, 3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine has also found applications in other areas of chemical research. Its unique electronic properties make it an attractive candidate for use in materials science, particularly in the development of functional materials for electronic and optical devices. The presence of multiple fluorine atoms can influence the electronic structure and charge transport properties of materials, making them suitable for advanced technological applications.
The safety and environmental impact of 3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine are important considerations in its use. Rigorous safety assessments are conducted to ensure that the compound meets regulatory standards for handling and disposal. These assessments include evaluating its toxicity, mutagenicity, and environmental persistence. Additionally, efforts are made to develop more sustainable synthetic routes that minimize waste generation and reduce the environmental footprint of its production.
In conclusion, 3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine (CAS No. 1806830-25-0) is a versatile compound with significant potential in various fields of chemistry and pharmaceutical research. Its unique structural features make it an attractive candidate for drug discovery and development, as well as other advanced applications. Ongoing research continues to uncover new insights into its properties and applications, further highlighting its importance in modern scientific endeavors.
1806830-25-0 (3-Bromo-4-(difluoromethyl)-2-fluoro-5-(trifluoromethyl)pyridine) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)