Cas no 1361910-23-7 (3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde)
3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde Chemical and Physical Properties
Names and Identifiers
-
- 3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde
-
- Inchi: 1S/C8H3F3N2O2/c9-8(10,11)15-7-6(2-12)1-5(4-14)3-13-7/h1,3-4H
- InChI Key: KEPKMOJZZPRWDI-UHFFFAOYSA-N
- SMILES: FC(OC1C(C#N)=CC(C=O)=CN=1)(F)F
Computed Properties
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 7
- Heavy Atom Count: 15
- Rotatable Bond Count: 2
- Complexity: 283
- XLogP3: 1.5
- Topological Polar Surface Area: 63
3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Alichem | A026002985-250mg |
3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde |
1361910-23-7 | 97% | 250mg |
652.80 USD | 2021-05-31 | |
| Alichem | A026002985-500mg |
3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde |
1361910-23-7 | 97% | 500mg |
1,038.80 USD | 2021-05-31 | |
| Alichem | A026002985-1g |
3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde |
1361910-23-7 | 97% | 1g |
1,848.00 USD | 2021-05-31 |
3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde Related Literature
-
Teresita Carrillo-Hernández,Philippe Schaeffer,Pierre Albrecht Chem. Commun., 2001, 1976-1977
-
Huiying Xu,Lu Zheng,Yu Zhou,Bang-Ce Ye Analyst, 2021,146, 5542-5549
-
Haitao Li,Yu Pan,Zhizhi Wang,Shan Chen,Ruixin Guo,Jianqiu Chen RSC Adv., 2015,5, 100775-100782
-
Bidyut Kumar Kundu,Rinky Singh,Ritudhwaj Tiwari,Debasis Nayak New J. Chem., 2019,43, 4867-4877
-
Yang Xu,Min Wang,Donghui Wei,Rongqiang Tian,Zheng Duan,Fran?ois Mathey Dalton Trans., 2019,48, 5523-5526
Additional information on 3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde
Professional Introduction to 3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde (CAS No. 1361910-23-7)
3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde is a highly specialized organic compound that has garnered significant attention in the field of pharmaceutical chemistry and medicinal biology. This compound, with the CAS number 1361910-23-7, is characterized by its unique structural features, which include a cyano group, a trifluoromethoxy substituent, and an aldehyde functionality. These structural elements not only contribute to its distinct chemical properties but also open up a wide range of potential applications in drug discovery and development.
The presence of the cyano group in the molecule imparts a certain level of reactivity that makes it a valuable intermediate in synthetic chemistry. The cyano group can participate in various chemical reactions, such as nucleophilic addition and condensation reactions, which are commonly employed in the synthesis of more complex molecules. This reactivity is particularly useful in the construction of heterocyclic compounds, which are prevalent in many pharmaceuticals.
On the other hand, the trifluoromethoxy substituent introduces a fluorine atom into the molecule, which is known for its ability to modulate metabolic stability and binding affinity. Fluorinated compounds often exhibit enhanced bioavailability and improved pharmacokinetic profiles, making them highly desirable in drug design. The trifluoromethoxy group can also influence the electronic properties of the molecule, thereby affecting its interactions with biological targets.
The aldehyde functionality at the 5-position of the pyridine ring provides another layer of reactivity that can be exploited for further derivatization. Aldehydes are versatile intermediates that can undergo condensation reactions with various nucleophiles, including amines and hydrazines, to form imines or hydrazones. These derivatives can then be further functionalized to produce more complex structures with tailored biological activities.
In recent years, there has been growing interest in exploring the pharmacological potential of pyridine derivatives. Pyridine-based compounds have shown promise in various therapeutic areas, including oncology, inflammation, and central nervous system disorders. The combination of different functional groups in 3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde makes it a particularly interesting candidate for further investigation.
One of the most compelling aspects of this compound is its potential as a building block for the synthesis of novel drug candidates. The structural features of 3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde allow for diverse modifications, enabling chemists to explore different pharmacophores and optimize biological activity. For instance, by introducing additional substituents or altering existing functional groups, researchers can fine-tune the properties of the molecule to enhance its efficacy and selectivity.
The aldehyde group, in particular, serves as a versatile handle for further chemical transformations. It can be used to form Schiff bases with various nitrogen-containing compounds, which have been shown to exhibit a wide range of biological activities. Additionally, it can undergo condensation reactions with hydrazines to produce hydrazones, which are known to possess antimicrobial and anti-inflammatory properties.
The trifluoromethoxy group also plays a crucial role in modulating the biological activity of the compound. Fluorinated pyridines have been reported to exhibit improved binding affinity to target proteins due to the electronic effects induced by fluorine atoms. This can lead to enhanced drug potency and reduced side effects. Furthermore, fluorine atoms can improve metabolic stability by resisting oxidation and hydrolysis.
In academic research, 3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde has been utilized as a key intermediate in several synthetic protocols. For example, it has been employed in the preparation of fluorinated pyridine-based inhibitors targeting enzymes involved in cancer metabolism. These inhibitors have shown promising results in preclinical studies, highlighting the potential of this compound as a therapeutic agent.
Another area where this compound has found application is in the development of novel agrochemicals. Pyridine derivatives are widely used as active ingredients in pesticides and herbicides due to their ability to interact with biological targets in pests and weeds. The unique structural features of 3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde make it a valuable starting material for synthesizing new agrochemicals with improved efficacy and environmental safety.
The cyano group in the molecule also contributes to its utility as an intermediate in organic synthesis. Cyano-substituted compounds are often used as precursors for forming carboxylic acids through hydrolysis or for introducing amide functionalities through reaction with ammonia or amides. These transformations are essential in constructing more complex molecules with specific biological activities.
Recent advancements in computational chemistry have also facilitated the exploration of 3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde as a lead compound for drug discovery. Molecular modeling studies have been conducted to predict its binding interactions with various biological targets, providing insights into its potential therapeutic applications. These computational approaches have helped researchers identify key structural features that can be optimized to enhance drug-like properties.
In conclusion, 3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde (CAS No. 1361910-23-7) is a multifunctional compound with significant potential in pharmaceutical chemistry and medicinal biology. Its unique structural features make it a valuable intermediate for synthesizing novel drug candidates and agrochemicals. The combination of reactivity provided by the cyano group, trifluoromethoxy substituent, and aldehyde functionality offers numerous opportunities for further exploration and development.
1361910-23-7 (3-Cyano-2-(trifluoromethoxy)pyridine-5-carboxaldehyde) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)