Cas no 1260790-51-9 (1-Chloro-2-fluoro-5-methyl-3-nitrobenzene)
1-Chloro-2-fluoro-5-methyl-3-nitrobenzene Chemical and Physical Properties
Names and Identifiers
-
- 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene
- 3-Chloro-4-fluoro-5-nitrotoluene
-
- Inchi: 1S/C7H5ClFNO2/c1-4-2-5(8)7(9)6(3-4)10(11)12/h2-3H,1H3
- InChI Key: GEWCFHQAVJUARY-UHFFFAOYSA-N
- SMILES: ClC1C(=C(C=C(C)C=1)[N+](=O)[O-])F
Computed Properties
- Exact Mass: 188.9992843g/mol
- Monoisotopic Mass: 188.9992843g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 3
- Heavy Atom Count: 12
- Rotatable Bond Count: 0
- Complexity: 185
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- Topological Polar Surface Area: 45.8
- XLogP3: 2.8
1-Chloro-2-fluoro-5-methyl-3-nitrobenzene Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Alichem | A010011406-250mg |
3-Chloro-4-fluoro-5-nitrotoluene |
1260790-51-9 | 97% | 250mg |
$494.40 | 2023-09-03 | |
| Alichem | A010011406-1g |
3-Chloro-4-fluoro-5-nitrotoluene |
1260790-51-9 | 97% | 1g |
$1549.60 | 2023-09-03 | |
| Alichem | A010011406-100mg |
3-Chloro-4-fluoro-5-nitrotoluene |
1260790-51-9 | 97% | 100mg |
$325.00 | 2023-09-03 | |
| Ambeed | A512164-5g |
1-Chloro-2-fluoro-5-methyl-3-nitrobenzene |
1260790-51-9 | 95% | 5g |
$890.0 | 2024-04-25 | |
| Ambeed | A512164-100mg |
1-Chloro-2-fluoro-5-methyl-3-nitrobenzene |
1260790-51-9 | 95% | 100mg |
$56.0 | 2025-03-03 | |
| Ambeed | A512164-250mg |
1-Chloro-2-fluoro-5-methyl-3-nitrobenzene |
1260790-51-9 | 95% | 250mg |
$95.0 | 2025-03-03 | |
| Ambeed | A512164-1g |
1-Chloro-2-fluoro-5-methyl-3-nitrobenzene |
1260790-51-9 | 95% | 1g |
$255.0 | 2025-03-03 | |
| 1PlusChem | 1P000RQX-100mg |
Benzene, 1-chloro-2-fluoro-5-methyl-3-nitro- |
1260790-51-9 | 95% | 100mg |
$82.00 | 2024-07-09 | |
| 1PlusChem | 1P000RQX-250mg |
Benzene, 1-chloro-2-fluoro-5-methyl-3-nitro- |
1260790-51-9 | 95% | 250mg |
$125.00 | 2024-07-09 | |
| 1PlusChem | 1P000RQX-1g |
Benzene, 1-chloro-2-fluoro-5-methyl-3-nitro- |
1260790-51-9 | 95% | 1g |
$303.00 | 2024-07-09 |
1-Chloro-2-fluoro-5-methyl-3-nitrobenzene Related Literature
-
Gloria Belén Ramírez-Rodríguez,José Manuel Delgado-López,Jaime Gómez-Morales CrystEngComm, 2013,15, 2206-2212
-
J. Zagora,M. Vosla?,L. Schreiberová,I. Schreiber Phys. Chem. Chem. Phys., 2002,4, 1284-1291
-
3. Estimating and correcting interference fringes in infrared spectra in infrared hyperspectral imagingGhazal Azarfar,Ebrahim Aboualizadeh,Nicholas M. Walter,Simona Ratti,Camilla Olivieri,Alessandra Norici,Michael Nasse,Achim Kohler,Mario Giordano Analyst, 2018,143, 4674-4683
-
Saeideh Mirfakhraei,Malak Hekmati,Fereshteh Hosseini Eshbala,Hojat Veisi New J. Chem., 2018,42, 1757-1761
-
Xu Jie,Deng Xu,Weili Wei RSC Adv., 2019,9, 29149-29153
Additional information on 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene
Introduction to 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene (CAS No. 1260790-51-9)
1-Chloro-2-fluoro-5-methyl-3-nitrobenzene, identified by its Chemical Abstracts Service (CAS) number 1260790-51-9, is a fluorinated aromatic compound that has garnered significant attention in the field of pharmaceutical and agrochemical research. This compound belongs to the class of nitroaromatics, which are widely studied due to their versatile reactivity and potential applications in synthetic chemistry. The presence of multiple substituents—chloro, fluoro, and methyl groups—along with a nitro group—enhances its utility as an intermediate in the synthesis of more complex molecules.
The structural features of 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene make it a valuable building block for the development of novel chemical entities. The electron-withdrawing nature of the nitro group and the electron-donating effects of the fluoro and methyl groups contribute to its unique electronic properties, which can be exploited in various chemical transformations. For instance, the nitro group can be reduced to an amine, while the chloro and fluoro substituents can undergo nucleophilic substitution reactions, allowing for further functionalization.
In recent years, there has been a growing interest in fluorinated compounds due to their enhanced metabolic stability, lipophilicity, and binding affinity to biological targets. 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene exemplifies this trend, as its fluorine atom can play a crucial role in modulating the pharmacokinetic and pharmacodynamic properties of drug candidates. Studies have shown that fluorine atoms can increase the bioavailability of drugs by improving their solubility and membrane permeability. Additionally, the fluoro group can influence the binding interactions between a drug and its target protein, potentially leading to higher efficacy and selectivity.
Recent advancements in computational chemistry have further highlighted the importance of 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene as a key intermediate. Molecular modeling studies have demonstrated that this compound can serve as a scaffold for designing molecules with specific biological activities. For example, researchers have utilized it in the synthesis of kinase inhibitors, which are critical in treating various cancers and inflammatory diseases. The ability to predict the binding modes of such compounds using computational methods has accelerated the drug discovery process significantly.
The synthesis of 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene typically involves multi-step organic reactions, starting from commercially available aromatic precursors. One common synthetic route involves the nitration of 2-fluoromethyl chloride followed by chlorination and methylation at appropriate positions on the benzene ring. The precise control of reaction conditions is essential to achieve high yields and purity, as side reactions can lead to undesired byproducts.
In addition to its pharmaceutical applications, 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene has shown promise in agrochemical research. Fluorinated aromatic compounds are known for their effectiveness as pesticides and herbicides due to their stability under environmental conditions and their ability to interact with biological targets in pests. Researchers are exploring derivatives of this compound as potential candidates for next-generation crop protection agents.
The analytical characterization of 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene is another critical aspect of its study. Techniques such as nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry (MS), and high-performance liquid chromatography (HPLC) are routinely employed to confirm its identity and purity. These analytical methods provide detailed insights into the molecular structure and help ensure that the compound meets the required specifications for further use.
As research continues to evolve, new applications for 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene are likely to emerge. The growing demand for fluorinated compounds in drug development underscores the importance of developing efficient synthetic routes and understanding their reactivity patterns. Collaborative efforts between academia and industry are essential to harness the full potential of this compound and its derivatives.
In conclusion, 1-Chloro-2-fluoro-5-methyl-3-nitrobenzene (CAS No. 1260790-51-9) is a multifaceted compound with significant implications in pharmaceuticals and agrochemicals. Its unique structural features make it a valuable intermediate for synthesizing complex molecules with desired biological activities. Ongoing research continues to uncover new possibilities for its application, reinforcing its importance in modern chemical science.
1260790-51-9 (1-Chloro-2-fluoro-5-methyl-3-nitrobenzene) Related Products
- 2106-49-2(1-chloro-2-fluoro-3-nitro-benzene)
- 101646-02-0(3-Chloro-4-fluoro-5-nitrobenzotrifluoride)
- 1151767-58-6(1-Chloro-2,4-difluoro-3-nitrobenzene)
- 15952-70-2(3,5-Dichloro-2,4-difluoronitrobenzene)
- 1481-68-1(1-Chloro-2,4-difluoro-5-nitrobenzene)
- 170098-88-1(1-Chloro-4-fluoro-2-methyl-5-nitrobenzene)
- 112108-73-3(2-Chloro-4-fluoro-5-nitrotoluene)
- 3847-58-3(2-chloro-1,3-difluoro-4-nitro-benzene)
- 345-18-6(4-chloro-1-fluoro-2-nitro-benzene)
- 88488-37-3(Benzenamine, 3-chloro-2,4-difluoro-5-nitro-)