Cas no 1250652-63-1 (2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine)
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine Chemical and Physical Properties
Names and Identifiers
-
- 2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine
- Pyrimidine, 4-chloro-2-(1,1-dimethylethyl)-6-(methoxymethyl)-
-
- Inchi: 1S/C10H15ClN2O/c1-10(2,3)9-12-7(6-14-4)5-8(11)13-9/h5H,6H2,1-4H3
- InChI Key: WVNQUPSDOKLAMK-UHFFFAOYSA-N
- SMILES: C1(C(C)(C)C)=NC(COC)=CC(Cl)=N1
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Chemenu | CM468835-250mg |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95%+ | 250mg |
$447 | 2023-02-03 | |
| Chemenu | CM468835-500mg |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95%+ | 500mg |
$694 | 2023-02-03 | |
| Chemenu | CM468835-1g |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95%+ | 1g |
$884 | 2023-02-03 | |
| Enamine | EN300-106974-0.05g |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95% | 0.05g |
$202.0 | 2023-10-28 | |
| Enamine | EN300-106974-0.1g |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95% | 0.1g |
$301.0 | 2023-10-28 | |
| Enamine | EN300-106974-0.25g |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95% | 0.25g |
$431.0 | 2023-10-28 | |
| Enamine | EN300-106974-0.5g |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95% | 0.5g |
$679.0 | 2023-10-28 | |
| Enamine | EN300-106974-1.0g |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95% | 1.0g |
$871.0 | 2023-07-08 | |
| Enamine | EN300-106974-2.5g |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95% | 2.5g |
$1707.0 | 2023-10-28 | |
| Enamine | EN300-106974-5.0g |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine |
1250652-63-1 | 95% | 5.0g |
$2525.0 | 2023-07-08 |
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine Related Literature
-
Zhiyan Chen,Nan Wu,Yaobing Wang,Bing Wang,Yingde Wang J. Mater. Chem. A, 2018,6, 516-526
-
Brindha J.,Balamurali M. M.,Kaushik Chanda RSC Adv., 2019,9, 34720-34734
-
Shintaro Takata,Yoshihiro Miura Phys. Chem. Chem. Phys., 2014,16, 24784-24789
-
Weili Dai,Guangjun Wu,Michael Hunger Chem. Commun., 2015,51, 13779-13782
Additional information on 2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine
Professional Introduction to 2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine (CAS No. 1250652-63-1)
2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine, with the CAS number 1250652-63-1, is a significant compound in the field of pharmaceutical and agrochemical research. This pyrimidine derivative has garnered attention due to its versatile applications in the synthesis of active pharmaceutical ingredients (APIs) and specialty chemicals. The compound's unique structural features, including a tert-butyl group, a chloro substituent, and a methoxymethyl moiety, make it a valuable intermediate in organic synthesis.
The tert-butyl group enhances the steric stability of the pyrimidine ring, making it more resistant to unwanted side reactions during synthesis. This property is particularly useful in multi-step synthetic pathways where regioselectivity and stability are critical. The presence of the chloro substituent allows for further functionalization via nucleophilic substitution reactions, enabling the introduction of various pharmacophores. Additionally, the methoxymethyl group serves as a protecting group for hydroxyl or carboxylic acid functionalities, facilitating controlled reactions in drug development.
In recent years, 2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine has been extensively studied for its potential in the development of novel therapeutic agents. Its structural framework is closely related to several known bioactive compounds, suggesting its utility in designing new drugs with improved pharmacokinetic properties. For instance, researchers have explored its role in synthesizing kinase inhibitors, which are crucial in treating cancers and inflammatory diseases. The compound's ability to serve as a precursor for heterocyclic scaffolds has made it a focal point in medicinal chemistry.
The agrochemical industry has also recognized the importance of this compound. Its derivatives have been investigated for their efficacy as herbicides and fungicides. The combination of the tert-butyl, chloro, and methoxymethyl groups contributes to its bioactivity by enhancing binding affinity to target enzymes in plants. Recent studies have demonstrated that modifications of this pyrimidine derivative can lead to compounds with higher selectivity and lower environmental impact.
Synthetic methodologies involving 2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine have seen significant advancements. Modern techniques such as transition metal-catalyzed cross-coupling reactions have enabled more efficient and scalable production processes. These methods not only improve yield but also minimize waste, aligning with green chemistry principles. The compound's reactivity with palladium and copper catalysts has been particularly noteworthy, allowing for the introduction of aryl and vinyl groups with high precision.
The role of computational chemistry in optimizing synthetic routes for 2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine cannot be overstated. Molecular modeling software has been instrumental in predicting reaction outcomes and identifying optimal conditions. By simulating various reaction pathways, scientists can reduce experimental trials and accelerate drug discovery processes. This computational approach has also helped in understanding the mechanistic details of how different functional groups influence the overall reactivity of the compound.
In conclusion, 2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine (CAS No. 1250652-63-1) is a multifaceted compound with broad applications in pharmaceuticals and agrochemicals. Its unique structural features make it an invaluable intermediate in synthetic chemistry, while its bioactive derivatives hold promise for developing new treatments for various diseases. As research continues to evolve, this compound will undoubtedly remain at the forefront of chemical innovation.
1250652-63-1 (2-tert-butyl-4-chloro-6-(methoxymethyl)pyrimidine) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)