Cas no 1041853-21-7 (6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid)
6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid Chemical and Physical Properties
Names and Identifiers
-
- 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid
- SCHEMBL1579481
- 1041853-21-7
- 6-Bromo-4-hydroxy-7-methoxycinnoline-3-carboxylicacid
- DB-318051
- GNPLYSQHMYSTFK-UHFFFAOYSA-N
-
- MDL: MFCD25954754
- Inchi: 1S/C10H7BrN2O4/c1-17-7-3-6-4(2-5(7)11)9(14)8(10(15)16)13-12-6/h2-3H,1H3,(H,12,14)(H,15,16)
- InChI Key: GNPLYSQHMYSTFK-UHFFFAOYSA-N
- SMILES: BrC1C(=CC2=C(C(C(C(=O)O)=NN2)=O)C=1)OC
Computed Properties
- Exact Mass: 297.95892Da
- Monoisotopic Mass: 297.95892Da
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 2
- Hydrogen Bond Acceptor Count: 6
- Heavy Atom Count: 17
- Rotatable Bond Count: 2
- Complexity: 385
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 2.5
- Topological Polar Surface Area: 88?2
6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid Security Information
- Storage Condition:(BD282004)
6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Alichem | A449041589-1g |
6-Bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid |
1041853-21-7 | 95% | 1g |
$1016.97 | 2023-09-04 | |
| Ambeed | A141925-1g |
6-Bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid |
1041853-21-7 | 95+% | 1g |
$933.0 | 2025-02-21 | |
| Chemenu | CM484768-1g |
6-Bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid |
1041853-21-7 | 95% | 1g |
$1120 | 2023-11-26 |
6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid Related Literature
-
Jingquan Liu,Huiyun Liu,Zhongfan Jia,Volga Bulmus,Thomas P. Davis Chem. Commun., 2008, 6582-6584
-
Kanjun Sun,Fengting Hua,Shuzhen Cui,Yanrong Zhu,Hui Peng,Guofu Ma RSC Adv., 2021,11, 37631-37642
-
3. An integrated microfluidic 3D tumor system for parallel and high-throughput chemotherapy evaluation?Dan Liu,Rui Hu,Zhongchao Huang,Meilin Sun,Kai Han Analyst, 2020,145, 6447-6455
-
Haitao Li,Yu Pan,Zhizhi Wang,Shan Chen,Ruixin Guo,Jianqiu Chen RSC Adv., 2015,5, 100775-100782
-
Teresita Carrillo-Hernández,Philippe Schaeffer,Pierre Albrecht Chem. Commun., 2001, 1976-1977
Additional information on 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid
Introduction to 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid (CAS No. 1041853-21-7)
6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid, identified by the CAS number 1041853-21-7, is a specialized organic compound that has garnered significant attention in the field of pharmaceutical chemistry and medicinal research. This compound belongs to the cinnoline derivatives, a class of heterocyclic compounds known for their diverse biological activities and potential therapeutic applications. The structural features of 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid, including the presence of bromine, hydroxyl, and methoxy functional groups, contribute to its unique chemical properties and reactivity, making it a valuable scaffold for drug discovery and development.
The significance of 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid in modern medicinal chemistry is underscored by its role as a key intermediate in the synthesis of various bioactive molecules. Researchers have leveraged its structural framework to develop compounds with potential applications in treating a range of diseases, including cancer, inflammation, and infectious disorders. The bromine substituent, in particular, enhances the compound's electrophilicity, facilitating further functionalization and enabling the creation of more complex derivatives with tailored pharmacological profiles.
Recent advancements in synthetic methodologies have enabled more efficient and scalable production of 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid, making it more accessible for academic and industrial research. These improvements have not only reduced production costs but also opened new avenues for exploring its biological activities. For instance, studies have demonstrated its potential as an anti-inflammatory agent by modulating key signaling pathways involved in immune responses.
The hydroxyl group in 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid plays a crucial role in its interactions with biological targets. This functional group can participate in hydrogen bonding, enhancing the compound's binding affinity to proteins and enzymes. Such interactions are critical for developing drugs that can effectively target specific disease mechanisms. Additionally, the methoxy group contributes to the compound's solubility and metabolic stability, factors that are essential for drug efficacy and safety.
In the realm of oncology research, 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid has been investigated for its potential anticancer properties. Preclinical studies have shown that derivatives of this compound can inhibit the growth of various cancer cell lines by interfering with critical cellular processes such as DNA replication and cell cycle progression. The bromine atom's ability to participate in cross-coupling reactions has been particularly useful in generating novel anticancer agents that exhibit higher selectivity and lower toxicity compared to existing therapies.
The pharmaceutical industry has also explored 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid as a precursor for developing antiviral drugs. Its structural motif has been incorporated into molecules designed to target viral enzymes essential for replication. By inhibiting these enzymes, such compounds can prevent viral propagation within host cells. This approach has shown promise in early-stage trials against RNA viruses, highlighting the compound's versatility in addressing different therapeutic challenges.
Beyond its applications in drug development, 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid has found utility in chemical biology research. Its unique structure allows researchers to probe fundamental biological processes by designing probes that interact with specific targets. These probes can provide insights into cellular mechanisms and aid in the discovery of new therapeutic targets.
The synthesis of 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid involves multi-step organic reactions that require careful optimization to ensure high yield and purity. Modern synthetic techniques, such as flow chemistry and catalytic methods, have improved the efficiency of these processes. These advancements not only enhance the scalability of production but also minimize waste generation, aligning with sustainable chemistry principles.
In conclusion, 6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid (CAS No. 1041853-21-7) is a versatile compound with significant potential in pharmaceutical research and drug development. Its unique structural features enable diverse biological activities, making it a valuable tool for exploring new therapeutic strategies across multiple disease areas. As research continues to uncover new applications for this compound, its importance in advancing medicinal chemistry is likely to grow further.
1041853-21-7 (6-bromo-4-hydroxy-7-methoxycinnoline-3-carboxylic acid) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)