Cas no 103483-32-5 (Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl-)
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- Chemical and Physical Properties
Names and Identifiers
-
- Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl-
- tert-butyl-(6-iodohexoxy)-dimethylsilane
- (1,1-Dimethylethyl)[(6-iodohexyl)oxy]dimethylsilane
- TERT-BUTYL[(6-IODOHEXYL)OXY]DIMETHYLSILANE
- SCHEMBL3272074
- tert-butyl(6-iodohexyloxy)dimethylsilane
- DTXSID20553523
- MFCD20257310
- F80568
- 1-(tert-Butyldimethylsiloxy)-6-iodohexane
- 1-(tert-butyldimethylsilyloxy)-6-iodo-hexane
- 103483-32-5
- TERT-BUTYL((6-IODOHEXYL)OXY)DIMETHYLSILANE
- UPYCEVUYBCJLIP-UHFFFAOYSA-N
- SY318911
- DB-189569
-
- Inchi: 1S/C12H27IOSi/c1-12(2,3)15(4,5)14-11-9-7-6-8-10-13/h6-11H2,1-5H3
- InChI Key: UPYCEVUYBCJLIP-UHFFFAOYSA-N
- SMILES: ICCCCCCO[Si](C)(C)C(C)(C)C
Computed Properties
- Exact Mass: 342.08721
- Monoisotopic Mass: 342.08759g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 1
- Heavy Atom Count: 15
- Rotatable Bond Count: 8
- Complexity: 164
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- Topological Polar Surface Area: 9.2?2
Experimental Properties
- PSA: 9.23
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Aaron | AR01G0X5-500mg |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97% | 500mg |
$197.00 | 2025-02-13 | |
| Aaron | AR01G0X5-1g |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97% | 1g |
$292.00 | 2025-02-13 | |
| Aaron | AR01G0X5-5g |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97% | 5g |
$863.00 | 2025-02-13 | |
| 1PlusChem | 1P01G0OT-250mg |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97.0% | 250mg |
$115.00 | 2023-12-26 | |
| 1PlusChem | 1P01G0OT-500mg |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97.0% | 500mg |
$185.00 | 2023-12-26 | |
| 1PlusChem | 1P01G0OT-1g |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97.0% | 1g |
$255.00 | 2023-12-26 | |
| 1PlusChem | 1P01G0OT-5g |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97.0% | 5g |
$355.00 | 2023-12-26 | |
| A2B Chem LLC | AY26205-250mg |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97.0% | 250mg |
$135.00 | 2024-04-20 | |
| A2B Chem LLC | AY26205-500mg |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97.0% | 500mg |
$223.00 | 2024-04-20 | |
| A2B Chem LLC | AY26205-1g |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- |
103483-32-5 | 97.0% | 1g |
$310.00 | 2024-04-20 |
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- Related Literature
-
Xin Fu,Qing-rong Liang,Rong-guang Luo,Yan-shu Li,Xiao-ping Xiao,Lu-lu Yu,Wen-zhe Shan,Guang-qin Fan J. Mater. Chem. B, 2019,7, 3088-3099
-
3. An integrated microfluidic 3D tumor system for parallel and high-throughput chemotherapy evaluation?Dan Liu,Rui Hu,Zhongchao Huang,Meilin Sun,Kai Han Analyst, 2020,145, 6447-6455
-
Kanjun Sun,Fengting Hua,Shuzhen Cui,Yanrong Zhu,Hui Peng,Guofu Ma RSC Adv., 2021,11, 37631-37642
-
Ni-Na Sun,Fengli Qu,Xiaobing Zhang,Shufang Zhang,Jinmao You Analyst, 2015,140, 1827-1831
Additional information on Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl-
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- (CAS No. 103483-32-5): A Comprehensive Overview
Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- (CAS No. 103483-32-5) is a specialized chemical compound that has gained significant attention in recent years due to its unique properties and potential applications in various fields, particularly in materials science and pharmaceutical research. This compound is a silane derivative with a specific functional group that imparts distinct chemical and physical characteristics.
The molecular structure of Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- is characterized by a silicon atom bonded to two methyl groups and an alkyl chain with an iodine substituent. The presence of the iodine atom at the terminal end of the hexyl chain makes this compound highly reactive and versatile for various chemical transformations. This reactivity is particularly valuable in the synthesis of complex organic molecules and in the development of advanced materials.
Recent research has highlighted the potential of Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- in the field of polymer science. Studies have shown that this compound can be used as a coupling agent to improve the adhesion between different materials, such as polymers and inorganic surfaces. This property is crucial for developing high-performance composites and coatings with enhanced mechanical and thermal stability.
In the pharmaceutical industry, Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- has shown promise as a precursor for the synthesis of drug delivery systems. The iodine substituent can be readily functionalized to introduce bioactive molecules or targeting ligands, making it a valuable intermediate in the development of targeted therapies. Additionally, its ability to form stable siloxane bonds can enhance the stability and biocompatibility of drug delivery vehicles.
The synthesis of Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- typically involves several steps, including the preparation of the iodinated alkyl chain and its subsequent reaction with a suitable silane reagent. Recent advancements in synthetic methods have led to more efficient and environmentally friendly processes for producing this compound. For example, researchers have developed catalysts that can significantly reduce reaction times and improve yields while minimizing by-product formation.
In terms of safety and handling, it is important to note that Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- should be stored under inert conditions to prevent degradation. It is also advisable to handle this compound with appropriate personal protective equipment (PPE) to ensure safety during laboratory operations.
The environmental impact of Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- is another area of ongoing research. While the compound itself is not classified as hazardous under current regulations, its potential effects on ecosystems must be carefully evaluated. Studies are being conducted to assess its biodegradability and toxicity to aquatic organisms.
In conclusion, Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl- (CAS No. 103483-32-5) is a versatile and promising compound with a wide range of applications in materials science and pharmaceutical research. Its unique chemical structure and reactivity make it an essential component in various advanced technologies. As research continues to advance, it is likely that new applications for this compound will be discovered, further expanding its utility and impact in these fields.
103483-32-5 (Silane, (1,1-dimethylethyl)[(6-iodohexyl)oxy]dimethyl-) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)