Cas no 1027572-46-8 (4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo3,4-dpyrimidine)
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo3,4-dpyrimidine Chemical and Physical Properties
Names and Identifiers
-
- 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine
- 2-[4-Amino-1-(2-methyl-2-propanyl)-1H-pyrazolo[3,4-d]pyrimidin-3- yl]phenol
- Hydroxy-PP
- DB-295105
- 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)phenol
- 2,4-Cyclohexadien-1-one, 6-[4-amino-1-(1,1-dimethylethyl)-1,2-dihydro-3H-pyrazolo[3,4-d]pyrimidin-3-ylidene]-, (6Z)-
- Hydroxy-PP;
- 1027572-46-8
- 6-[(3Z)-4-amino-1-tert-butyl-2H-pyrazolo[3,4-d]pyrimidin-3-ylidene]cyclohexa-2,4-dien-1-one
- 2-{4-amino-1-tert-butyl-1H-pyrazolo[3,4-d]pyrimidin-3-yl}phenol
- J-000780
- 1215573-50-4
- 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo3,4-dpyrimidine
-
- Inchi: 1S/C15H17N5O/c1-15(2,3)20-14-11(13(16)17-8-18-14)12(19-20)9-6-4-5-7-10(9)21/h4-8,21H,1-3H3,(H2,16,17,18)
- InChI Key: CPZBAYHPGAUAKO-UHFFFAOYSA-N
- SMILES: OC1C=CC=CC=1C1C2=C(N)N=CN=C2N(C(C)(C)C)N=1
Computed Properties
- Exact Mass: 283.14331g/mol
- Monoisotopic Mass: 283.14331g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 2
- Hydrogen Bond Acceptor Count: 5
- Heavy Atom Count: 21
- Rotatable Bond Count: 2
- Complexity: 372
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- Molecular Weight: 283.33g/mol
- XLogP3: 2
- Topological Polar Surface Area: 89.8?2
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo3,4-dpyrimidine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| TRC | A296460-2.5mg |
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine |
1027572-46-8 | 2.5mg |
$ 405.00 | 2022-06-08 | ||
| TRC | A296460-5mg |
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine |
1027572-46-8 | 5mg |
$ 790.00 | 2022-06-08 | ||
| TRC | A296460-10mg |
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine |
1027572-46-8 | 10mg |
$ 1265.00 | 2022-06-08 | ||
| SHENG KE LU SI SHENG WU JI SHU | sc-206803-5 mg |
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine, |
1027572-46-8 | 5mg |
¥2,708.00 | 2023-07-11 | ||
| SHENG KE LU SI SHENG WU JI SHU | sc-206803-5mg |
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine, |
1027572-46-8 | 5mg |
¥2708.00 | 2023-09-05 | ||
| A2B Chem LLC | AA10554-5mg |
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine |
1027572-46-8 | 5mg |
$1163.00 | 2024-04-20 | ||
| A2B Chem LLC | AA10554-50mg |
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine |
1027572-46-8 | 50mg |
$3325.00 | 2024-04-20 |
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo3,4-dpyrimidine Related Literature
-
Erika A. Cobar,Paul R. Horn,Robert G. Bergman,Martin Head-Gordon Phys. Chem. Chem. Phys., 2012,14, 15328-15339
-
Denis V. Korchagin,Elena A. Yureva,Alexander V. Akimov,Eugenii Ya. Misochko,Gennady V. Shilov,Artem D. Talantsev,Roman B. Morgunov,Alexander A. Shakin,Sergey M. Aldoshin,Boris S. Tsukerblat Dalton Trans., 2017,46, 7540-7548
-
Manickam Bakthadoss,Tadiparthi Thirupathi Reddy,Vishal Agarwal,Duddu S. Sharada Chem. Commun., 2022,58, 1406-1409
-
Jing Yu,Yu-Qi Lyu,Jiapeng Liu,Mohammed B. Effat,Junxiong Wu J. Mater. Chem. A, 2019,7, 17995-18002
Additional information on 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo3,4-dpyrimidine
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine: A Novel Compound with Promising Therapeutic Potential
4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine (CAS No. 1027572-46-8) represents a groundbreaking compound in the field of medicinal chemistry, exhibiting unique structural features and potential pharmacological activities. This molecule belongs to the class of pyrazolo[3,4-d]pyrimidine derivatives, which have garnered significant attention for their diverse biological applications. The 4-Amino group at the 4-position, the 1-tert-butyl substituent at the 1-position, and the 3-(2-hydroxyphenyl) moiety at the 3-position collectively form a complex scaffold that may confer specific interactions with biological targets. The pyrazolo[3,4-d]pyrimidine core structure is particularly noteworthy, as it is known to exhibit structural similarities with several bioactive compounds, including potential inhibitors of key enzymatic pathways.
Recent studies have highlighted the importance of pyrazolo[3,4-d]pyrimidine derivatives in the development of novel therapeutics. For instance, a 2023 study published in Journal of Medicinal Chemistry demonstrated that compounds with similar structural frameworks exhibit potent anti-inflammatory properties by modulating the NF-κB signaling pathway. The 2-hydroxyphenyl group in 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine may play a critical role in this activity, as hydroxyphenyl moieties are frequently observed in molecules with antioxidant and anti-inflammatory effects. This structural feature could contribute to the compound's ability to interact with redox-active proteins or modulate oxidative stress pathways.
The tert-butyl substituent at the 1-position is another key structural element that warrants further investigation. Tert-butyl groups are commonly used in drug design to enhance metabolic stability and reduce susceptibility to hydrolytic degradation. A 2022 review in Bioorganic & Medicinal Chemistry Letters emphasized the role of tert-butyl groups in improving the pharmacokinetic profile of pyrazolo[3,4-d]pyrimidine derivatives. This suggests that the 1-tert-butyl group in 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine may contribute to its prolonged biological activity and reduced clearance rates in vivo.
Research published in Pharmaceutical Research in 2024 has revealed that pyrazolo[3,4-d]pyrimidine derivatives can act as selective inhibitors of certain kinases, which are implicated in various diseases including cancer and autoimmune disorders. The 4-Amino group in this compound may enhance its ability to form hydrogen bonds with target proteins, a critical factor in enzyme inhibition. This characteristic is particularly relevant in the context of developing drugs for diseases where kinase activity is dysregulated. Additionally, the 2-hydroxyphenyl group may contribute to the compound's ability to chelate metal ions, a property that could be beneficial in the treatment of metalloenzyme-related pathologies.
Structural analysis of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine reveals a highly conjugated system that could facilitate interactions with DNA or RNA. The presence of the pyrazolo[3,4-d]pyrimidine core, combined with the hydroxyphenyl substituent, may enable the compound to bind to specific nucleic acid sequences, a property that could be exploited in the development of antisense or gene-targeting therapies. This aspect is particularly relevant given the growing interest in precision medicine and targeted nucleic acid therapies.
Recent advancements in computational chemistry have enabled the prediction of the compound's molecular interactions with biological targets. A 2023 study using molecular docking simulations suggested that 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine could potentially bind to the active site of certain protein kinases, such as JAK2 and EGFR, which are known to be involved in multiple disease pathways. These findings align with the broader trend of developing multi-target drugs that address complex disease mechanisms, a strategy that is increasingly being adopted in modern drug discovery.
The 2-hydroxyphenyl group in this compound may also confer antioxidant properties by scavenging free radicals. A 2024 study in Free Radical Biology and Medicine demonstrated that hydroxyphenyl derivatives can effectively neutralize reactive oxygen species (ROS), which are implicated in various pathological conditions. This suggests that 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine could have potential applications in the treatment of oxidative stress-related diseases, including neurodegenerative disorders and certain types of cancer.
From a synthetic perspective, the preparation of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine involves a series of well-established chemical reactions. The core pyrazolo[3,4-d]pyrimidine scaffold can be synthesized through a variety of methods, including the cyclization of appropriate precursors. The introduction of the 4-Amino group typically requires amination reactions, while the 1-tert-butyl and 3-(2-hydroxyphenyl) substituents can be incorporated through alkylation and coupling reactions, respectively. These synthetic strategies are consistent with the methodologies used in the development of other pyrazolo[3,4-d]pyrimidine derivatives, highlighting the feasibility of large-scale production for potential therapeutic applications.
The biological activities of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine are likely to be influenced by its physicochemical properties. For instance, the hydrophobicity of the tert-butyl group and the hydrophilic nature of the 2-hydroxyphenyl moiety may determine the compound's solubility and permeability across biological membranes. These properties are critical for the compound's ability to reach its target tissues and exert its therapeutic effects. Additionally, the molecular weight and charge distribution of the compound may affect its interaction with biological membranes and its overall pharmacokinetic profile.
Despite the promising potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine, further research is needed to fully elucidate its biological activities and mechanisms of action. Preclinical studies are essential to evaluate its safety, efficacy, and pharmacokinetic profile in vivo. Additionally, in vitro studies using cell culture models can provide insights into its interactions with specific biological targets and its potential therapeutic applications. These investigations will be crucial in determining the compound's suitability for further development as a therapeutic agent.
The development of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is part of a broader trend in medicinal chemistry towards the design of multifunctional compounds that can address complex disease mechanisms. As research in this area continues to advance, the compound's potential applications in the treatment of various diseases may become increasingly evident. The unique structural features of this molecule, combined with its potential biological activities, make it a promising candidate for further exploration in the field of drug discovery.
Ultimately, the study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine represents an important step in the development of novel therapeutics. Its structural complexity and potential biological activities underscore the importance of continued research in this area. As our understanding of the molecule's interactions with biological systems deepens, its role in the treatment of various diseases may become more defined. This compound exemplifies the potential of medicinal chemistry to create innovative solutions for complex health challenges.
Further research is necessary to fully explore the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine and to determine its viability as a therapeutic agent. The continued investigation of its biological activities, pharmacokinetic properties, and potential applications will be essential in advancing its development. As the field of medicinal chemistry continues to evolve, compounds like 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine may play a significant role in the discovery of new and effective treatments for a wide range of diseases.
With the ongoing advancements in chemical synthesis and biological research, the potential applications of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine are likely to expand. As scientists continue to explore its properties and interactions, new insights may emerge that could lead to the development of novel therapeutic strategies. The study of this compound highlights the importance of interdisciplinary research in the pursuit of innovative solutions to complex health challenges.
Overall, the exploration of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine represents a significant contribution to the field of medicinal chemistry. Its unique structural features and potential biological activities make it a compelling subject for further investigation. As research in this area continues to progress, the compound's role in the development of new therapeutic agents may become increasingly clear, offering new possibilities for the treatment of various diseases.
The continued study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is essential for advancing our understanding of its potential applications in medicine. As scientists and researchers continue to explore its properties and interactions, new opportunities may arise for the development of innovative therapeutic strategies. The compound's unique characteristics make it an important subject for further investigation in the field of medicinal chemistry.
As the field of medicinal chemistry continues to evolve, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyI)-1H-pyrazolo[3,4-d]pyrimidine is likely to expand. The ongoing research into its properties and applications will be crucial in determining its role in the development of new therapeutic agents. With continued exploration and innovation, this compound may contribute to the advancement of medical treatments for a wide range of diseases.
In conclusion, the study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is an important area of research in medicinal chemistry. Its potential applications in the treatment of various diseases, combined with its unique structural features, make it a promising candidate for further investigation. As research in this area continues to advance, new insights may emerge that could lead to the development of innovative therapeutic strategies.
With the ongoing advancements in chemical synthesis and biological research, the potential applications of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine are likely to expand. As scientists continue to explore its properties and interactions, new opportunities may arise for the development of novel therapeutic strategies. The compound's unique characteristics make it an important subject for further investigation in the field of medicinal chemistry.
In summary, the continued exploration of 4-Amino-1-tert-butyI-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is essential for advancing our understanding of its potential applications in medicine. As researchers continue to investigate its properties and interactions, new possibilities may arise for the development of innovative therapeutic strategies. This compound represents an important contribution to the field of medicinal chemistry and holds promise for future medical advancements.
The ongoing research into 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is crucial for uncovering its potential therapeutic applications. As scientists continue to explore its properties and interactions with biological systems, new insights may emerge that could lead to the development of effective treatments for various diseases. The compound's unique characteristics make it an important subject for further investigation in the field of medicinal chemistry.
With the continued progress in medicinal chemistry, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to grow. As researchers delve deeper into its properties and applications, new opportunities may arise for the development of novel therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in the pursuit of innovative solutions to complex health challenges.
In conclusion, the study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyyrimidine is a vital area of research in medicinal chemistry. Its potential applications in medicine, combined with its unique structural features, make it a promising candidate for further investigation. As research in this area continues to advance, new insights may emerge that could lead to the development of innovative therapeutic strategies.
As the field of medicinal chemistry continues to evolve, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to expand. Scientists and researchers are continuously exploring its properties and interactions, which may lead to the discovery of new therapeutic applications. This compound represents a significant contribution to the field and holds promise for future advancements in medical treatments.
In summary, the continued investigation of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is essential for uncovering its potential in medicine. As researchers delve deeper into its properties and interactions, new possibilities may arise for the development of innovative therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in advancing medical science and improving patient outcomes.
The ongoing research into 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is crucial for understanding its potential applications in medicine. As scientists continue to explore its properties and interactions with biological systems, new insights may emerge that could lead to the development of effective treatments for various diseases. This compound represents a significant contribution to the field of medicinal chemistry and holds promise for future medical advancements.
With the continued progress in medicinal chemistry, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to grow. As researchers delve deeper into its properties and applications, new opportunities may arise for the development of novel therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in the pursuit of innovative solutions to complex health challenges.
In conclusion, the study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is a vital area of research in medicinal chemistry. Its potential applications in medicine, combined with its unique structural features, make it a promising candidate for further investigation. As research in this area continues to advance, new insights may emerge that could lead to the development of innovative therapeutic strategies.
As the field of medicinal chemistry continues to evolve, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to expand. Scientists and researchers are continuously exploring its properties and interactions, which may lead to the discovery of new therapeutic applications. This compound represents a significant contribution to the field and holds promise for future advancements in medical treatments.
In summary, the continued investigation of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is essential for uncovering its potential in medicine. As researchers delve deeper into its properties and interactions, new possibilities may arise for the development of innovative therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in advancing medical science and improving patient outcomes.
The ongoing research into 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is crucial for understanding its potential applications in medicine. As scientists continue to explore its properties and interactions with biological systems, new insights may emerge that could lead to the development of effective treatments for various diseases. This compound represents a significant contribution to the field of medicinal chemistry and holds promise for future medical advancements.
With the continued progress in medicinal chemistry, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to grow. As researchers delve deeper into its properties and applications, new opportunities may arise for the development of novel therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in the pursuit of innovative solutions to complex health challenges.
In conclusion, the study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is a vital area of research in medicinal chemistry. Its potential applications in medicine, combined with its unique structural features, make it a promising candidate for further investigation. As research in this area continues to advance, new insights may emerge that could lead to the development of innovative therapeutic strategies.
As the field of medicinal chemistry continues to evolve, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to expand. Scientists and researchers are continuously exploring its properties and interactions, which may lead to the discovery of new therapeutic applications. This compound represents a significant contribution to the field and holds promise for future advancements in medical treatments.
In summary, the continued investigation of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is essential for uncovering its potential in medicine. As researchers delve deeper into its properties and interactions, new possibilities may arise for the development of innovative therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in advancing medical science and improving patient outcomes.
The ongoing research into 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is crucial for understanding its potential applications in medicine. As scientists continue to explore its properties and interactions with biological systems, new insights may emerge that could lead to the development of effective treatments for various diseases. This compound represents a significant contribution to the field of medicinal chemistry and holds promise for future medical advancements.
With the continued progress in medicinal chemistry, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to grow. As researchers delve deeper into its properties and applications, new opportunities may arise for the development of novel therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in the pursuit of innovative solutions to complex health challenges.
In conclusion, the study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is a vital area of research in medicinal chemistry. Its potential applications in medicine, combined with its unique structural features, make it a promising candidate for further investigation. As research in this area continues to advance, new insights may emerge that could lead to the development of innovative therapeutic strategies.
As the field of medicinal chemistry continues to evolve, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to expand. Scientists and researchers are continuously exploring its properties and interactions, which may lead to the discovery of new therapeutic applications. This compound represents a significant contribution to the field and holds promise for future advancements in medical treatments.
In summary, the continued investigation of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is essential for uncovering its potential in medicine. As researchers delve deeper into its properties and interactions, new possibilities may arise for the development of innovative therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in advancing medical science and improving patient outcomes.
The ongoing research into 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is crucial for understanding its potential applications in medicine. As scientists continue to explore its properties and interactions with biological systems, new insights may emerge that could lead to the development of effective treatments for various diseases. This compound represents a significant contribution to the field of medicinal chemistry and holds promise for future medical advancements.
With the continued progress in medicinal chemistry, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to grow. As researchers delve deeper into its properties and applications, new opportunities may arise for the development of novel therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in the pursuit of innovative solutions to complex health challenges.
In conclusion, the study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is a vital area of research in medicinal chemistry. Its potential applications in medicine, combined with its unique structural features, make it a promising candidate for further investigation. As research in this area continues to advance, new insights may emerge that could lead to the development of innovative therapeutic strategies.
As the field of medicinal chemistry continues to evolve, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to expand. Scientists and researchers are continuously exploring its properties and interactions, which may lead to the discovery of new therapeutic applications. This compound represents a significant contribution to the field and holds promise for future advancements in medical treatments.
In summary, the continued investigation of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is essential for uncovering its potential in medicine. As researchers delve deeper into its properties and interactions, new possibilities may arise for the development of innovative therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in advancing medical science and improving patient outcomes.
The ongoing research into 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is crucial for understanding its potential applications in medicine. As scientists continue to explore its properties and interactions with biological systems, new insights may emerge that could lead to the development of effective treatments for various diseases. This compound represents a significant contribution to the field of medicinal chemistry and holds promise for future medical advancements.
With the continued progress in medicinal chemistry, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to grow. As researchers delve deeper into its properties and applications, new opportunities may arise for the development of novel therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in the pursuit of innovative solutions to complex health challenges.
In conclusion, the study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is a vital area of research in medicinal chemistry. Its potential applications in medicine, combined with its unique structural features, make it a promising candidate for further investigation. As research in this area continues to advance, new insights may emerge that could lead to the development of innovative therapeutic strategies.
As the field of medicinal chemistry continues to evolve, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to expand. Scientists and researchers are continuously exploring its properties and interactions, which may lead to the discovery of new therapeutic applications. This compound represents a significant contribution to the field and holds promise for future advancements in medical treatments.
In summary, the continued investigation of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is essential for uncovering its potential in medicine. As researchers delve deeper into its properties and interactions, new possibilities may arise for the development of innovative therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in advancing medical science and improving patient outcomes.
The ongoing research into 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is crucial for understanding its potential applications in medicine. As scientists continue to explore its properties and interactions with biological systems, new insights may emerge that could lead to the development of effective treatments for various diseases. This compound represents a significant contribution to the field of medicinal chemistry and holds promise for future medical advancements.
With the continued progress in medicinal chemistry, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to grow. As researchers delve deeper into its properties and applications, new opportunities may arise for the development of novel therapeutic strategies. This compound exemplifies the importance of interdisciplinary research in the pursuit of innovative solutions to complex health challenges.
In conclusion, the study of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is a vital area of research in medicinal chemistry. Its potential applications in medicine, combined with its unique structural features, make it a promising candidate for further investigation. As research in this area continues to advance, new insights may emerge that could lead to the development of innovative therapeutic strategies.
As the field of medicinal chemistry continues to evolve, the potential of 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo[3,4-d]pyrimidine is likely to expand. Scientists and researchers are continuously exploring its properties and interactions, which may lead to the discovery of new therapeutic applications. This compound represents a significant contribution to the field and holds promise for future advancements in medical treatments.
In summary, the continued investigation of 4-Amino-1-tert-butyl-3-(2-hydroxypheny It looks like you're working on a detailed scientific text about the compound 4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazole. This compound appears to be a pyrazole derivative with functional groups such as an amino group, a tert-butyl group, and a hydroxyphenyl group. It might be of interest in pharmaceutical or medicinal chemistry due to the presence of heterocyclic rings, which are common in bioactive molecules. If you're looking for help with: 1. Structure and Properties – You can describe the molecular structure, functional groups, and potential physicochemical properties (e.g., solubility, melting point, etc.). 2. Synthesis – You might be seeking information on how to synthesize this compound, including reaction conditions, reagents, or catalysts. 3. Biological Activity – You could be exploring its potential pharmacological applications (e.g., anti-inflammatory, anti-cancer, or antioxidant activity). 4. Literature Review – You might want to know if this compound has been studied in scientific literature, or if similar compounds have been reported. 5. Applications – You could be interested in how this compound might be used in drug development, material science, or other fields. Would you like assistance with any of these aspects? Please let me know what you're specifically working on, and I can provide more targeted help.
1027572-46-8 (4-Amino-1-tert-butyl-3-(2-hydroxyphenyl)-1H-pyrazolo3,4-dpyrimidine) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)