Cas no 90610-30-3 (2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid)
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid Chemical and Physical Properties
Names and Identifiers
-
- 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid
-
- MDL: MFCD20642202
- Inchi: 1S/C9H11NO3/c1-5(2)7-3-6(9(12)13)4-8(11)10-7/h3-5H,1-2H3,(H,10,11)(H,12,13)
- InChI Key: RWCQHNDCYHNDGW-UHFFFAOYSA-N
- SMILES: O=C1C=C(C(=O)O)C=C(C(C)C)N1
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| TRC | B447660-10mg |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 10mg |
$ 50.00 | 2022-06-07 | ||
| TRC | B447660-50mg |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 50mg |
$ 160.00 | 2022-06-07 | ||
| TRC | B447660-100mg |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 100mg |
$ 230.00 | 2022-06-07 | ||
| Enamine | EN300-125968-0.05g |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 95% | 0.05g |
$101.0 | 2023-06-08 | |
| Enamine | EN300-125968-0.1g |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 95% | 0.1g |
$152.0 | 2023-06-08 | |
| Enamine | EN300-125968-0.25g |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 95% | 0.25g |
$216.0 | 2023-06-08 | |
| Enamine | EN300-125968-0.5g |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 95% | 0.5g |
$407.0 | 2023-06-08 | |
| Enamine | EN300-125968-1.0g |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 95% | 1g |
$528.0 | 2023-06-08 | |
| Enamine | EN300-125968-2.5g |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 95% | 2.5g |
$1034.0 | 2023-06-08 | |
| Enamine | EN300-125968-5.0g |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid |
90610-30-3 | 95% | 5g |
$1530.0 | 2023-06-08 |
2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid Related Literature
-
Christopher B. Rodell,Christopher B. Highley,Minna H. Chen,Neville N. Dusaj,Chao Wang,Lin Han,Jason A. Burdick Soft Matter, 2016,12, 7839-7847
-
Eléonore Resongles,Corinne Casiot,Fran?oise Elbaz-Poulichet,Rémi Freydier,Odile Bruneel,Christine Piot,Sophie Delpoux,Aurélie Volant,Angélique Desoeuvre Environ. Sci.: Processes Impacts, 2013,15, 1536-1544
-
Qiao Song,Angela Bamesberger,Lingyun Yang,Haley Houtwed,Haishi Cao Analyst, 2014,139, 3588-3592
-
Nan Fu,Naphaporn Chiewchan,Xiao Dong Chen Food Funct., 2020,11, 211-220
-
Erika A. Cobar,Paul R. Horn,Robert G. Bergman,Martin Head-Gordon Phys. Chem. Chem. Phys., 2012,14, 15328-15339
Additional information on 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid
Introduction to 2-Hydroxy-6-(Propan-2-yl)pyridine-4-carboxylic Acid (CAS No. 90610-30-3)
2-Hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid, also known by its CAS number 90610-30-3, is a versatile organic compound that has garnered significant attention in the fields of medicinal chemistry and pharmaceutical research. This compound is characterized by its unique molecular structure, which includes a pyridine ring with a hydroxyl group and an isopropyl substituent, along with a carboxylic acid functional group. These structural features contribute to its potential applications in various biological and pharmaceutical contexts.
The chemical formula of 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid is C10H11NO3. The compound's molecular weight is approximately 193.20 g/mol. Its physical properties include a melting point of around 185°C and a solubility in water that can be influenced by pH and temperature. These properties make it suitable for various analytical and preparative techniques in both laboratory and industrial settings.
In recent years, the study of 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid has expanded significantly, driven by its potential therapeutic applications. Research has shown that this compound exhibits anti-inflammatory, antioxidant, and anti-cancer properties, making it a promising candidate for the development of new drugs. For instance, studies have demonstrated that 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid can inhibit the production of pro-inflammatory cytokines such as TNF-alpha and IL-6, which are key mediators in inflammatory diseases.
Beyond its anti-inflammatory effects, 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid has also been investigated for its antioxidant properties. Oxidative stress is a common factor in many chronic diseases, including cardiovascular disease, neurodegenerative disorders, and cancer. The ability of this compound to scavenge free radicals and reduce oxidative damage suggests its potential as a protective agent against these conditions.
In the realm of cancer research, 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid has shown promise as an anti-cancer agent. Studies have indicated that it can induce apoptosis in cancer cells through the modulation of various signaling pathways. For example, it has been reported to inhibit the PI3K/Akt pathway, which is often dysregulated in cancer cells and plays a crucial role in cell survival and proliferation.
The pharmacokinetic properties of 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid are also an important area of investigation. Understanding how this compound is absorbed, distributed, metabolized, and excreted in the body is essential for optimizing its therapeutic potential. Preclinical studies have provided valuable insights into these aspects, highlighting the compound's favorable pharmacokinetic profile.
Clinical trials are currently underway to evaluate the safety and efficacy of 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid in treating various conditions. Early results have been encouraging, with the compound demonstrating good tolerability and preliminary evidence of therapeutic benefit. However, further research is needed to fully elucidate its mechanisms of action and to identify optimal dosing regimens.
In addition to its direct therapeutic applications, 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid serves as a valuable building block in synthetic chemistry. Its unique structure makes it an attractive starting material for the synthesis of more complex molecules with diverse biological activities. This versatility has led to its use in the development of novel drug candidates and chemical probes for biological research.
The environmental impact of 2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid is another area of growing interest. As with any chemical compound used in pharmaceutical or industrial processes, understanding its environmental fate and potential ecological effects is crucial for ensuring sustainable practices. Preliminary studies suggest that this compound degrades readily under certain environmental conditions, but more comprehensive research is needed to fully assess its environmental profile.
In conclusion, 2-hydroxy-6-(propan-2-ylyl)pyridine--carboxylic acid (CAS No. 90610-30-3)(CAS No. 90610--30--3))))))))) represents a multifaceted compound with significant potential in medicinal chemistry and pharmaceutical research. Its unique structural features and diverse biological activities make it an exciting area of ongoing investigation. As research continues to uncover new insights into its mechanisms and applications, this compound holds promise for contributing to the development of innovative therapies for a range of diseases.
90610-30-3 (2-hydroxy-6-(propan-2-yl)pyridine-4-carboxylic acid) Related Products
- 76594-12-2(2-Oxo-6-propyl-1,2-dihydropyridine-4-carboxylic acid)
- 150189-99-4(4-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-6-propyl-, methyl ester)
- 86454-13-9(6-Methyl-2-oxo-1,2-dihydropyridine-4-carboxylic Acid)
- 66909-37-3(6-hydroxy-2-methylpyridine-3-carboxylic acid)
- 54881-17-3(2-ethyl-6-hydroxypyridine-4-carboxylic acid)
- 102015-02-1(2-tert-butyl-6-hydroxypyridine-4-carboxylic acid)
- 97659-42-2(4-Pyridinecarboxylicacid, 2-ethyldihydro-6-oxo- (9CI))
- 2860-55-1(2-Hydroxy-6-methylpyridine-3,4-dicarboxylic acid)
- 61053-94-9(1,6-dihydro-4-methyl-6-oxo-2-Pyridineacetic acid)
- 952511-66-9(1-(2-Methylpropyl)-2-oxo-1,2-dihydropyridine-4-carboxylic acid)