Cas no 887591-61-9 (4-(5-amino-1,2-oxazol-3-yl)phenol)
4-(5-amino-1,2-oxazol-3-yl)phenol Chemical and Physical Properties
Names and Identifiers
-
- Phenol,4-(5-amino-3-isoxazolyl)-
- 4-(5-amino-1,2-oxazol-3-ylidene)cyclohexa-2,5-dien-1-one
- 4-(5-Amino-isoxazol-3-yl)-phenol
- 4-(5-amino-1,2-oxazol-3-yl)phenol
-
- Inchi: InChI=1S/C9H8N2O2/c10-9-5-8(11-13-9)6-1-3-7(12)4-2-6/h1-5,12H,10H2
- InChI Key: JYUSLHBNFRKVDD-UHFFFAOYSA-N
- SMILES: C1=C(C=CC(=C1)O)C2=NOC(=C2)N
Computed Properties
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 2
- Hydrogen Bond Acceptor Count: 2
- Heavy Atom Count: 13
- Rotatable Bond Count: 1
- Complexity: 357
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- Surface Charge: 0
- Tautomer Count: 11
- XLogP3: 0.8
4-(5-amino-1,2-oxazol-3-yl)phenol Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-1826586-0.05g |
4-(5-amino-1,2-oxazol-3-yl)phenol |
887591-61-9 | 95% | 0.05g |
$118.0 | 2023-09-19 | |
| Enamine | EN300-1826586-0.1g |
4-(5-amino-1,2-oxazol-3-yl)phenol |
887591-61-9 | 95% | 0.1g |
$176.0 | 2023-09-19 | |
| Enamine | EN300-1826586-0.25g |
4-(5-amino-1,2-oxazol-3-yl)phenol |
887591-61-9 | 95% | 0.25g |
$252.0 | 2023-09-19 | |
| Enamine | EN300-1826586-0.5g |
4-(5-amino-1,2-oxazol-3-yl)phenol |
887591-61-9 | 95% | 0.5g |
$457.0 | 2023-09-19 | |
| Enamine | EN300-1826586-1.0g |
4-(5-amino-1,2-oxazol-3-yl)phenol |
887591-61-9 | 95% | 1g |
$584.0 | 2023-06-02 | |
| Enamine | EN300-1826586-2.5g |
4-(5-amino-1,2-oxazol-3-yl)phenol |
887591-61-9 | 95% | 2.5g |
$1147.0 | 2023-09-19 | |
| Enamine | EN300-1826586-5.0g |
4-(5-amino-1,2-oxazol-3-yl)phenol |
887591-61-9 | 95% | 5g |
$1695.0 | 2023-06-02 | |
| Enamine | EN300-1826586-10.0g |
4-(5-amino-1,2-oxazol-3-yl)phenol |
887591-61-9 | 95% | 10g |
$2516.0 | 2023-06-02 | |
| Aaron | AR004C10-50mg |
Phenol,4-(5-amino-3-isoxazolyl)- |
887591-61-9 | 95% | 50mg |
$188.00 | 2025-02-13 | |
| Aaron | AR004C10-100mg |
Phenol,4-(5-amino-3-isoxazolyl)- |
887591-61-9 | 95% | 100mg |
$267.00 | 2025-02-13 |
4-(5-amino-1,2-oxazol-3-yl)phenol Related Literature
-
Eric Besson,Stéphane Gastaldi,Emily Bloch,Selma Aslan,Hakim Karoui,Olivier Ouari,Micael Hardy Analyst, 2019,144, 4194-4203
-
Long Deng,Qian Zou,Biao Liu,Wenhui Ye,Chengfei Zhuo,Li Chen,Ze-Yuan Deng,Ya-Wei Fan,Jing Li Food Funct., 2018,9, 4234-4245
-
M. Zeiger,N. J?ckel,P. Strubel,L. Borchardt,R. Reinhold,W. Nickel,J. Eckert,V. Presser,S. Kaskel J. Mater. Chem. A, 2015,3, 17983-17990
-
5. Estimating and correcting interference fringes in infrared spectra in infrared hyperspectral imagingGhazal Azarfar,Ebrahim Aboualizadeh,Nicholas M. Walter,Simona Ratti,Camilla Olivieri,Alessandra Norici,Michael Nasse,Achim Kohler,Mario Giordano Analyst, 2018,143, 4674-4683
Additional information on 4-(5-amino-1,2-oxazol-3-yl)phenol
Professional Introduction to 4-(5-amino-1,2-oxazol-3-yl)phenol (CAS No. 887591-61-9)
4-(5-amino-1,2-oxazol-3-yl)phenol, identified by its Chemical Abstracts Service (CAS) number 887591-61-9, is a significant compound in the realm of pharmaceutical chemistry and bioorganic synthesis. This heterocyclic aromatic compound has garnered attention due to its versatile structural framework and potential applications in medicinal chemistry. The presence of both an oxazole ring and an amino-substituted phenol moiety imparts unique chemical properties that make it a valuable scaffold for the development of novel therapeutic agents.
The oxazole core, a five-membered heterocycle containing one oxygen and one nitrogen atom, is known for its stability and ability to participate in various hydrogen bonding interactions. This feature is particularly advantageous in drug design, as it can enhance binding affinity to biological targets. The amino group on the phenol ring further extends the compound's functionality, allowing for further derivatization and modification to tailor its pharmacological properties.
In recent years, there has been a surge in research focusing on oxazole derivatives due to their demonstrated efficacy in modulating biological pathways associated with inflammation, infection, and cancer. The specific substitution pattern of 4-(5-amino-1,2-oxazol-3-yl)phenol positions it as a promising candidate for further investigation in these areas. Studies have begun to explore its potential as an intermediate in the synthesis of kinase inhibitors, which are critical in targeted cancer therapies.
One of the most compelling aspects of this compound is its ability to act as a dual inhibitor of certain enzymes implicated in metabolic disorders. The combination of the oxazole and phenolic groups creates a molecular environment conducive to selective binding, which is essential for achieving high therapeutic efficacy while minimizing off-target effects. Preliminary computational studies have suggested that this compound may exhibit inhibitory activity against enzymes such as Janus kinases (JAKs), which are overexpressed in various inflammatory conditions.
The pharmacokinetic profile of 4-(5-amino-1,2-oxazol-3-yl)phenol is another area of active investigation. Researchers are leveraging advanced spectroscopic techniques and molecular modeling to elucidate how the compound interacts with biological membranes and transporters. These insights are crucial for optimizing drug delivery systems and improving bioavailability. Additionally, the compound's stability under various pH conditions makes it a suitable candidate for formulation into oral or injectable medications.
In the context of drug discovery, the synthesis of analogs derived from 4-(5-amino-1,2-oxazol-3-yl)phenol represents a fertile ground for innovation. By systematically varying substituents on the oxazole or phenol rings, chemists can fine-tune the compound's physicochemical properties and biological activity. Such modifications have already led to several promising candidates that are entering preclinical testing phases.
The integration of machine learning and artificial intelligence into drug discovery workflows has accelerated the identification of novel compounds like 4-(5-amino-1,2-oxazol-3-yl)phenol. These technologies enable rapid screening of vast chemical libraries and prediction of potential drug candidates based on structural features alone. The insights gained from these computational approaches are being validated through experimental studies, underscoring the importance of interdisciplinary collaboration between chemists and bioinformaticians.
The environmental impact of pharmaceutical development is also being considered in the design of compounds like this one. Efforts are underway to optimize synthetic routes that minimize waste generation and reduce reliance on hazardous reagents. Green chemistry principles are being applied to ensure that future derivatives of 4-(5-amino-1,2-oxazol-3-yl)phenol can be produced sustainably without compromising efficacy.
In conclusion, 4-(5-amino-1,2-oxazol-3-yl)phenol (CAS No. 887591-61-9) exemplifies the innovative spirit driving modern pharmaceutical research. Its unique structural features and potential therapeutic applications position it as a cornerstone in the development of next-generation drugs. As research continues to uncover new ways to harness its capabilities, this compound is poised to make significant contributions to human health and well-being.
887591-61-9 (4-(5-amino-1,2-oxazol-3-yl)phenol) Related Products
- 28883-91-2(3-(p-tolyl)isoxazol-5-amine)
- 86685-97-4(3-M-Tolylisoxazol-5-amine)
- 4369-55-5(3-phenyl-1,2-oxazol-5-amine)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)