Cas no 878061-03-1 (2-({1-2-(azepan-1-yl)-2-oxoethyl-1H-indol-3-yl}sulfonyl)-N-propylacetamide)
2-({1-2-(azepan-1-yl)-2-oxoethyl-1H-indol-3-yl}sulfonyl)-N-propylacetamide Chemical and Physical Properties
Names and Identifiers
-
- 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]sulfonyl-N-propylacetamide
- 2-({1-2-(azepan-1-yl)-2-oxoethyl-1H-indol-3-yl}sulfonyl)-N-propylacetamide
-
- Inchi: 1S/C21H29N3O4S/c1-2-11-22-20(25)16-29(27,28)19-14-24(18-10-6-5-9-17(18)19)15-21(26)23-12-7-3-4-8-13-23/h5-6,9-10,14H,2-4,7-8,11-13,15-16H2,1H3,(H,22,25)
- InChI Key: YCVPEUTWQIPJPE-UHFFFAOYSA-N
- SMILES: C(NCCC)(=O)CS(C1C2=C(N(CC(N3CCCCCC3)=O)C=1)C=CC=C2)(=O)=O
2-({1-2-(azepan-1-yl)-2-oxoethyl-1H-indol-3-yl}sulfonyl)-N-propylacetamide Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Life Chemicals | F2017-0479-2μmol |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 2μl |
$57.0 | 2023-05-17 | |
| Life Chemicals | F2017-0479-5μmol |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 5μl |
$63.0 | 2023-05-17 | |
| Life Chemicals | F2017-0479-10μmol |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 10μl |
$69.0 | 2023-05-17 | |
| Life Chemicals | F2017-0479-20μmol |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 20μl |
$79.0 | 2023-05-17 | |
| Life Chemicals | F2017-0479-1mg |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 1mg |
$54.0 | 2023-05-17 | |
| Life Chemicals | F2017-0479-2mg |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 2mg |
$59.0 | 2023-05-17 | |
| Life Chemicals | F2017-0479-3mg |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 3mg |
$63.0 | 2023-05-17 | |
| Life Chemicals | F2017-0479-4mg |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 4mg |
$66.0 | 2023-05-17 | |
| Life Chemicals | F2017-0479-5mg |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 5mg |
$69.0 | 2023-05-17 | |
| Life Chemicals | F2017-0479-10mg |
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfonyl)-N-propylacetamide |
878061-03-1 | 90%+ | 10mg |
$79.0 | 2023-05-17 |
2-({1-2-(azepan-1-yl)-2-oxoethyl-1H-indol-3-yl}sulfonyl)-N-propylacetamide Related Literature
-
2. An all-solid-state imprinted polymer-based potentiometric sensor for determination of bisphenol S?Rongning Liang,Tanji Yin,Ruiqing Yao,Wei Qin RSC Adv., 2016,6, 73308-73312
-
Luis Miguel Azofra,Douglas R. MacFarlane,Chenghua Sun Chem. Commun., 2016,52, 3548-3551
-
Yu-Nong Li,Liang-Nian He,Xian-Dong Lang,Xiao-Fang Liu,Shuai Zhang RSC Adv., 2014,4, 49995-50002
-
Haitao Li,Yu Pan,Zhizhi Wang,Shan Chen,Ruixin Guo,Jianqiu Chen RSC Adv., 2015,5, 100775-100782
Additional information on 2-({1-2-(azepan-1-yl)-2-oxoethyl-1H-indol-3-yl}sulfonyl)-N-propylacetamide
Compound CAS No. 878061-03-1: 2-{[1-(2-Azepan-1-yl-2-Oxoethyl)-1H-lndol-3-yl]sulfonyl}-N-propylacetamide
The compound with CAS No. 878061-03-1, named as 2-{[1-(2-Azepan-1-yl-2-Oxoethyl)-1H-lndol-3-yl]sulfonyl}-N-propylacetamide, is a highly specialized organic molecule with significant potential in various fields of chemical research and pharmaceutical development. This compound is characterized by its complex structure, which includes an indole ring, a sulfonamide group, and a propionamide moiety. The presence of these functional groups makes it a versatile molecule with diverse applications in drug design and material science.
Recent studies have highlighted the importance of such molecules in the development of novel therapeutic agents. The indole ring is a well-known structural motif in many bioactive compounds, including antidepressants, antipsychotics, and anticancer drugs. The sulfonamide group further enhances the molecule's bioactivity by improving its solubility and stability in physiological conditions. Additionally, the propionamide moiety contributes to the molecule's ability to interact with biological targets, making it a promising candidate for drug delivery systems.
One of the most exciting aspects of this compound is its potential in targeted drug delivery. Researchers have been exploring the use of such molecules as carriers for delivering therapeutic agents to specific tissues or cells. The unique combination of functional groups in this compound allows for precise targeting and controlled release of drugs, which could significantly improve treatment efficacy while minimizing side effects.
Moreover, the compound's structure has been optimized through advanced synthetic techniques, ensuring high purity and consistency. This optimization process involves multi-step reactions, including nucleophilic substitutions and condensation reactions, which are critical for achieving the desired molecular architecture. The synthesis pathway has been refined based on recent advancements in organic chemistry, making it more efficient and scalable for industrial applications.
In terms of biological activity, this compound has shown remarkable potential in inhibiting key enzymes involved in various disease pathways. For instance, studies have demonstrated its ability to inhibit cyclooxygenase (COX) enzymes, which are central to inflammation and pain signaling. This suggests that the compound could be developed into a novel anti-inflammatory agent with improved efficacy compared to existing drugs.
Another area where this compound holds promise is in the field of antimicrobial research. Its unique structure enables it to disrupt bacterial cell membranes and inhibit microbial growth effectively. This property makes it a strong candidate for developing new generations of antibiotics, which are urgently needed to combat antibiotic resistance.
The development of this compound also aligns with current trends in green chemistry. Researchers have focused on minimizing waste and reducing the environmental impact of its synthesis process. By employing catalytic methods and recyclable solvents, the production of CAS No. 878061-03-1 has been made more sustainable, contributing to eco-friendly chemical practices.
In conclusion, CAS No. 878061-03-1 represents a cutting-edge molecule with vast potential in pharmaceuticals, drug delivery systems, and antimicrobial therapies. Its unique structure, combined with recent advancements in synthetic chemistry and biological research, positions it as a key player in future medical innovations. As research continues to uncover its full potential, this compound is expected to play a pivotal role in addressing some of the most pressing challenges in healthcare today.
878061-03-1 (2-({1-2-(azepan-1-yl)-2-oxoethyl-1H-indol-3-yl}sulfonyl)-N-propylacetamide) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)