Cas no 792853-77-1 (2-{1-(dimethylamino)methylcyclohexyl}acetic acid)
2-{1-(dimethylamino)methylcyclohexyl}acetic acid Chemical and Physical Properties
Names and Identifiers
-
- Cyclohexaneacetic acid, 1-[(dimethylamino)methyl]-
- 2-{1-(dimethylamino)methylcyclohexyl}acetic acid
-
- MDL: MFCD20643905
- Inchi: 1S/C11H21NO2/c1-12(2)9-11(8-10(13)14)6-4-3-5-7-11/h3-9H2,1-2H3,(H,13,14)
- InChI Key: KDOXQJNYSKYRKI-UHFFFAOYSA-N
- SMILES: C1(CN(C)C)(CC(O)=O)CCCCC1
2-{1-(dimethylamino)methylcyclohexyl}acetic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-8636928-0.05g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95.0% | 0.05g |
$56.0 | 2025-02-19 | |
| Enamine | EN300-8636928-0.1g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95.0% | 0.1g |
$86.0 | 2025-02-19 | |
| Enamine | EN300-8636928-0.25g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95.0% | 0.25g |
$121.0 | 2025-02-19 | |
| Enamine | EN300-8636928-0.5g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95.0% | 0.5g |
$229.0 | 2025-02-19 | |
| Enamine | EN300-8636928-1.0g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95.0% | 1.0g |
$328.0 | 2025-02-19 | |
| Enamine | EN300-8636928-2.5g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95.0% | 2.5g |
$642.0 | 2025-02-19 | |
| Enamine | EN300-8636928-5.0g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95.0% | 5.0g |
$949.0 | 2025-02-19 | |
| Enamine | EN300-8636928-10.0g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95.0% | 10.0g |
$1409.0 | 2025-02-19 | |
| Enamine | EN300-8636928-1g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95% | 1g |
$414.0 | 2023-09-02 | |
| Enamine | EN300-8636928-5g |
2-{1-[(dimethylamino)methyl]cyclohexyl}acetic acid |
792853-77-1 | 95% | 5g |
$1199.0 | 2023-09-02 |
2-{1-(dimethylamino)methylcyclohexyl}acetic acid Related Literature
-
Jialiang Yuan,Ran Dong,Yuan Li,Yang Liu,Zhuo Zheng,Yuxia Liu,Yan Sun,Benhe Zhong,Zhenguo Wu,Xiaodong Guo Chem. Commun., 2021,57, 13004-13007
-
Siquan Zhang,Shengyao Wang,Liping Guo,Hao Chen,Bien Tan,Shangbin Jin J. Mater. Chem. C, 2020,8, 192-200
Additional information on 2-{1-(dimethylamino)methylcyclohexyl}acetic acid
Introduction to 2-{1-(dimethylamino)methylcyclohexyl}acetic Acid (CAS No: 792853-77-1)
The compound 2-{1-(dimethylamino)methylcyclohexyl}acetic acid, identified by the CAS registry number 792853-77-1, is a significant molecule in the field of organic chemistry and pharmaceutical research. This compound has garnered attention due to its unique structural properties and potential applications in drug development and material science.
Recent studies have highlighted the importance of dimethylamino-containing cyclohexane derivatives in various biological systems. The presence of the dimethylamino group imparts unique electronic and steric properties to the molecule, making it a promising candidate for bioactive compounds. Researchers have explored its role in modulating enzyme activity and its potential as a lead compound in medicinal chemistry.
The synthesis of 2-{1-(dimethylamino)methylcyclohexyl}acetic acid involves a multi-step process, often utilizing advanced catalytic techniques and stereo-selective reactions. These methods ensure high purity and optimal yields, which are critical for its application in preclinical studies.
In terms of pharmacological applications, this compound has shown promise in targeting specific receptors and pathways associated with chronic diseases such as cancer and neurodegenerative disorders. Preclinical data suggest that it may possess anti-inflammatory and antioxidant properties, further underscoring its therapeutic potential.
The structural versatility of CAS No: 792853-77-1 allows for extensive modifications, enabling researchers to explore a wide range of analogs with varying bioactivities. This flexibility is a key factor in its ongoing investigation as a potential drug candidate.
Moreover, recent advancements in computational chemistry have facilitated the modeling of this compound's interactions with biological targets. These studies provide valuable insights into its mechanism of action and guide further optimization efforts.
In conclusion, 2-{1-(dimethylamino)methylcyclohexyl}acetic acid represents a compelling area of research with significant implications for future therapeutic developments. Its unique chemical properties, combined with cutting-edge research methodologies, position it as a vital molecule in the ongoing quest for innovative medical solutions.
792853-77-1 (2-{1-(dimethylamino)methylcyclohexyl}acetic acid) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)