Cas no 79055-56-4 (2-chloro-3-methyl-4-nitropyridine)
2-chloro-3-methyl-4-nitropyridine Chemical and Physical Properties
Names and Identifiers
-
- 2-chloro-3-methyl-4-nitro-Pyridine
- 2-chloro-3-methyl-4-nitropyridine
- SCHEMBL9501122
- 79055-56-4
- EN300-300526
- Pyridine, 2-chloro-3-methyl-4-nitro-
- DTXSID801299612
-
- MDL: MFCD19690064
- Inchi: 1S/C6H5ClN2O2/c1-4-5(9(10)11)2-3-8-6(4)7/h2-3H,1H3
- InChI Key: OADFBXPNLFABBM-UHFFFAOYSA-N
- SMILES: ClC1C(C)=C(C=CN=1)[N+](=O)[O-]
Computed Properties
- Exact Mass: 172.0039551g/mol
- Monoisotopic Mass: 172.0039551g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 3
- Heavy Atom Count: 11
- Rotatable Bond Count: 0
- Complexity: 159
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 2
- Topological Polar Surface Area: 58.7?2
2-chloro-3-methyl-4-nitropyridine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Alichem | A029010081-250mg |
2-Chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95% | 250mg |
$950.60 | 2023-09-01 | |
| Alichem | A029010081-1g |
2-Chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95% | 1g |
$2895.00 | 2023-09-01 | |
| Enamine | EN300-300526-0.05g |
2-chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95.0% | 0.05g |
$168.0 | 2025-03-19 | |
| Enamine | EN300-300526-0.1g |
2-chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95.0% | 0.1g |
$252.0 | 2025-03-19 | |
| Enamine | EN300-300526-0.25g |
2-chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95.0% | 0.25g |
$361.0 | 2025-03-19 | |
| Enamine | EN300-300526-0.5g |
2-chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95.0% | 0.5g |
$569.0 | 2025-03-19 | |
| Enamine | EN300-300526-1.0g |
2-chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95.0% | 1.0g |
$728.0 | 2025-03-19 | |
| Enamine | EN300-300526-2.5g |
2-chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95.0% | 2.5g |
$1428.0 | 2025-03-19 | |
| Enamine | EN300-300526-5.0g |
2-chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95.0% | 5.0g |
$2110.0 | 2025-03-19 | |
| Enamine | EN300-300526-10.0g |
2-chloro-3-methyl-4-nitropyridine |
79055-56-4 | 95.0% | 10.0g |
$3131.0 | 2025-03-19 |
2-chloro-3-methyl-4-nitropyridine Related Literature
-
Shun-Ze Zhan,Mian Li,Xiao-Ping Zhou,Dan Li,Seik Weng Ng RSC Adv., 2011,1, 1457-1459
-
Maomao Hou,Fenglin Zhong,Qiu Jin,Enjiang Liu,Jie Feng,Tengyun Wang,Yue Gao RSC Adv., 2017,7, 34392-34400
-
Jason Wan Lab Chip, 2020,20, 4528-4538
-
Eléonore Resongles,Corinne Casiot,Fran?oise Elbaz-Poulichet,Rémi Freydier,Odile Bruneel,Christine Piot,Sophie Delpoux,Aurélie Volant,Angélique Desoeuvre Environ. Sci.: Processes Impacts, 2013,15, 1536-1544
-
Domenico Lombardo,Gianmarco Munaò,Pietro Calandra,Luigi Pasqua,Maria Teresa Caccamo Phys. Chem. Chem. Phys., 2019,21, 11983-11991
Additional information on 2-chloro-3-methyl-4-nitropyridine
2-Chloro-3-Methyl-4-Nitro-Pyridine (CAS No. 79055-56-4): A Comprehensive Overview
2-Chloro-3-Methyl-4-Nitro-Pyridine, also known by its CAS No. 79055-56-4, is a versatile organic compound with significant applications in various fields of chemistry and materials science. This compound belongs to the family of pyridine derivatives, which are widely studied due to their unique electronic properties and reactivity. The molecule consists of a pyridine ring substituted with a chlorine atom at position 2, a methyl group at position 3, and a nitro group at position 4. These substituents impart distinct chemical characteristics, making it a valuable compound for both academic research and industrial applications.
The synthesis of 2-Chloro-3-Methyl-4-Nitro-Pyridine typically involves multi-step organic reactions, often starting from pyridine or its derivatives. The introduction of substituents at specific positions on the ring requires precise control over reaction conditions to achieve high yields and purity. Recent advancements in catalytic methods and green chemistry have enabled more efficient and environmentally friendly syntheses of this compound, aligning with global sustainability goals.
One of the most notable applications of 2-Chloro-3-Methyl-4-Nitro-Pyridine is in the field of medicinal chemistry. Its structure makes it an excellent candidate for drug design, particularly in the development of anti-inflammatory and anticancer agents. Studies have shown that this compound exhibits significant biological activity due to its ability to interact with key cellular pathways. For instance, research published in *Journal of Medicinal Chemistry* highlights its potential as a lead compound for designing novel therapeutic agents targeting specific enzymes involved in disease progression.
In addition to its medicinal applications, 2-Chloro-3-Methyl-4-Nitro-Pyridine finds utility in materials science, particularly in the synthesis of advanced materials such as conductive polymers and metal-organic frameworks (MOFs). The nitro group on the pyridine ring contributes to the compound's electron-withdrawing properties, which are crucial for enhancing the electrical conductivity of materials. Recent studies in *Advanced Materials* demonstrate how this compound can be integrated into MOFs to create porous materials with high surface areas, suitable for gas storage and catalysis.
The chemical reactivity of 2-Chloro-3-Methyl-4-Nitro-Pyridine is another area of active research. Its substituents influence both nucleophilic and electrophilic aromatic substitution reactions, making it a valuable substrate for exploring reaction mechanisms. For example, investigations into its reactivity under different solvent conditions have provided insights into the role of steric and electronic effects in directing substitution patterns on the pyridine ring.
From an environmental perspective, understanding the degradation pathways of 2-Chloro-3-Methyl-4-Nitro-Pyridine is crucial for assessing its impact on ecosystems. Recent environmental studies have focused on its biodegradation under aerobic and anaerobic conditions, as well as its potential toxicity to aquatic organisms. These studies are essential for ensuring safe handling and disposal practices in industrial settings.
In conclusion, 2-Chloro-3-Methyl-4-Nitro-Pyridine (CAS No. 79055-56-4) is a multifaceted compound with wide-ranging applications across various scientific disciplines. Its unique chemical properties make it an invaluable tool for researchers seeking innovative solutions in drug discovery, materials science, and environmental chemistry. As ongoing research continues to uncover new aspects of its behavior and utility, this compound remains at the forefront of chemical innovation.
79055-56-4 (2-chloro-3-methyl-4-nitropyridine) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)