Cas no 650140-84-4 (3,5-Dibromo-4-methoxypyridine 1-oxide)
3,5-Dibromo-4-methoxypyridine 1-oxide Chemical and Physical Properties
Names and Identifiers
-
- 3,5-Dibromo-4-methoxypyridine 1-oxide
- 3,5-dibromo-4-methoxy-1-oxidopyridin-1-ium
- 3,5-dibromo-4-methoxypyridine-n-oxide
- C6H5Br2NO2
-
- MDL: MFCD02756035
- Inchi: 1S/C6H5Br2NO2/c1-11-6-4(7)2-9(10)3-5(6)8/h2-3H,1H3
- InChI Key: KAYQEYHOGFRTAL-UHFFFAOYSA-N
- SMILES: BrC1C=[N+](C=C(C=1OC)Br)[O-]
Computed Properties
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 1
- Heavy Atom Count: 11
- Rotatable Bond Count: 1
3,5-Dibromo-4-methoxypyridine 1-oxide Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| SHANG HAI MAI KE LIN SHENG HUA Technology Co., Ltd. | D857636-1g |
3,5-Dibromo-4-methoxypyridine |
650140-84-4 | ≥98% | 1g |
¥401.40 | 2022-01-10 | |
| eNovation Chemicals LLC | D240885-100mg |
3,5-Dibromo-4-methoxypyridine 1-oxide |
650140-84-4 | 97% | 100mg |
$120 | 2024-05-23 | |
| eNovation Chemicals LLC | D240885-250mg |
3,5-Dibromo-4-methoxypyridine 1-oxide |
650140-84-4 | 97% | 250mg |
$130 | 2024-05-23 | |
| eNovation Chemicals LLC | D240885-5g |
3,5-Dibromo-4-methoxypyridine 1-oxide |
650140-84-4 | 97% | 5g |
$160 | 2024-05-23 | |
| Aaron | AR00EDKX-5g |
3,5-Dibromo-4-Methoxypyridine-N-Oxide |
650140-84-4 | 98% | 5g |
$127.00 | 2025-02-10 | |
| A2B Chem LLC | AG69685-100mg |
3,5-Dibromo-4-methoxypyridine-n-oxide |
650140-84-4 | 98% | 100mg |
$4.00 | 2024-04-19 | |
| A2B Chem LLC | AG69685-250mg |
3,5-Dibromo-4-methoxypyridine-n-oxide |
650140-84-4 | 98% | 250mg |
$6.00 | 2024-04-19 | |
| A2B Chem LLC | AG69685-1g |
3,5-Dibromo-4-methoxypyridine-n-oxide |
650140-84-4 | 98% | 1g |
$7.00 | 2024-04-19 | |
| A2B Chem LLC | AG69685-5g |
3,5-Dibromo-4-methoxypyridine-n-oxide |
650140-84-4 | 98% | 5g |
$26.00 | 2024-04-19 | |
| SHANG HAI HAO HONG Biomedical Technology Co., Ltd. | 1088987-1g |
3,5-Dibromo-4-methoxypyridine 1-oxide |
650140-84-4 | 98% | 1g |
¥42.00 | 2024-05-05 |
3,5-Dibromo-4-methoxypyridine 1-oxide Related Literature
-
Zhiyan Chen,Nan Wu,Yaobing Wang,Bing Wang,Yingde Wang J. Mater. Chem. A, 2018,6, 516-526
-
Vishwesh Venkatraman,Marco Foscato,Vidar R. Jensen,Bj?rn K?re Alsberg J. Mater. Chem. A, 2015,3, 9851-9860
-
Shintaro Takata,Yoshihiro Miura Phys. Chem. Chem. Phys., 2014,16, 24784-24789
-
Jacob S. Jordan,Evan R. Williams Analyst, 2021,146, 2617-2625
-
Eric Besson,Stéphane Gastaldi,Emily Bloch,Selma Aslan,Hakim Karoui,Olivier Ouari,Micael Hardy Analyst, 2019,144, 4194-4203
Additional information on 3,5-Dibromo-4-methoxypyridine 1-oxide
3,5-Dibromo-4-methoxypyridine 1-oxide (CAS No. 650140-84-4): An Overview of Its Properties, Synthesis, and Applications
3,5-Dibromo-4-methoxypyridine 1-oxide (CAS No. 650140-84-4) is a versatile compound that has garnered significant attention in the fields of organic chemistry and pharmaceutical research. This compound is characterized by its unique structure, which includes a pyridine ring substituted with bromine atoms at the 3 and 5 positions and a methoxy group at the 4 position, along with an oxide functional group. The combination of these substituents imparts distinct chemical properties that make it a valuable intermediate in various synthetic pathways and potential applications in drug discovery.
The synthesis of 3,5-dibromo-4-methoxypyridine 1-oxide typically involves a multi-step process. One common approach is to start with 4-methoxypyridine, which undergoes bromination at the 3 and 5 positions to form 3,5-dibromo-4-methoxypyridine. Subsequently, oxidation of the pyridine ring using an appropriate oxidizing agent, such as meta-chloroperoxybenzoic acid (mCPBA), yields the desired product. This synthetic route has been well-documented in the literature and is known for its high yield and selectivity.
The physical and chemical properties of 3,5-dibromo-4-methoxypyridine 1-oxide are crucial for understanding its behavior in various chemical reactions and applications. It is a solid at room temperature with a melting point of approximately 160°C. The compound is soluble in common organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), making it suitable for use in solution-phase reactions. Its stability under various conditions has been extensively studied, and it has been found to be relatively stable under standard laboratory conditions.
In terms of reactivity, 3,5-dibromo-4-methoxypyridine 1-oxide exhibits several notable features. The presence of the bromine atoms makes it an excellent substrate for cross-coupling reactions, such as Suzuki-Miyaura coupling and Stille coupling. These reactions are widely used in the synthesis of complex organic molecules and are particularly useful in the development of new pharmaceuticals. The methoxy group on the pyridine ring can also be readily functionalized through various chemical transformations, further expanding its utility as a synthetic intermediate.
Recent research has highlighted the potential applications of 3,5-dibromo-4-methoxypyridine 1-oxide in drug discovery and development. For instance, studies have shown that derivatives of this compound exhibit promising biological activities, including anti-inflammatory and anti-cancer properties. One notable example is the use of 3,5-dibromo-4-methoxypyridine 1-oxide as a starting material for the synthesis of pyridinyl derivatives that target specific enzymes involved in cancer progression. These derivatives have shown significant efficacy in preclinical studies, suggesting their potential as lead compounds for further development.
The environmental impact of 3,5-dibromo-4-methoxypyridine 1-oxide is another important consideration. While it is not classified as a hazardous substance under current regulations, proper handling and disposal procedures should be followed to minimize any potential environmental risks. Researchers are also exploring more sustainable synthetic methods to reduce the environmental footprint associated with its production.
In conclusion, 3,5-dibromo-4-methoxypyridine 1-oxide (CAS No. 650140-84-4) is a multifaceted compound with a wide range of applications in organic chemistry and pharmaceutical research. Its unique structure and reactivity make it an attractive intermediate for various synthetic pathways, while its biological activities hold promise for future drug discovery efforts. As research continues to advance, it is likely that new applications and insights into this compound will emerge, further solidifying its importance in the scientific community.
650140-84-4 (3,5-Dibromo-4-methoxypyridine 1-oxide) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)