Cas no 643726-07-2 (N-Methyl-1-(4-phenylthiazol-2-yl)methanamine)
N-Methyl-1-(4-phenylthiazol-2-yl)methanamine Chemical and Physical Properties
Names and Identifiers
-
- N-Methyl-1-(4-phenylthiazol-2-yl)methanamine
- METHYL-(4-PHENYL-THIAZOL-2-YLMETHYL)-AMINE
- N-methyl(4-phenylthiazol-2-yl)methanamine
- N-methyl-1-(4-phenyl-1,3-thiazol-2-yl)methanamine
-
- Inchi: InChI=1S/C11H12N2S/c1-12-7-11-13-10(8-14-11)9-5-3-2-4-6-9/h2-6,8,12H,7H2,1H3
- InChI Key: IWMGARGHDMDXOO-UHFFFAOYSA-N
- SMILES: CNCC1=NC(=CS1)C2=CC=CC=C2
Computed Properties
- Hydrogen Bond Donor Count: 1
- Hydrogen Bond Acceptor Count: 2
- Heavy Atom Count: 14
- Rotatable Bond Count: 3
N-Methyl-1-(4-phenylthiazol-2-yl)methanamine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Alichem | A059006291-1g |
N-Methyl-1-(4-phenylthiazol-2-yl)methanamine |
643726-07-2 | 95% | 1g |
$305.28 | 2023-09-01 | |
| Chemenu | CM123400-1g |
N-methyl-1-(4-phenylthiazol-2-yl)methanamine |
643726-07-2 | 95% | 1g |
$333 | 2021-08-05 | |
| Chemenu | CM123400-1g |
N-methyl-1-(4-phenylthiazol-2-yl)methanamine |
643726-07-2 | 95% | 1g |
$*** | 2023-05-30 | |
| Enamine | EN300-5282429-0.05g |
methyl[(4-phenyl-1,3-thiazol-2-yl)methyl]amine |
643726-07-2 | 0.05g |
$323.0 | 2023-05-24 | ||
| Enamine | EN300-5282429-0.1g |
methyl[(4-phenyl-1,3-thiazol-2-yl)methyl]amine |
643726-07-2 | 0.1g |
$339.0 | 2023-05-24 | ||
| Enamine | EN300-5282429-0.25g |
methyl[(4-phenyl-1,3-thiazol-2-yl)methyl]amine |
643726-07-2 | 0.25g |
$354.0 | 2023-05-24 | ||
| Enamine | EN300-5282429-0.5g |
methyl[(4-phenyl-1,3-thiazol-2-yl)methyl]amine |
643726-07-2 | 0.5g |
$370.0 | 2023-05-24 | ||
| Enamine | EN300-5282429-1.0g |
methyl[(4-phenyl-1,3-thiazol-2-yl)methyl]amine |
643726-07-2 | 1g |
$385.0 | 2023-05-24 | ||
| Enamine | EN300-5282429-2.5g |
methyl[(4-phenyl-1,3-thiazol-2-yl)methyl]amine |
643726-07-2 | 2.5g |
$754.0 | 2023-05-24 | ||
| Enamine | EN300-5282429-5.0g |
methyl[(4-phenyl-1,3-thiazol-2-yl)methyl]amine |
643726-07-2 | 5g |
$1115.0 | 2023-05-24 |
N-Methyl-1-(4-phenylthiazol-2-yl)methanamine Related Literature
-
Huabin Zhang,Shaowu Du CrystEngComm, 2014,16, 4059-4068
-
Govind Reddy Mol. Syst. Des. Eng., 2021,6, 779-789
-
Alvin Tanudjaja,Shinsuke Inagi,Fusao Kitamura,Toshikazu Takata,Ikuyoshi Tomita Dalton Trans., 2021,50, 3037-3043
-
Marta Liras,Isabel Quijada-Garrido,Marta Palacios-Cuesta,Sonia Mu?oz-Durieux,Olga García Polym. Chem., 2014,5, 433-442
-
Huiying Xu,Lu Zheng,Yu Zhou,Bang-Ce Ye Analyst, 2021,146, 5542-5549
Additional information on N-Methyl-1-(4-phenylthiazol-2-yl)methanamine
N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine (CAS No. 643726-07-2): An Overview of Its Structure, Properties, and Applications
N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine (CAS No. 643726-07-2) is a synthetic organic compound that has garnered significant attention in recent years due to its unique chemical structure and potential applications in various fields, particularly in medicinal chemistry and pharmaceutical research. This compound belongs to the class of thiazoles, which are known for their diverse biological activities and therapeutic potential.
The molecular formula of N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine is C13H15NS, and its molecular weight is approximately 229.33 g/mol. The compound features a thiazole ring substituted with a phenyl group and a methylated amine moiety, which contributes to its distinct chemical properties and reactivity. The thiazole ring, a five-membered heterocyclic structure containing sulfur and nitrogen atoms, is a common scaffold in many biologically active molecules.
Recent studies have highlighted the importance of thiazole derivatives in the development of new drugs for various diseases. For instance, thiazoles have been shown to exhibit potent anti-inflammatory, antimicrobial, and anticancer activities. The presence of the phenyl group in N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine further enhances its biological activity by increasing its lipophilicity and improving its ability to cross cell membranes.
In terms of physical properties, N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine is typically a white crystalline solid at room temperature. It is soluble in common organic solvents such as methanol, ethanol, and dimethyl sulfoxide (DMSO), but has limited solubility in water. This solubility profile makes it suitable for use in various chemical reactions and biological assays.
The synthesis of N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine can be achieved through several routes, including the reaction of 4-phenylthiazol-2-carbaldehyde with methylamine followed by reduction. The choice of synthetic method depends on factors such as yield, purity, and cost-effectiveness. Recent advancements in synthetic chemistry have led to the development of more efficient and environmentally friendly methods for the preparation of this compound.
In the context of medicinal chemistry, N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine has been investigated for its potential as a lead compound in drug discovery programs. Studies have shown that it exhibits selective binding to specific protein targets involved in various disease pathways. For example, it has been reported to inhibit the activity of certain kinases, which are key enzymes implicated in cancer progression and inflammatory diseases.
The pharmacological profile of N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine has also been explored in preclinical studies. In vitro assays have demonstrated its ability to modulate cellular signaling pathways and induce apoptosis in cancer cells. Additionally, animal models have been used to evaluate its efficacy and safety profile. These studies have provided valuable insights into the potential therapeutic applications of this compound.
Beyond its medicinal applications, N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine has also found use in other areas such as materials science and analytical chemistry. Its unique chemical properties make it a valuable reagent for the synthesis of more complex molecules and materials with specific functionalities.
In conclusion, N-Methyl-1-(4-Phenylthiazol-2-yl)methanamine (CAS No. 643726-07-2) is a versatile compound with a wide range of potential applications. Its unique chemical structure and biological activity make it an attractive candidate for further research and development in various scientific fields. As ongoing studies continue to uncover new properties and applications, this compound is likely to play an increasingly important role in advancing our understanding of complex biological systems and developing new therapeutic strategies.
643726-07-2 (N-Methyl-1-(4-phenylthiazol-2-yl)methanamine) Related Products
- 91818-69-8(4-Phenyl-thiazol-2-yl-methylamine Hydrochloride)
- 90916-45-3((4-phenyl-1,3-thiazol-2-yl)methanamine)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)