Cas no 460748-43-0 (trans-2-(4-fluorophenyl)vinylboronic acid)
trans-2-(4-fluorophenyl)vinylboronic acid Chemical and Physical Properties
Names and Identifiers
-
- BORONIC ACID, [(1E)-2-(4-FLUOROPHENYL)ETHENYL]-
- (E)-2-(4-fluorophenyl)vinylboronic acid
- (E)-(4-Fluorostyryl)boronic acid
- trans-2-(4-fluorophenyl)vinylboronic acid
- Trans-2-(4-fluorophenyl)vinylboronicacid
- AKOS015894006
- trans-(4-fluorophenyl)vinyl boronic acid
- MFCD02093725
- DS-2124
- 214907-24-1
- 4-Fluorostyrylboronic Acid
- trans-2-(4-Fluorophenyl)vinylboronic acid, 95%
- trans-2(-4-Fluoro-phenyl)-vinyl boronic acid
- [(1E)-2-(4-fluorophenyl)ethenyl]boronic acid
- W18836
- (E)-4-fluorostyrylboronic acid
- trans-2-(4-fluorophenyl)vinyl boronic acid
- (4-Fluorostyryl)boronic acid
- CS-W006222
- CHEMBL2315706
- EN300-7383743
- [(E)-2-(4-fluorophenyl)vinyl]boronic acid
- (E)-(4-Fluorostyryl)boronicacid
- [(E)-2-(4-fluorophenyl)ethenyl]boronic acid
- SCHEMBL386500
- 460748-43-0
-
- MDL: MFCD02093725
- Inchi: 1S/C8H8BFO2/c10-8-3-1-7(2-4-8)5-6-9(11)12/h1-6,11-12H/b6-5+
- InChI Key: GBNJRIQSFJFDII-AATRIKPKSA-N
- SMILES: B(/C=C/C1=CC=C(F)C=C1)(O)O
Computed Properties
- Exact Mass: 166.0601378Da
- Monoisotopic Mass: 166.0601378Da
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 2
- Hydrogen Bond Acceptor Count: 2
- Heavy Atom Count: 12
- Rotatable Bond Count: 2
- Complexity: 153
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 1
- Undefined Bond Stereocenter Count: 0
- Topological Polar Surface Area: 40.5?2
trans-2-(4-fluorophenyl)vinylboronic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBEB0655-1 G |
trans-2-(4-fluorophenyl)vinylboronic acid |
460748-43-0 | 95% | 1g |
¥ 778.00 | 2021-05-07 | |
| Chemenu | CM214459-1g |
(E)-(4-Fluorostyryl)boronic acid |
460748-43-0 | 97% | 1g |
$116 | 2022-11-27 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBEB0655-1G |
trans-2-(4-fluorophenyl)vinylboronic acid |
460748-43-0 | 95% | 1g |
¥ 778.00 | 2023-04-13 | |
| eNovation Chemicals LLC | D637423-1g |
Trans-2-(4-fluorophenyl)vinylboronicacid |
460748-43-0 | 95% | 1g |
$495 | 2025-02-28 | |
| eNovation Chemicals LLC | D637423-5g |
Trans-2-(4-fluorophenyl)vinylboronicacid |
460748-43-0 | 95% | 5g |
$695 | 2025-02-28 | |
| AstaTech | W18836-0.25/G |
(E)-(4-FLUOROSTYRYL)BORONIC ACID |
460748-43-0 | 95% | 0.25g |
$95 | 2023-09-19 | |
| AstaTech | W18836-1/G |
(E)-(4-FLUOROSTYRYL)BORONIC ACID |
460748-43-0 | 95% | 1g |
$250 | 2023-09-19 | |
| AstaTech | W18836-5/G |
(E)-(4-FLUOROSTYRYL)BORONIC ACID |
460748-43-0 | 95% | 5g |
$750 | 2023-09-19 | |
| Enamine | EN300-7383743-0.1g |
[(E)-2-(4-fluorophenyl)ethenyl]boronic acid |
460748-43-0 | 0.1g |
$39.0 | 2023-07-06 | ||
| Enamine | EN300-7383743-0.25g |
[(E)-2-(4-fluorophenyl)ethenyl]boronic acid |
460748-43-0 | 0.25g |
$55.0 | 2023-07-06 |
trans-2-(4-fluorophenyl)vinylboronic acid Related Literature
-
Ross Harder,David C. Dunand,Ian McNulty Nanoscale, 2017,9, 5686-5693
-
Norihito Fukui,Keisuke Fujimoto,Hideki Yorimitsu,Atsuhiro Osuka Dalton Trans., 2017,46, 13322-13341
-
Gerald J. Meyer,Leif Hammarstr?m Chem. Sci., 2020,11, 3460-3473
-
Max Attwood,Hiroki Akutsu,Lee Martin,Toby J. Blundell,Pierre Le Maguere,Scott S. Turner Dalton Trans., 2021,50, 11843-11851
Additional information on trans-2-(4-fluorophenyl)vinylboronic acid
Introduction to trans-2-(4-fluorophenyl)vinylboronic acid (CAS No. 460748-43-0)
trans-2-(4-fluorophenyl)vinylboronic acid, with the chemical identifier CAS No. 460748-43-0, is a specialized organoboron compound that has garnered significant attention in the field of synthetic chemistry and pharmaceutical research. This compound belongs to the class of boronic acids, which are widely recognized for their utility in various chemical transformations, particularly in cross-coupling reactions such as the Suzuki-Miyaura coupling. The presence of a 4-fluorophenyl substituent introduces unique electronic properties, making this compound a valuable tool in the development of advanced materials and pharmaceuticals.
The structure of trans-2-(4-fluorophenyl)vinylboronic acid consists of a vinyl group attached to a boronic acid moiety, with the 4-fluorophenyl group providing additional functionality. This arrangement allows for versatile interactions with other organic molecules, enabling its use in a broad spectrum of applications. Boronic acids, in general, are known for their stability and reactivity, which makes them indispensable in modern synthetic protocols.
In recent years, there has been a surge in research focused on the development of novel boronic acid derivatives for their potential applications in drug discovery and material science. The 4-fluorophenyl group in trans-2-(4-fluorophenyl)vinylboronic acid specifically enhances its utility due to the fluorine atom's ability to influence electronic properties and metabolic stability. This has led to its exploration as a key intermediate in the synthesis of biologically active compounds.
One of the most notable applications of trans-2-(4-fluorophenyl)vinylboronic acid is in the field of pharmaceuticals, where it serves as a precursor for the synthesis of complex molecules. The Suzuki-Miyaura coupling reaction, facilitated by this compound, is particularly useful in constructing carbon-carbon bonds, which are essential in many drug molecules. The fluorine substituent also contributes to improved pharmacokinetic properties, such as increased bioavailability and reduced metabolic degradation.
The use of trans-2-(4-fluorophenyl)vinylboronic acid has been extensively studied in the context of anticancer agents. Researchers have leveraged its reactivity to develop novel compounds that exhibit potent anticancer activity. For instance, studies have shown that derivatives of this compound can inhibit the growth of various cancer cell lines by targeting specific molecular pathways involved in tumor progression. The ability to fine-tune the structure through modifications such as changing the substituents on the 4-fluorophenyl group allows for the development of highly specific and effective therapeutic agents.
In addition to its pharmaceutical applications, trans-2-(4-fluorophenyl)vinylboronic acid has found utility in materials science. The unique electronic properties imparted by the 4-fluorophenyl group make this compound suitable for use in organic electronics and optoelectronic devices. Researchers have explored its potential as a building block for organic semiconductors and light-emitting diodes (OLEDs). The boronic acid moiety also facilitates cross-coupling reactions that are crucial for constructing complex molecular architectures required in advanced materials.
The synthesis of trans-2-(4-fluorophenyl)vinylboronic acid is another area of active research. While several synthetic routes have been reported, recent advancements have focused on developing more efficient and environmentally friendly methods. These include catalytic processes that minimize waste and improve yield, aligning with the growing emphasis on green chemistry principles. The development of such methodologies not only enhances the accessibility of this compound but also contributes to sustainable chemical practices.
The role of computational chemistry in understanding the reactivity and properties of trans-2-(4-fluorophenyl)vinylboronic acid cannot be overstated. Molecular modeling techniques have provided valuable insights into how different substituents affect its behavior in various reactions. This computational approach complements experimental work by allowing researchers to predict outcomes before conducting costly laboratory trials. Such integrative strategies are increasingly important in modern drug discovery and material science.
In conclusion,
460748-43-0 (trans-2-(4-fluorophenyl)vinylboronic acid) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)