Cas no 36776-44-0 (Phenol,3-methyl-5-(phenylmethoxy)-)
Phenol,3-methyl-5-(phenylmethoxy)- Chemical and Physical Properties
Names and Identifiers
-
- Phenol,3-methyl-5-(phenylmethoxy)-
- 3-(Benzyloxy)-5-methylphenol
- 2-benzyl-5-methylbenzene-1,3-diol
- Monobenzyl Orcinol
-
- Inchi: 1S/C14H14O2/c1-11-7-13(15)9-14(8-11)16-10-12-5-3-2-4-6-12/h2-9,15H,10H2,1H3
- InChI Key: HQOPQGDDTOUNDP-UHFFFAOYSA-N
- SMILES: C1(O)=CC(OCC2=CC=CC=C2)=CC(C)=C1
Computed Properties
- Exact Mass: 214.09942
Experimental Properties
- PSA: 29.46
Phenol,3-methyl-5-(phenylmethoxy)- Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Chemenu | CM344791-1g |
3-(Benzyloxy)-5-methylphenol |
36776-44-0 | 95%+ | 1g |
$358 | 2022-06-11 | |
| Chemenu | CM344791-5g |
3-(Benzyloxy)-5-methylphenol |
36776-44-0 | 95%+ | 5g |
$1072 | 2022-06-11 | |
| Chemenu | CM344791-10g |
3-(Benzyloxy)-5-methylphenol |
36776-44-0 | 95%+ | 10g |
$1715 | 2022-06-11 | |
| A2B Chem LLC | AD37129-250mg |
3-(Benzyloxy)-5-methylphenol |
36776-44-0 | 97% | 250mg |
$114.00 | 2024-04-20 | |
| A2B Chem LLC | AD37129-1g |
3-(Benzyloxy)-5-methylphenol |
36776-44-0 | 97% | 1g |
$282.00 | 2024-04-20 | |
| A2B Chem LLC | AD37129-5g |
3-(Benzyloxy)-5-methylphenol |
36776-44-0 | 97% | 5g |
$771.00 | 2024-04-20 | |
| A2B Chem LLC | AD37129-10g |
3-(Benzyloxy)-5-methylphenol |
36776-44-0 | 97% | 10g |
$1316.00 | 2024-04-20 | |
| SHANG HAI HAO HONG Biomedical Technology Co., Ltd. | 1734601-1g |
3-(Benzyloxy)-5-methylphenol |
36776-44-0 | 98% | 1g |
¥2212.00 | 2024-05-16 | |
| 1PlusChem | 1P0078QX-1g |
Phenol,3-methyl-5-(phenylmethoxy)- |
36776-44-0 | 97% | 1g |
$370.00 | 2025-02-21 | |
| 1PlusChem | 1P0078QX-250mg |
Phenol,3-methyl-5-(phenylmethoxy)- |
36776-44-0 | 97% | 250mg |
$96.00 | 2025-02-21 |
Phenol,3-methyl-5-(phenylmethoxy)- Related Literature
-
Joseph W. Bennett,Diamond T. Jones,Blake G. Hudson,Joshua Melendez-Rivera,Robert J. Hamers,Sara E. Mason Environ. Sci.: Nano, 2020,7, 1642-1651
-
Ivor Lon?ari? Phys. Chem. Chem. Phys., 2015,17, 9436-9445
-
Tengfei Yu,Yuehan Wu,Wei Li,Bin Li RSC Adv., 2014,4, 34134-34143
-
Weili Dai,Guangjun Wu,Michael Hunger Chem. Commun., 2015,51, 13779-13782
-
Thi Thu Tram Nguyen,Thanh Binh Nguyen Org. Biomol. Chem., 2021,19, 6015-6020
Additional information on Phenol,3-methyl-5-(phenylmethoxy)-
Phenol, 3-methyl-5-(phenylmethoxy) - A Comprehensive Overview
Phenol, 3-methyl-5-(phenylmethoxy), also known by its CAS number 36776-44-0, is a versatile organic compound with a unique structure that has garnered significant attention in both academic and industrial research. This compound belongs to the phenol family, characterized by a hydroxyl group (-OH) attached to a benzene ring. The presence of a methyl group at the 3-position and a phenylmethoxy group at the 5-position introduces distinct chemical properties and functional groups that make it highly valuable in various applications.
The molecular formula of Phenol, 3-methyl-5-(phenylmethoxy) is C14H14O2, with a molecular weight of 218.26 g/mol. Its structure consists of a benzene ring substituted with a hydroxyl group at position 1, a methyl group at position 3, and a phenylmethoxy group at position 5. This arrangement creates a molecule with both electron-donating and electron-withdrawing groups, which influence its reactivity and stability. The compound is typically synthesized through nucleophilic aromatic substitution or coupling reactions, depending on the desired regiochemistry and yield.
Recent studies have highlighted the potential of Phenol, 3-methyl-5-(phenylmethoxy) in the field of materials science. Researchers have explored its use as a precursor for advanced polymers and high-performance materials due to its ability to form stable covalent bonds under specific conditions. For instance, investigations into its application in the synthesis of polyurethanes have shown promising results, where the compound acts as a building block for creating lightweight yet durable materials suitable for aerospace and automotive industries.
In addition to its role in materials science, Phenol, 3-methyl-5-(phenylmethoxy) has also been studied for its pharmacological properties. Preclinical studies suggest that this compound exhibits moderate anti-inflammatory and antioxidant activities, making it a potential candidate for drug development. Furthermore, its ability to interact with specific biological targets has led to exploratory research in the context of cancer therapy, where it has shown selective cytotoxicity against certain tumor cell lines.
The synthesis of Phenol, 3-methyl-5-(phenylmethoxy) has been optimized in recent years to improve yield and reduce production costs. One notable advancement involves the use of microwave-assisted synthesis techniques, which significantly accelerate reaction rates while maintaining product purity. This approach has been particularly beneficial for large-scale production in industries such as agrochemicals and specialty chemicals.
From an environmental perspective, the biodegradability and toxicity of Phenol, 3-methyl-5-(phenylmethoxy) have been assessed under various conditions. Studies indicate that the compound exhibits low acute toxicity to aquatic organisms when exposed to environmentally relevant concentrations. However, long-term ecological impacts remain an area of active research to ensure sustainable practices in its production and application.
In conclusion, Phenol, 3-methyl-5-(phenylmethoxy), CAS number 36776-44-0, stands out as a multifaceted compound with applications spanning materials science, pharmacology, and industrial chemistry. Its unique structure and functional groups continue to drive innovative research across diverse fields, underscoring its importance as a key component in modern chemical development.
36776-44-0 (Phenol,3-methyl-5-(phenylmethoxy)-) Related Products
- 3769-42-4(1,3-Dibenzyloxybenzene)
- 621-91-0(1,4-Dibenzyloxybenzene)
- 6214-44-4(4-Ethoxybenzyl Acohol)
- 836-43-1(p-Benzyloxybenzyl Alcohol)
- 1515-81-7(p-(Methoxymethyl)anisole)
- 946-80-5(Benzyl phenyl ether)
- 176650-92-3(3,5-Bis(3,5-dimethoxybenzyloxy)benzyl Alcohol)
- 24131-31-5(3,5-Dibenzyloxybenzyl alcohol)
- 705-76-0(3,5-Dimethoxybenzyl alcohol)
- 103-16-2(Monobenzone)