Cas no 24653-79-0 (3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride)
3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride Chemical and Physical Properties
Names and Identifiers
-
- Benzenesulfonyl chloride, 3,5-dichloro-4-methyl-
- 3,5-dichloro-4-methylbenzene-1-sulfonylchloride
- 24653-79-0
- SCHEMBL9449881
- EN300-118639
- 2,6-dichloro-p-toluenesulfonyl chloride
- 3,5-Dichloro-4-methylbenzenesulfonyl chloride
- G53059
- AKOS011078250
- 3,5-dichloro-4-methylbenzene-1-sulfonyl chloride
- 3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride
-
- Inchi: 1S/C7H5Cl3O2S/c1-4-6(8)2-5(3-7(4)9)13(10,11)12/h2-3H,1H3
- InChI Key: OLFWFOJPCBLRSU-UHFFFAOYSA-N
- SMILES: ClC1C=C(C=C(C=1C)Cl)S(=O)(=O)Cl
Computed Properties
- Exact Mass: 257.90775
- Monoisotopic Mass: 257.907584g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 2
- Heavy Atom Count: 13
- Rotatable Bond Count: 1
- Complexity: 260
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 3.6
- Topological Polar Surface Area: 42.5?2
Experimental Properties
- PSA: 34.14
3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| TRC | D484233-10mg |
3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride |
24653-79-0 | 10mg |
$ 50.00 | 2022-06-05 | ||
| TRC | D484233-50mg |
3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride |
24653-79-0 | 50mg |
$ 160.00 | 2022-06-05 | ||
| TRC | D484233-100mg |
3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride |
24653-79-0 | 100mg |
$ 230.00 | 2022-06-05 | ||
| Alichem | A010010351-250mg |
3,5-Dichloro-4-methylbenzenesulfonyl chloride |
24653-79-0 | 97% | 250mg |
$494.40 | 2023-09-02 | |
| Alichem | A010010351-500mg |
3,5-Dichloro-4-methylbenzenesulfonyl chloride |
24653-79-0 | 97% | 500mg |
$815.00 | 2023-09-02 | |
| Alichem | A010010351-1g |
3,5-Dichloro-4-methylbenzenesulfonyl chloride |
24653-79-0 | 97% | 1g |
$1519.80 | 2023-09-02 | |
| A2B Chem LLC | AV49555-50mg |
3,5-dichloro-4-methylbenzene-1-sulfonyl chloride |
24653-79-0 | 95% | 50mg |
$142.00 | 2024-04-20 | |
| A2B Chem LLC | AV49555-100mg |
3,5-dichloro-4-methylbenzene-1-sulfonyl chloride |
24653-79-0 | 95% | 100mg |
$195.00 | 2024-04-20 | |
| A2B Chem LLC | AV49555-250mg |
3,5-dichloro-4-methylbenzene-1-sulfonyl chloride |
24653-79-0 | 95% | 250mg |
$263.00 | 2024-04-20 | |
| A2B Chem LLC | AV49555-500mg |
3,5-dichloro-4-methylbenzene-1-sulfonyl chloride |
24653-79-0 | 95% | 500mg |
$464.00 | 2024-04-20 |
3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride Related Literature
-
1. Fatty acid eutectic mixtures and derivatives from non-edible animal fat as phase change materials?Pau Gallart-Sirvent,Marc Martín,Gemma Villorbina,Mercè Balcells,Aran Solé,Luisa F. Cabeza,Ramon Canela-Garayoa RSC Adv., 2017,7, 24133-24139
-
Qiao Song,Angela Bamesberger,Lingyun Yang,Haley Houtwed,Haishi Cao Analyst, 2014,139, 3588-3592
-
Hongxia Li,Aikifa Raza,Qiaoyu Ge,Jin-You Lu,TieJun Zhang Soft Matter, 2020,16, 6841-6849
-
Ziyang Deng,Changwei Chen,Sunliang Cui RSC Adv., 2016,6, 93753-93755
-
Albertus D. Handoko,Khoong Hong Khoo,Teck Leong Tan,Hongmei Jin,Zhi Wei Seh J. Mater. Chem. A, 2018,6, 21885-21890
Additional information on 3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride
3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride (CAS No. 24653-79-0)
3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride, also known as CAS No. 24653-79-0, is a versatile organic compound with significant applications in the field of organic synthesis and materials science. This compound is characterized by its unique structure, which includes a benzene ring substituted with two chlorine atoms at the 3 and 5 positions, a methyl group at the 4 position, and a sulfonyl chloride group at the 1 position. The combination of these substituents imparts distinct chemical properties, making it a valuable reagent in various synthetic processes.
The synthesis of 3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride typically involves multi-step reactions, often starting from chlorobenzene derivatives. The introduction of the sulfonyl chloride group is a critical step, as it enables the compound to act as an electrophilic agent in subsequent reactions. Recent advancements in catalytic methods and green chemistry have led to more efficient and environmentally friendly synthesis routes for this compound.
In terms of chemical reactivity, 3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride exhibits high electrophilicity due to the electron-withdrawing nature of the sulfonyl chloride group. This makes it an excellent reagent for nucleophilic substitution reactions, particularly with amines, alcohols, and thiols. The presence of chlorine atoms at the 3 and 5 positions further enhances the compound's stability and reactivity by creating a highly activated aromatic system.
One of the most notable applications of CAS No. 24653-79-0 is in the synthesis of sulfonamides, which are widely used in pharmaceuticals and agrochemicals. The sulfonamide group can be introduced by reacting the sulfonyl chloride with an amine, leading to the formation of stable amide bonds. Recent studies have demonstrated that this reaction can be optimized using microwave-assisted techniques, significantly reducing reaction times while maintaining high yields.
Beyond pharmaceutical applications, 3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride has found utility in materials science as a building block for advanced polymers and coatings. Its ability to undergo various coupling reactions makes it ideal for designing functional materials with tailored properties such as high thermal stability and mechanical strength.
From an environmental perspective, researchers have been exploring the biodegradation pathways of CAS No. 24653-79-0 to assess its potential impact on ecosystems. Studies indicate that under specific microbial conditions, the compound can undergo hydrolysis to form less hazardous byproducts. These findings are crucial for developing sustainable industrial practices that minimize environmental risks associated with its use.
In conclusion, 3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride (CAS No. 24653-79-0) is a multifaceted organic compound with diverse applications across various industries. Its unique chemical properties and reactivity make it an indispensable tool in modern organic synthesis. Ongoing research continues to uncover new avenues for its application while addressing environmental concerns through innovative synthesis and degradation studies.
24653-79-0 (3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)