Cas no 2219339-13-4 (4-(3-Chlorophenyl)-1-nitrosopiperazine)
4-(3-Chlorophenyl)-1-nitrosopiperazine Chemical and Physical Properties
Names and Identifiers
-
- 1-(3-chlorophenyl)-4-nitrosopiperazine
- 4-(3-Chlorophenyl)-1-nitrosopiperazine
-
- MDL: MFCD32710602
- Inchi: 1S/C10H12ClN3O/c11-9-2-1-3-10(8-9)13-4-6-14(12-15)7-5-13/h1-3,8H,4-7H2
- InChI Key: SAUUWOYGFFSLAY-UHFFFAOYSA-N
- SMILES: N1(C2=CC=CC(Cl)=C2)CCN(N=O)CC1
4-(3-Chlorophenyl)-1-nitrosopiperazine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| TRC | C141520-25mg |
4-(3-Chlorophenyl)-1-nitrosopiperazine |
2219339-13-4 | 25mg |
$ 155.00 | 2023-04-18 | ||
| TRC | C141520-100mg |
4-(3-Chlorophenyl)-1-nitrosopiperazine |
2219339-13-4 | 100mg |
$ 563.00 | 2023-04-18 | ||
| TRC | C141520-250mg |
4-(3-Chlorophenyl)-1-nitrosopiperazine |
2219339-13-4 | 250mg |
$ 800.00 | 2023-09-08 | ||
| Enamine | EN300-26625515-0.05g |
1-(3-chlorophenyl)-4-nitrosopiperazine |
2219339-13-4 | 95% | 0.05g |
$212.0 | 2023-09-12 | |
| Enamine | EN300-26625515-0.1g |
1-(3-chlorophenyl)-4-nitrosopiperazine |
2219339-13-4 | 95% | 0.1g |
$317.0 | 2023-09-12 | |
| Enamine | EN300-26625515-0.25g |
1-(3-chlorophenyl)-4-nitrosopiperazine |
2219339-13-4 | 95% | 0.25g |
$452.0 | 2023-09-12 | |
| Enamine | EN300-26625515-0.5g |
1-(3-chlorophenyl)-4-nitrosopiperazine |
2219339-13-4 | 95% | 0.5g |
$713.0 | 2023-09-12 | |
| Enamine | EN300-26625515-1.0g |
1-(3-chlorophenyl)-4-nitrosopiperazine |
2219339-13-4 | 95% | 1g |
$914.0 | 2023-06-03 | |
| Enamine | EN300-26625515-2.5g |
1-(3-chlorophenyl)-4-nitrosopiperazine |
2219339-13-4 | 95% | 2.5g |
$1791.0 | 2023-09-12 | |
| Enamine | EN300-26625515-5.0g |
1-(3-chlorophenyl)-4-nitrosopiperazine |
2219339-13-4 | 95% | 5g |
$2650.0 | 2023-06-03 |
4-(3-Chlorophenyl)-1-nitrosopiperazine Related Literature
-
Govind Reddy Mol. Syst. Des. Eng., 2021,6, 779-789
-
2. An integrated chip for immunofluorescence and its application to analyze lysosomal storage disordersJie Shen,Ying Zhou,Tu Lu,Junya Peng,Zhixiang Lin,Yuhong Pang,Li Yu Lab Chip, 2012,12, 317-324
-
3. An all-solid-state imprinted polymer-based potentiometric sensor for determination of bisphenol S?Rongning Liang,Tanji Yin,Ruiqing Yao,Wei Qin RSC Adv., 2016,6, 73308-73312
-
Yu-Nong Li,Liang-Nian He,Xian-Dong Lang,Xiao-Fang Liu,Shuai Zhang RSC Adv., 2014,4, 49995-50002
Additional information on 4-(3-Chlorophenyl)-1-nitrosopiperazine
4-(3-Chlorophenyl)-1-nitrosopiperazine: A Comprehensive Overview
The compound 4-(3-Chlorophenyl)-1-nitrosopiperazine, identified by the CAS number CAS No. 2219339-13-4, is a fascinating molecule with significant potential in various fields of chemistry and pharmacology. This compound belongs to the class of piperazine derivatives, which are widely studied due to their unique structural properties and diverse applications. The presence of a nitroso group (-NO) at the 1-position of the piperazine ring introduces interesting electronic and steric effects, making this compound a subject of interest in both academic and industrial research.
Recent advancements in synthetic chemistry have enabled the efficient synthesis of 4-(3-Chlorophenyl)-1-nitrosopiperazine. Researchers have employed various strategies, including nucleophilic substitution and condensation reactions, to construct this molecule. The incorporation of the nitroso group has been achieved through innovative methods such as diazotization followed by coupling reactions, which have significantly improved the yield and purity of the compound. These developments highlight the importance of optimizing synthetic pathways to meet the growing demand for high-quality chemical intermediates.
The structural uniqueness of 4-(3-Chlorophenyl)-1-nitrosopiperazine lies in its combination of a piperazine ring with a chlorophenyl substituent. The piperazine ring, a six-membered saturated heterocycle containing two nitrogen atoms, provides a rigid framework that can be further functionalized for various applications. The chlorophenyl group introduces electron-withdrawing effects, which can influence the reactivity and selectivity of the molecule in different chemical environments. This makes it an attractive candidate for exploring its role in drug design and material science.
Recent studies have focused on the pharmacological properties of 4-(3-Chlorophenyl)-1-nitrosopiperazine. Preclinical research has demonstrated its potential as an anti-inflammatory agent, with promising results in reducing inflammation in animal models. The nitroso group is believed to play a critical role in modulating these effects by influencing the redox balance within cellular systems. Additionally, investigations into its antioxidant properties have revealed its ability to scavenge free radicals, suggesting its potential application in combating oxidative stress-related diseases.
The application of computational chemistry tools has further enhanced our understanding of this compound's behavior at the molecular level. Advanced molecular modeling techniques have provided insights into its electronic structure, conformational flexibility, and interaction patterns with biological targets. These findings are crucial for guiding future research aimed at optimizing its bioavailability and therapeutic efficacy.
In conclusion, 4-(3-Chlorophenyl)-1-nitrosopiperazine represents a promising molecule with diverse applications across multiple disciplines. Its unique structure, coupled with recent advancements in synthesis and pharmacology, positions it as a valuable asset in both academic and industrial settings. As research continues to uncover its full potential, this compound is expected to contribute significantly to the development of novel drugs and materials.
2219339-13-4 (4-(3-Chlorophenyl)-1-nitrosopiperazine) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)