Cas no 2138517-32-3 (sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate)
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate Chemical and Physical Properties
Names and Identifiers
-
- sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate
-
- MDL: MFCD31558644
- Inchi: 1S/C5H4BrNO2S.Na/c1-2-3(6)10-4(7-2)5(8)9;/h1H3,(H,8,9);/q;+1/p-1
- InChI Key: QUSVPKAEQIOZIE-UHFFFAOYSA-M
- SMILES: [Na+].S1C(Br)=C(C)N=C1C([O-])=O
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Chemenu | CM425447-250mg |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95%+ | 250mg |
$586 | 2022-12-31 | |
| Chemenu | CM425447-500mg |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95%+ | 500mg |
$656 | 2022-12-31 | |
| Chemenu | CM425447-1g |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95%+ | 1g |
$727 | 2022-12-31 | |
| Enamine | EN300-814414-1g |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95% | 1g |
$918.0 | 2023-09-02 | |
| Enamine | EN300-814414-5g |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95% | 5g |
$2052.0 | 2023-09-02 | |
| Enamine | EN300-814414-10g |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95% | 10g |
$3469.0 | 2023-09-02 | |
| Enamine | EN300-814414-0.05g |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95.0% | 0.05g |
$183.0 | 2025-02-21 | |
| Enamine | EN300-814414-0.1g |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95.0% | 0.1g |
$272.0 | 2025-02-21 | |
| Enamine | EN300-814414-0.25g |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95.0% | 0.25g |
$388.0 | 2025-02-21 | |
| Enamine | EN300-814414-0.5g |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate |
2138517-32-3 | 95.0% | 0.5g |
$612.0 | 2025-02-21 |
sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate Related Literature
-
Govind Reddy Mol. Syst. Des. Eng., 2021,6, 779-789
-
Sandip Gangadhar Balwe,Yeon Tae Jeong Org. Biomol. Chem., 2018,16, 1287-1296
-
3. An integrated chip for immunofluorescence and its application to analyze lysosomal storage disordersJie Shen,Ying Zhou,Tu Lu,Junya Peng,Zhixiang Lin,Yuhong Pang,Li Yu Lab Chip, 2012,12, 317-324
-
Li-Hua Gan,Rui Wu,Jian-Lei Tian,Patrick W. Fowler Phys. Chem. Chem. Phys., 2017,19, 419-425
-
Piotr Szcze?niak,Sebastian Stecko RSC Adv., 2015,5, 30882-30888
Additional information on sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate
Sodium 5-Bromo-4-Methyl-1,3-Thiazole-2-Carboxylate: A Comprehensive Overview
Sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate, identified by the CAS number 2138517-32-3, is a compound of significant interest in the fields of organic chemistry and materials science. This compound belongs to the class of thiazole derivatives, which are widely studied for their unique chemical properties and potential applications in various industries. The thiazole ring system, characterized by a five-membered heterocycle containing sulfur and nitrogen atoms, forms the core structure of this compound. The substituents attached to the thiazole ring—specifically, the bromine atom at position 5 and the methyl group at position 4—contribute to its distinct chemical reactivity and physical properties.
The synthesis of sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate typically involves multi-step organic reactions. Recent advancements in synthetic methodologies have enabled more efficient and selective routes to prepare this compound. For instance, researchers have explored the use of microwave-assisted synthesis to accelerate reaction times while maintaining high yields. This approach not only enhances the scalability of the synthesis but also aligns with the growing demand for sustainable chemical processes in modern industries.
One of the most promising applications of sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate lies in its use as an intermediate in pharmaceutical research. The thiazole moiety is known for its ability to modulate various biological targets, making it a valuable component in drug discovery programs. Recent studies have demonstrated that derivatives of this compound exhibit potent anti-inflammatory and antioxidant activities, suggesting their potential utility in treating conditions such as neurodegenerative diseases and cardiovascular disorders.
In addition to its pharmaceutical applications, sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate has also found relevance in materials science. The compound's ability to form stable coordination complexes with metal ions has been exploited in the development of novel catalysts for organic transformations. For example, recent research has highlighted its role as a ligand in palladium-catalyzed cross-coupling reactions, which are critical in synthesizing complex organic molecules with high precision.
The environmental impact of sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate is another area of active investigation. As concerns about sustainability and eco-friendliness grow, understanding the fate and behavior of this compound in natural ecosystems has become increasingly important. Studies have shown that under aerobic conditions, the compound undergoes biodegradation through microbial action, albeit at a relatively slow rate. This information is crucial for assessing its potential risks to aquatic life and guiding regulatory decisions on its safe handling and disposal.
Looking ahead, ongoing research aims to further elucidate the mechanistic details underlying the reactivity of sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate. Advanced computational techniques, such as density functional theory (DFT), are being employed to probe its electronic structure and predict its reactivity under various conditions. These insights are expected to pave the way for innovative applications in fields ranging from agrochemicals to electronic materials.
In conclusion, sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate stands as a versatile compound with a wide array of potential applications across multiple disciplines. Its unique chemical properties, coupled with ongoing advancements in synthetic and analytical methodologies, ensure that it remains a focal point for scientific exploration and technological innovation.
2138517-32-3 (sodium 5-bromo-4-methyl-1,3-thiazole-2-carboxylate) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)