Cas no 2092836-69-4 (2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride)
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride Chemical and Physical Properties
Names and Identifiers
-
- 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride
-
- MDL: MFCD31420760
- Inchi: 1S/C7H15ClO3S/c1-6(2)11-7(3,4)5-12(8,9)10/h6H,5H2,1-4H3
- InChI Key: AHBUIGKQXQNHJH-UHFFFAOYSA-N
- SMILES: C(S(Cl)(=O)=O)C(C)(OC(C)C)C
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-227368-0.05g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 95% | 0.05g |
$174.0 | 2024-06-20 | |
| Enamine | EN300-227368-0.1g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 95% | 0.1g |
$257.0 | 2024-06-20 | |
| Enamine | EN300-227368-0.25g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 95% | 0.25g |
$367.0 | 2024-06-20 | |
| Enamine | EN300-227368-0.5g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 95% | 0.5g |
$579.0 | 2024-06-20 | |
| Enamine | EN300-227368-1.0g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 95% | 1.0g |
$743.0 | 2024-06-20 | |
| Enamine | EN300-227368-2.5g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 95% | 2.5g |
$1454.0 | 2024-06-20 | |
| Enamine | EN300-227368-5.0g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 95% | 5.0g |
$2152.0 | 2024-06-20 | |
| Enamine | EN300-227368-10.0g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 95% | 10.0g |
$3191.0 | 2024-06-20 | |
| Enamine | EN300-227368-1g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 1g |
$743.0 | 2023-09-15 | ||
| Enamine | EN300-227368-5g |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride |
2092836-69-4 | 5g |
$2152.0 | 2023-09-15 |
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride Related Literature
-
David White,Sean R. Stowell Biomater. Sci., 2017,5, 463-474
-
Dhirendra K. Chaudhary,Pramendra Kumar,Lokendra Kumar RSC Adv., 2016,6, 94731-94738
-
Gaurav J. Shah,Eric P.-Y. Chiou,Ming C. Wu,Chang-Jin “CJ” Kim Lab Chip, 2009,9, 1732-1739
-
Christopher J. Harrison,Kyle J. Berean,Enrico Della Gaspera,Jian Zhen Ou,Richard B. Kaner,Kourosh Kalantar-zadeh,Torben Daeneke Nanoscale, 2016,8, 16276-16283
-
Ivor Lon?ari? Phys. Chem. Chem. Phys., 2015,17, 9436-9445
Additional information on 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride
Introduction to 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride (CAS No. 2092836-69-4)
2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride, with the CAS number 2092836-69-4, is a versatile and highly reactive organic compound that has gained significant attention in recent years due to its unique chemical properties and potential applications in various fields, particularly in the pharmaceutical and chemical industries. This compound belongs to the class of sulfonyl chlorides, which are known for their ability to participate in a wide range of synthetic transformations and reactions.
The molecular structure of 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride consists of a sulfonyl chloride functional group (-SO2Cl) attached to a substituted propane backbone. The presence of the tert-butyl ether moiety (propan-2-yloxy) and the methyl group on the propane chain imparts specific reactivity and stability characteristics to this compound. These features make it an attractive reagent for synthetic chemists working on the development of new pharmaceuticals, agrochemicals, and materials.
In the context of pharmaceutical research, 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride has been explored for its potential in the synthesis of biologically active molecules. Recent studies have demonstrated its utility in the preparation of sulfonamide derivatives, which are important intermediates in the synthesis of various drugs, including antibiotics, antivirals, and anti-inflammatory agents. The high reactivity of the sulfonyl chloride group allows for efficient coupling with amines, leading to the formation of sulfonamides with high yields and purity.
Beyond its role in drug synthesis, 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride has also found applications in the development of novel materials. For instance, it can be used as a crosslinking agent in polymer chemistry, where its reactivity enables the formation of robust and stable polymer networks. These networks have potential uses in areas such as coatings, adhesives, and biomedical devices.
The synthetic versatility of 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride is further highlighted by its ability to undergo various chemical transformations. For example, it can be converted into sulfonic acids or sulfonates through hydrolysis or nucleophilic substitution reactions. These derivatives have applications in catalysis, surfactants, and other industrial processes.
In terms of safety and handling, it is important to note that sulfonyl chlorides are generally reactive and can be sensitive to moisture and heat. Therefore, proper storage conditions and handling procedures should be followed to ensure safety and maintain product integrity. It is recommended to store 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride under an inert atmosphere at low temperatures.
The environmental impact of compounds like 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride is another area of ongoing research. Efforts are being made to develop more sustainable synthetic methods that minimize waste generation and reduce environmental footprint. Green chemistry principles are increasingly being applied to ensure that the production and use of such compounds are environmentally responsible.
In conclusion, 2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride (CAS No. 2092836-69-4) is a valuable reagent with a wide range of applications in both academic research and industrial settings. Its unique chemical properties make it an essential tool for synthetic chemists working on the development of new drugs, materials, and other advanced products. As research continues to advance, it is likely that new applications for this compound will be discovered, further expanding its utility in the chemical sciences.
2092836-69-4 (2-methyl-2-(propan-2-yloxy)propane-1-sulfonyl chloride) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)