Cas no 2034391-76-7 (N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide)
N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide Chemical and Physical Properties
Names and Identifiers
-
- F6476-3311
- N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide
- AKOS025317901
- N-[(4-methoxyphenyl)methyl]-3-[4-(trifluoromethyl)pyridin-2-yl]oxypyrrolidine-1-carboxamide
- N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide
- 2034391-76-7
-
- Inchi: 1S/C19H20F3N3O3/c1-27-15-4-2-13(3-5-15)11-24-18(26)25-9-7-16(12-25)28-17-10-14(6-8-23-17)19(20,21)22/h2-6,8,10,16H,7,9,11-12H2,1H3,(H,24,26)
- InChI Key: ILEVLKZLHQXSLJ-UHFFFAOYSA-N
- SMILES: FC(C1C=CN=C(C=1)OC1CN(C(NCC2C=CC(=CC=2)OC)=O)CC1)(F)F
Computed Properties
- Exact Mass: 395.14567599g/mol
- Monoisotopic Mass: 395.14567599g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 1
- Hydrogen Bond Acceptor Count: 7
- Heavy Atom Count: 28
- Rotatable Bond Count: 5
- Complexity: 512
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 1
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 3
- Topological Polar Surface Area: 63.7?2
N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Life Chemicals | F6476-3311-2μmol |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 2μl |
$85.5 | 2023-07-05 | |
| Life Chemicals | F6476-3311-5μmol |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 5μl |
$94.5 | 2023-07-05 | |
| Life Chemicals | F6476-3311-10μmol |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 10μl |
$103.5 | 2023-07-05 | |
| Life Chemicals | F6476-3311-20μmol |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 20μl |
$118.5 | 2023-07-05 | |
| Life Chemicals | F6476-3311-1mg |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 1mg |
$81.0 | 2023-07-05 | |
| Life Chemicals | F6476-3311-2mg |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 2mg |
$88.5 | 2023-07-05 | |
| Life Chemicals | F6476-3311-3mg |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 3mg |
$94.5 | 2023-07-05 | |
| Life Chemicals | F6476-3311-4mg |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 4mg |
$99.0 | 2023-07-05 | |
| Life Chemicals | F6476-3311-5mg |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 5mg |
$103.5 | 2023-07-05 | |
| Life Chemicals | F6476-3311-10mg |
N-[(4-methoxyphenyl)methyl]-3-{[4-(trifluoromethyl)pyridin-2-yl]oxy}pyrrolidine-1-carboxamide |
2034391-76-7 | 90%+ | 10mg |
$118.5 | 2023-07-05 |
N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide Related Literature
-
Hongxia Li,Aikifa Raza,Qiaoyu Ge,Jin-You Lu,TieJun Zhang Soft Matter, 2020,16, 6841-6849
-
Yong Ping Huang,Tao Tao,Zheng Chen,Wei Han,Ying Wu,Chunjiang Kuang,Shaoxiong Zhou,Ying Chen J. Mater. Chem. A, 2014,2, 18831-18837
-
Yaling Zhang,Chunhui Dai,Shiwei Zhou,Bin Liu Chem. Commun., 2018,54, 10092-10095
-
Joo Chuan Yeo,Kenry Lab Chip, 2016,16, 4082-4090
Additional information on N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide
Professional Introduction to N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide (CAS No. 2034391-76-7)
N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide is a sophisticated organic compound that has garnered significant attention in the field of pharmaceutical chemistry and drug discovery. This compound, identified by its CAS number 2034391-76-7, represents a pinnacle of molecular design, incorporating multiple functional groups that contribute to its unique chemical properties and potential biological activities. The presence of a pyrrolidine core, combined with substituents such as 4-methoxybenzyl and 4-(trifluoromethyl)pyridin-2-yl, makes it a promising candidate for further investigation in medicinal chemistry.
The pyrrolidine scaffold is a privileged structure in drug design, known for its ability to mimic the conformational flexibility of natural amino acids. This feature enhances the compound's potential to interact with biological targets, particularly enzymes and receptors. The incorporation of the 4-methoxybenzyl group introduces a hydrophobic moiety that can improve membrane permeability, a critical factor for drug bioavailability. Additionally, the 4-(trifluoromethyl)pyridin-2-yl substituent adds electronic bulk and lipophilicity, which can modulate the compound's pharmacokinetic profile.
In recent years, there has been a surge in research focused on developing novel therapeutic agents with enhanced efficacy and reduced side effects. N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide has emerged as a compound of interest due to its structural complexity and potential biological activity. Studies have shown that derivatives of this class exhibit promising properties in various disease models, including cancer, inflammation, and neurological disorders. The trifluoromethyl group, in particular, is well-known for its ability to enhance metabolic stability and binding affinity to biological targets.
The synthesis of this compound involves multiple steps, each requiring precise control over reaction conditions to ensure high yield and purity. Advanced synthetic techniques, such as palladium-catalyzed cross-coupling reactions and protecting group strategies, are employed to construct the complex molecular framework. The use of high-performance liquid chromatography (HPLC) and nuclear magnetic resonance (NMR) spectroscopy allows for rigorous characterization of the final product, ensuring that it meets the stringent requirements for pharmaceutical applications.
The pharmacological profile of N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide is under active investigation in several research laboratories. Preliminary studies suggest that this compound may possess inhibitory activity against key enzymes involved in disease pathways. For instance, its structure resembles known inhibitors of kinases and phosphodiesterases, which are critical targets in cancer therapy. Additionally, the presence of the pyrrolidine core suggests potential interactions with G protein-coupled receptors (GPCRs), which are involved in a wide range of physiological processes.
The development of novel drug candidates often involves virtual screening and high-throughput screening (HTS) methodologies to identify compounds with desirable biological activity. N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide has been subjected to these screening processes, demonstrating its potential as a lead compound for further optimization. Computational modeling techniques are employed to predict binding interactions between the compound and target proteins, providing insights into its mechanism of action.
In conclusion, N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide is a multifaceted compound with significant potential in pharmaceutical research. Its unique structural features make it an attractive candidate for further development into therapeutic agents targeting various diseases. As research continues to uncover new applications for this compound, it is likely to play a crucial role in the advancement of modern medicine.
2034391-76-7 (N-(4-methoxybenzyl)-3-((4-(trifluoromethyl)pyridin-2-yl)oxy)pyrrolidine-1-carboxamide) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)