Cas no 203251-37-0 (2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one)
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one Chemical and Physical Properties
Names and Identifiers
-
- 2-chloro-1-(3-chloro-4-fluorophenyl)ethanone
- 2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one
-
- Inchi: InChI=1S/C8H5Cl2FO/c9-4-8(12)5-1-2-7(11)6(10)3-5/h1-3H,4H2
- InChI Key: AASJJWQLIAAUBM-UHFFFAOYSA-N
- SMILES: C1=CC(=C(C=C1C(=O)CCl)Cl)F
Computed Properties
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 1
- Heavy Atom Count: 12
- Rotatable Bond Count: 2
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| TRC | C612205-25mg |
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one |
203251-37-0 | 25mg |
$ 70.00 | 2022-06-06 | ||
| TRC | C612205-50mg |
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one |
203251-37-0 | 50mg |
$ 95.00 | 2022-06-06 | ||
| TRC | C612205-250mg |
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one |
203251-37-0 | 250mg |
$ 365.00 | 2022-06-06 | ||
| Chemenu | CM460244-250mg |
Ethanone, 2-chloro-1-(3-chloro-4-fluorophenyl)- |
203251-37-0 | 95%+ | 250mg |
$246 | 2022-06-12 | |
| Chemenu | CM460244-500mg |
Ethanone, 2-chloro-1-(3-chloro-4-fluorophenyl)- |
203251-37-0 | 95%+ | 500mg |
$445 | 2022-06-12 | |
| Chemenu | CM460244-1g |
Ethanone, 2-chloro-1-(3-chloro-4-fluorophenyl)- |
203251-37-0 | 95%+ | 1g |
$592 | 2022-06-12 | |
| Enamine | EN300-103647-0.05g |
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one |
203251-37-0 | 95% | 0.05g |
$101.0 | 2023-10-28 | |
| Enamine | EN300-103647-0.1g |
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one |
203251-37-0 | 95% | 0.1g |
$152.0 | 2023-10-28 | |
| Enamine | EN300-103647-0.25g |
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one |
203251-37-0 | 95% | 0.25g |
$216.0 | 2023-10-28 | |
| Enamine | EN300-103647-0.5g |
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one |
203251-37-0 | 95% | 0.5g |
$407.0 | 2023-10-28 |
2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one Related Literature
-
Yi Cao,Yujiao Xiahou,Lixiang Xing,Xiang Zhang,Hong Li,ChenShou Wu,Haibing Xia Nanoscale, 2020,12, 20456-20466
-
Albertus D. Handoko,Khoong Hong Khoo,Teck Leong Tan,Hongmei Jin,Zhi Wei Seh J. Mater. Chem. A, 2018,6, 21885-21890
-
Ji-Ping Wei Nanoscale, 2015,7, 11815-11832
-
Amandine Altmayer-Henzien,Valérie Declerck,David J. Aitken,Ewen Lescop,Denis Merlet,Jonathan Farjon Org. Biomol. Chem., 2013,11, 7611-7615
Additional information on 2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one
2-Chloro-1-(3-Chloro-4-Fluorophenyl)Ethan-1-One: A Comprehensive Overview
The compound with CAS No. 203251-37-0, commonly referred to as 2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one, is a significant molecule in the field of organic chemistry. This compound is characterized by its unique structure, which includes a chlorine atom at the second position of the ethanone group and a substituted phenyl ring at the first position. The phenyl ring itself is further substituted with a chlorine atom at the third position and a fluorine atom at the fourth position, making it a highly functionalized aromatic system.
Recent studies have highlighted the importance of this compound in various chemical reactions and its potential applications in drug discovery. The presence of multiple halogen atoms in its structure makes it an interesting candidate for exploring halogen bonding interactions, which have gained significant attention in medicinal chemistry due to their role in stabilizing molecular complexes and enhancing bioavailability.
One of the most notable aspects of 2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one is its reactivity in nucleophilic acyl substitution reactions. Researchers have demonstrated that the compound can undergo efficient substitution reactions under mild conditions, making it a valuable precursor for synthesizing more complex molecules. This property has been leveraged in the development of novel pharmaceutical agents, particularly those targeting specific enzyme pathways.
Another area where this compound has shown promise is in its ability to act as a building block for constructing bioactive molecules. Its rigid structure and electron-withdrawing substituents make it an ideal candidate for exploring stereochemical outcomes in organic synthesis. Recent advancements in asymmetric catalysis have enabled the synthesis of enantiomerically pure derivatives of this compound, which are crucial for studying chirality-dependent biological activities.
The electronic properties of 2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one have also been extensively studied using computational methods. These studies have provided insights into its electronic structure, which is influenced by the presence of multiple electronegative substituents. The compound exhibits a high degree of electron deficiency at the carbonyl carbon, making it highly reactive towards nucleophiles. This characteristic has been exploited in designing efficient synthetic routes for various heterocyclic compounds.
In terms of applications, this compound has found utility in both academic and industrial settings. In academia, it serves as a model system for studying fundamental aspects of organic chemistry, such as reaction mechanisms and stereochemistry. In industry, it is used as an intermediate in the synthesis of agrochemicals and pharmaceuticals. Its versatility as a building block underscores its importance in modern organic synthesis.
Recent research has also focused on understanding the environmental fate and toxicity of 2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one. Studies have shown that it undergoes biodegradation under specific environmental conditions, which is critical for assessing its potential impact on ecosystems. Additionally, toxicological studies have provided valuable information about its safety profile, which is essential for regulatory compliance and risk assessment.
In conclusion, 2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one (CAS No. 203251-37-) is a versatile and intriguing molecule with diverse applications across various fields of chemistry. Its unique structure, reactivity, and functional properties make it an invaluable tool for researchers and industry professionals alike. As ongoing research continues to uncover new insights into its behavior and potential uses, this compound is poised to play an even more significant role in advancing chemical science.
203251-37-0 (2-chloro-1-(3-chloro-4-fluorophenyl)ethan-1-one) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)