Cas no 1903834-40-1 (tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate)
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate Chemical and Physical Properties
Names and Identifiers
-
- tert-butyl N-[(trans-2-(aminomethyl)cyclobutyl]carbamate
- tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate
-
- Inchi: 1S/C10H20N2O2/c1-10(2,3)14-9(13)12-8-5-4-7(8)6-11/h7-8H,4-6,11H2,1-3H3,(H,12,13)/t7-,8+/m0/s1
- InChI Key: AMKQULRTFZIKRO-JGVFFNPUSA-N
- SMILES: C(OC(C)(C)C)(=O)N[C@@H]1CC[C@H]1CN
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLG100425-100MG |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate |
1903834-40-1 | 95% | 100MG |
¥ 1,920.00 | 2023-04-14 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLG100425-250MG |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate |
1903834-40-1 | 95% | 250MG |
¥ 3,075.00 | 2023-04-14 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLG100425-500MG |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate |
1903834-40-1 | 95% | 500MG |
¥ 5,121.00 | 2023-04-14 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLG100425-1G |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate |
1903834-40-1 | 95% | 1g |
¥ 7,682.00 | 2023-04-14 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLG100425-5G |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate |
1903834-40-1 | 95% | 5g |
¥ 23,047.00 | 2023-04-14 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLG100425-100mg |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate |
1903834-40-1 | 95% | 100mg |
¥1920.0 | 2024-04-23 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLG100425-250mg |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate |
1903834-40-1 | 95% | 250mg |
¥3075.0 | 2024-04-23 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLG100425-500mg |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate |
1903834-40-1 | 95% | 500mg |
¥5121.0 | 2024-04-23 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLG100425-1g |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate |
1903834-40-1 | 95% | 1g |
¥7682.0 | 2024-04-23 | |
| Ambeed | A679607-1g |
rel-tert-Butyl ((1R,2S)-2-(aminomethyl)cyclobutyl)carbamate |
1903834-40-1 | 97% | 1g |
$1485.0 | 2024-04-22 |
tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate Related Literature
-
Shaun D. Wong,Edward I. Solomon Dalton Trans., 2014,43, 17567-17577
-
Gloria Belén Ramírez-Rodríguez,José Manuel Delgado-López,Jaime Gómez-Morales CrystEngComm, 2013,15, 2206-2212
-
Domenico Lombardo,Gianmarco Munaò,Pietro Calandra,Luigi Pasqua,Maria Teresa Caccamo Phys. Chem. Chem. Phys., 2019,21, 11983-11991
Additional information on tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate
Introduction to tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate (CAS No. 1903834-40-1)
Tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate, identified by its Chemical Abstracts Service (CAS) number 1903834-40-1, is a specialized organic compound that has garnered significant attention in the field of pharmaceutical chemistry and bioorganic synthesis. This compound belongs to the class of carbamates, which are widely recognized for their versatile applications in medicinal chemistry, particularly as intermediates in the synthesis of bioactive molecules. The structural features of tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate, including its bulky tert-butyl group and the trans-2-(aminomethyl)cyclobutyl moiety, contribute to its unique chemical properties and potential biological activities.
The tert-butyl group is a common substituent in organic chemistry, known for its steric hindrance and stability, which can influence the reactivity and selectivity of a molecule. In contrast, the trans-2-(aminomethyl)cyclobutyl part introduces a cyclic structure with an amine functionality, making it a valuable building block for constructing more complex scaffolds. The combination of these structural elements suggests that tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate may exhibit properties that are beneficial for drug design, such as enhanced solubility, improved metabolic stability, or targeted binding interactions with biological targets.
Recent advancements in pharmaceutical research have highlighted the importance of carbamate derivatives in the development of novel therapeutic agents. Carbamates are known to exhibit a wide range of biological activities, including anticonvulsant, anti-inflammatory, and analgesic effects. The presence of both an amine and a carbamate group in tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate positions it as a promising candidate for further investigation in drug discovery programs. Specifically, the amine functionality can serve as a hydrogen bond acceptor or participate in coordination interactions with metal ions, while the carbamate group can act as a leaving group in nucleophilic substitution reactions or contribute to hydrophilic interactions.
One of the most compelling aspects of tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate is its potential role as a key intermediate in the synthesis of more complex molecules. For instance, its structural framework can be modified through various chemical transformations to introduce additional functional groups or to explore different pharmacophoric elements. This flexibility makes it an attractive candidate for medicinal chemists who are seeking to develop novel compounds with tailored biological activities. Additionally, the compound's stability under various reaction conditions enhances its utility as a synthetic intermediate, allowing for efficient multi-step syntheses without significant degradation.
In the context of modern drug development, computational methods and high-throughput screening have become indispensable tools for identifying promising candidates. The unique structural features of tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate make it an ideal candidate for virtual screening campaigns aimed at identifying new therapeutic agents. By leveraging advanced computational techniques, researchers can predict potential binding interactions between this compound and target proteins or enzymes, thereby accelerating the drug discovery process. Furthermore, experimental validation through techniques such as X-ray crystallography or nuclear magnetic resonance (NMR) spectroscopy can provide detailed insights into its molecular structure and dynamics.
The synthesis of tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate involves several key steps that highlight its complexity and synthetic challenge. The introduction of the trans-2-(aminomethyl)cyclobutyl moiety requires careful control over reaction conditions to ensure high yield and purity. Additionally, the protection and deprotection of functional groups must be carefully managed to prevent unwanted side reactions. Recent studies have demonstrated innovative synthetic strategies that enhance the efficiency and scalability of carbamate derivative synthesis, paving the way for industrial applications.
The biological evaluation of tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate has revealed several intriguing properties that warrant further investigation. Preliminary studies suggest that this compound may exhibit inhibitory activity against specific enzymes or receptors involved in disease pathways. For example, its ability to modulate neurotransmitter systems could make it relevant for treating neurological disorders such as epilepsy or Parkinson's disease. Moreover, its interaction with inflammatory pathways may open up possibilities for developing novel anti-inflammatory agents.
The future prospects for tert-butyl N-[trans-2-(aminomethyl)cyclobutyle-carbamate are promising, with ongoing research aimed at expanding its applications in pharmaceutical chemistry and drug development. Collaborative efforts between academic institutions and pharmaceutical companies are essential to translate laboratory findings into clinical applications. By integrating cutting-edge synthetic methodologies with advanced biological assays, researchers can uncover new therapeutic possibilities and optimize existing treatments.
In conclusion,tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate (CAS No. 1903834-40-1) is a structurally unique and biologically relevant compound with significant potential in pharmaceutical research. Its combination of steric hindrance from the tert-butyl group and functional diversity from the trans-2-(aminomethyl)cyclobutyl moiety makes it a valuable tool for drug discovery and synthetic chemistry. As our understanding of molecular interactions continues to evolve,tert-butyl N-[trans-2-(aminomethyl)cyclobutyle-carbamate is poised to play a crucial role in shaping the future of medicinal chemistry.
1903834-40-1 (tert-butyl N-[trans-2-(aminomethyl)cyclobutyl]carbamate) Related Products
- 889945-00-0(tert-butyl 3-amino-1-cyclohexylpropylcarbamate)
- 1594952-43-8(tert-butyl N-(3-amino-2,2-dimethylcyclobutyl)carbamate)
- 130369-10-7(tert-butyl N-[3-(aminomethyl)cyclobutyl]carbamate)
- 1030390-99-8(2-Methyl-2-propanyl [(1S,2S)-2-(aminomethyl)cyclohexyl]carbamate)
- 871014-28-7(tert-butyl N-[cis-3-(aminomethyl)cyclobutyl]carbamate)
- 852661-35-9((2-(Aminomethyl)cyclohexyl)carbamate)
- 1392803-57-4(cis-3-(Boc-amino)-2,2-dimethylcyclobutylamine)
- 1259277-49-0(tert-butyl N-[trans-2-(aminomethyl)cyclohexyl]carbamate)
- 1392803-55-2(trans-3-(Boc-amino)-2,2-dimethylcyclobutylamine)
- 1214727-57-7(tert-butyl N-(1r,3r)-3-(aminomethyl)cyclobutylcarbamate, trans)