Cas no 1805034-85-8 (3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride)
3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride Chemical and Physical Properties
Names and Identifiers
-
- 3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride
-
- Inchi: 1S/C6H3ClF2INO2S/c7-14(12,13)4-2-1-3(5(8)9)6(10)11-4/h1-2,5H
- InChI Key: NNRUBSOYQDEZIY-UHFFFAOYSA-N
- SMILES: IC1=C(C(F)F)C=CC(=N1)S(=O)(=O)Cl
Computed Properties
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 5
- Heavy Atom Count: 14
- Rotatable Bond Count: 2
- Complexity: 295
- XLogP3: 2.5
- Topological Polar Surface Area: 55.4
3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Alichem | A029077110-250mg |
3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride |
1805034-85-8 | 97% | 250mg |
$504.00 | 2022-04-01 | |
| Alichem | A029077110-500mg |
3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride |
1805034-85-8 | 97% | 500mg |
$847.60 | 2022-04-01 | |
| Alichem | A029077110-1g |
3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride |
1805034-85-8 | 97% | 1g |
$1,519.80 | 2022-04-01 |
3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride Related Literature
-
Jingquan Liu,Huiyun Liu,Zhongfan Jia,Volga Bulmus,Thomas P. Davis Chem. Commun., 2008, 6582-6584
-
2. An all-solid-state imprinted polymer-based potentiometric sensor for determination of bisphenol S?Rongning Liang,Tanji Yin,Ruiqing Yao,Wei Qin RSC Adv., 2016,6, 73308-73312
-
Hyejin Moon,Aaron R. Wheeler,Robin L. Garrell,Chang-Jin “CJ” Kim Lab Chip, 2006,6, 1213-1219
-
Huabin Zhang,Shaowu Du CrystEngComm, 2014,16, 4059-4068
-
Inês S. Albuquerque,Hélia F. Jeremias,Miguel Chaves-Ferreira,Dijana Matak-Vinkovic,Omar Boutureira,Carlos C. Rom?o Chem. Commun., 2015,51, 3993-3996
Additional information on 3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride
Introduction to 3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride (CAS No. 1805034-85-8)
3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride (CAS No. 1805034-85-8) is a versatile and highly reactive compound that has garnered significant attention in the fields of medicinal chemistry and pharmaceutical research. This compound is characterized by its unique structural features, including a difluoromethyl group, an iodine substituent, and a sulfonyl chloride functional group, which collectively contribute to its diverse reactivity and potential applications.
The difluoromethyl group is known for its ability to modulate the electronic and steric properties of molecules, making it a valuable moiety in the design of bioactive compounds. The presence of this group can enhance the metabolic stability and bioavailability of drug candidates, which are crucial factors in drug development. Additionally, the iodine substituent provides a handle for further functionalization through various chemical transformations, such as cross-coupling reactions, which are essential in the synthesis of complex organic molecules.
The sulfonyl chloride functional group is highly reactive and can participate in a wide range of chemical reactions, including nucleophilic substitution and coupling reactions. This reactivity makes 3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride an excellent building block for the synthesis of sulfonamides, sulfonate esters, and other sulfur-containing derivatives. These derivatives have found applications in various areas, including agrochemicals, materials science, and pharmaceuticals.
In recent years, there has been a growing interest in the use of 3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride in the development of novel therapeutic agents. One notable application is in the field of oncology, where this compound has been used as a starting material for the synthesis of targeted cancer therapies. For example, researchers have utilized this compound to develop inhibitors of specific kinases involved in cancer cell proliferation and survival. The ability to fine-tune the properties of these inhibitors through strategic modifications has led to the discovery of more potent and selective drug candidates.
Beyond oncology, 3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride has also shown promise in other therapeutic areas. In neurodegenerative diseases such as Alzheimer's and Parkinson's disease, this compound has been used to synthesize small molecules that target key enzymes involved in disease progression. These molecules have demonstrated promising results in preclinical studies, highlighting their potential as lead compounds for further development.
The versatility of 3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride extends beyond its use as a synthetic intermediate. It has also been explored as a probe molecule in chemical biology studies. By incorporating this compound into bioconjugates or imaging agents, researchers can gain insights into cellular processes and protein interactions that are relevant to various diseases. This approach has led to the identification of novel targets and pathways that could be exploited for therapeutic intervention.
In conclusion, 3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride (CAS No. 1805034-85-8) is a multifaceted compound with significant potential in medicinal chemistry and pharmaceutical research. Its unique structural features and reactivity make it an invaluable tool for the synthesis of bioactive molecules with diverse applications. As research continues to advance, it is likely that new uses for this compound will be discovered, further expanding its impact on human health and well-being.
1805034-85-8 (3-(Difluoromethyl)-2-iodopyridine-6-sulfonyl chloride) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)