Cas no 174913-38-3 (Benzene, 1,5-dibromo-2-chloro-4-methoxy-)
Benzene, 1,5-dibromo-2-chloro-4-methoxy- Chemical and Physical Properties
Names and Identifiers
-
- Benzene, 1,5-dibromo-2-chloro-4-methoxy-
- 1,5-Dibromo-2-chloro-4-methoxybenzene
- MFCD32707011
- CS-0191948
- E95771
- 174913-38-3
-
- MDL: MFCD32707011
- Inchi: 1S/C7H5Br2ClO/c1-11-7-3-6(10)4(8)2-5(7)9/h2-3H,1H3
- InChI Key: OTZRCEAVEJYZQS-UHFFFAOYSA-N
- SMILES: C1(Br)=CC(Br)=C(OC)C=C1Cl
Computed Properties
- Exact Mass: 299.83752Da
- Monoisotopic Mass: 297.83957Da
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 1
- Heavy Atom Count: 11
- Rotatable Bond Count: 1
- Complexity: 134
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 3.9
- Topological Polar Surface Area: 9.2?2
Benzene, 1,5-dibromo-2-chloro-4-methoxy- Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Ambeed | A1524886-1g |
1,5-Dibromo-2-chloro-4-methoxybenzene |
174913-38-3 | 98% | 1g |
$503.0 | 2024-04-22 | |
| abcr | AB560090-250 mg |
1,5-Dibromo-2-chloro-4-methoxybenzene; . |
174913-38-3 | 250mg |
€255.10 | 2023-06-14 | ||
| abcr | AB560090-500 mg |
1,5-Dibromo-2-chloro-4-methoxybenzene; . |
174913-38-3 | 500mg |
€415.70 | 2023-06-14 | ||
| abcr | AB560090-1 g |
1,5-Dibromo-2-chloro-4-methoxybenzene; . |
174913-38-3 | 1g |
€562.00 | 2023-06-14 | ||
| A2B Chem LLC | BA21712-250mg |
Benzene, 1,5-dibromo-2-chloro-4-methoxy- |
174913-38-3 | 95% | 250mg |
$218.00 | 2024-04-20 | |
| A2B Chem LLC | BA21712-500mg |
Benzene, 1,5-dibromo-2-chloro-4-methoxy- |
174913-38-3 | 95% | 500mg |
$283.00 | 2024-04-20 | |
| A2B Chem LLC | BA21712-1g |
Benzene, 1,5-dibromo-2-chloro-4-methoxy- |
174913-38-3 | 95% | 1g |
$370.00 | 2024-04-20 | |
| A2B Chem LLC | BA21712-5g |
Benzene, 1,5-dibromo-2-chloro-4-methoxy- |
174913-38-3 | 95% | 5g |
$1154.00 | 2024-04-20 | |
| A2B Chem LLC | BA21712-10g |
Benzene, 1,5-dibromo-2-chloro-4-methoxy- |
174913-38-3 | 95% | 10g |
$1917.00 | 2024-04-20 | |
| A2B Chem LLC | BA21712-25g |
Benzene, 1,5-dibromo-2-chloro-4-methoxy- |
174913-38-3 | 95% | 25g |
$3702.00 | 2024-04-20 |
Benzene, 1,5-dibromo-2-chloro-4-methoxy- Related Literature
-
Marcin Czapla,Jack Simons Phys. Chem. Chem. Phys., 2018,20, 21739-21745
-
Shintaro Takata,Yoshihiro Miura Phys. Chem. Chem. Phys., 2014,16, 24784-24789
-
Ross Harder,David C. Dunand,Ian McNulty Nanoscale, 2017,9, 5686-5693
-
Shun-Ze Zhan,Mian Li,Xiao-Ping Zhou,Dan Li,Seik Weng Ng RSC Adv., 2011,1, 1457-1459
-
Alexandre Vimont,Arnaud Travert,Philippe Bazin,Jean-Claude Lavalley,Marco Daturi,Christian Serre,Gérard Férey,Sandrine Bourrelly,Philip L. Llewellyn Chem. Commun., 2007, 3291-3293
Additional information on Benzene, 1,5-dibromo-2-chloro-4-methoxy-
Benzene, 1,5-Dibromo-2-Chloro-4-Methoxy
Benzene, 1,5-dibromo-2-chloro-4-methoxy is a highly specialized aromatic compound with the CAS registry number 174913-38-3. This compound is characterized by its unique substitution pattern on the benzene ring, featuring bromine atoms at positions 1 and 5, a chlorine atom at position 2, and a methoxy group (-OCH?) at position 4. The combination of these substituents imparts distinctive chemical properties, making it a valuable molecule in various research and industrial applications.
The synthesis of benzene, 1,5-dibromo-2-chloro-4-methoxy typically involves multi-step organic reactions. One common approach is the directed electrophilic substitution on a pre-substituted benzene derivative. For instance, starting with chlorobenzene or bromobenzene derivatives, subsequent substitution reactions with bromine and methoxy groups can be performed under controlled conditions to achieve the desired substitution pattern. Recent advancements in catalytic methods have enabled more efficient and selective syntheses of such complex aromatic compounds.
The chemical structure of this compound is of particular interest due to its potential applications in materials science and pharmacology. The presence of electron-withdrawing groups like bromine and chlorine enhances the reactivity of the benzene ring toward electrophilic substitution reactions. Meanwhile, the methoxy group introduces electron-donating effects through resonance, creating a dynamic balance that can be exploited in various chemical transformations.
In terms of physical properties, benzene, 1,5-dibromo-2-chloro-4-methoxy is typically a crystalline solid at room temperature with a melting point around 80°C. Its solubility in organic solvents such as dichloromethane and diethyl ether is moderate due to the presence of both polar and non-polar substituents on the benzene ring.
Recent studies have explored the use of this compound as an intermediate in the synthesis of advanced materials. For example, researchers have utilized its reactivity to construct heterocyclic compounds with potential applications in optoelectronics and drug delivery systems. Additionally, its role as a precursor in polymer chemistry has been investigated, particularly in the development of high-performance polymers for aerospace applications.
The environmental impact of benzene derivatives, including this compound, has also been a topic of recent research. Studies have shown that while these compounds are generally stable under normal conditions, their degradation pathways under UV light or microbial action can lead to the formation of less harmful byproducts. This knowledge is crucial for ensuring safe handling and disposal practices in industrial settings.
In conclusion, benzene, 1,5-dibromo-2-chloro-4-methoxy (CAS No. 174913-38-3) stands out as a versatile compound with promising applications across multiple disciplines. Its unique substitution pattern offers opportunities for further exploration in both fundamental research and industrial innovation.
174913-38-3 (Benzene, 1,5-dibromo-2-chloro-4-methoxy-) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)