Cas no 1713163-23-5 (4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid)
4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid Chemical and Physical Properties
Names and Identifiers
-
- 4-Methyl-1,1-dioxo-1lambda(6)-thiane-4-carboxylic acid
- 4-methyl-1,1-dioxo-1lambda6-thiane-4-carboxylic acid
- 4-methyl-1,1-dioxothiane-4-carboxylic acid
- 4-Methyltetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide
- 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid
-
- Inchi: 1S/C7H12O4S/c1-7(6(8)9)2-4-12(10,11)5-3-7/h2-5H2,1H3,(H,8,9)
- InChI Key: ATQHGENFZNCQDE-UHFFFAOYSA-N
- SMILES: S1(CCC(C(=O)O)(C)CC1)(=O)=O
Computed Properties
- Hydrogen Bond Donor Count: 1
- Hydrogen Bond Acceptor Count: 4
- Heavy Atom Count: 12
- Rotatable Bond Count: 1
- Complexity: 271
- XLogP3: 0
- Topological Polar Surface Area: 79.8
4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-188585-0.05g |
4-methyl-1,1-dioxo-1lambda6-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 0.05g |
$229.0 | 2023-09-18 | |
| Enamine | EN300-188585-0.1g |
4-methyl-1,1-dioxo-1lambda6-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 0.1g |
$342.0 | 2023-09-18 | |
| Enamine | EN300-188585-0.25g |
4-methyl-1,1-dioxo-1lambda6-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 0.25g |
$487.0 | 2023-09-18 | |
| Enamine | EN300-188585-0.5g |
4-methyl-1,1-dioxo-1lambda6-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 0.5g |
$768.0 | 2023-09-18 | |
| Enamine | EN300-188585-1g |
4-methyl-1,1-dioxo-1lambda6-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 1g |
$986.0 | 2023-09-18 | |
| Enamine | EN300-188585-2.5g |
4-methyl-1,1-dioxo-1lambda6-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 2.5g |
$1931.0 | 2023-09-18 | |
| Enamine | EN300-188585-5g |
4-methyl-1,1-dioxo-1lambda6-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 5g |
$2858.0 | 2023-09-18 | |
| Enamine | EN300-188585-10g |
4-methyl-1,1-dioxo-1lambda6-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 10g |
$4236.0 | 2023-09-18 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBTQ8893-100MG |
4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 100MG |
¥ 1,075.00 | 2023-04-14 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBTQ8893-250MG |
4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid |
1713163-23-5 | 95% | 250MG |
¥ 1,716.00 | 2023-04-14 |
4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid Related Literature
-
Yi Cao,Yujiao Xiahou,Lixiang Xing,Xiang Zhang,Hong Li,ChenShou Wu,Haibing Xia Nanoscale, 2020,12, 20456-20466
-
Gloria Belén Ramírez-Rodríguez,José Manuel Delgado-López,Jaime Gómez-Morales CrystEngComm, 2013,15, 2206-2212
-
Gaurav J. Shah,Eric P.-Y. Chiou,Ming C. Wu,Chang-Jin “CJ” Kim Lab Chip, 2009,9, 1732-1739
-
Jason Wan Lab Chip, 2020,20, 4528-4538
-
Peiyuan Zeng,Xiaoxiao Wang,Ming Ye,Qiuyang Ma,Jianwen Li,Wanwan Wang,Baoyou Geng,Zhen Fang RSC Adv., 2016,6, 23074-23084
Additional information on 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid
Chemical Profile of 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid (CAS No. 1713163-23-5)
4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid, identified by the Chemical Abstracts Service Number (CAS No.) 1713163-23-5, is a structurally unique compound that has garnered attention in the field of pharmaceutical chemistry and organic synthesis. This heterocyclic compound features a thiane backbone modified with a methyl group and two carbonyl functionalities, making it a versatile scaffold for further chemical modifications and biological investigations.
The molecular structure of 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid consists of a sulfur-containing ring system with two oxygen atoms incorporated into the ring, creating a dioxo (or di-keto) moiety. The presence of these oxygen atoms introduces significant electrophilic centers, which can participate in various nucleophilic additions and condensation reactions. Additionally, the carboxylic acid group at the 4-position provides an acidic proton and serves as a potential site for further derivatization, such as esterification or amidation.
Recent advancements in medicinal chemistry have highlighted the potential of thiane derivatives as pharmacophores due to their ability to interact with biological targets in unique ways. The incorporation of oxygen atoms into the thiane ring enhances the compound's reactivity and functionality, making it an attractive candidate for drug discovery programs. Specifically, the dioxo-thiane core has been explored in the development of novel antimicrobial and anti-inflammatory agents, where its ability to disrupt bacterial cell wall synthesis or modulate inflammatory pathways has been demonstrated.
In synthetic chemistry, 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid serves as a valuable intermediate for constructing more complex molecules. The reactive sites on the compound—namely the carbonyl groups and the carboxylic acid—can be selectively functionalized to generate derivatives with tailored properties. For instance, researchers have utilized this compound to synthesize thiazole-based scaffolds, which are known for their broad spectrum of biological activity. The versatility of 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid lies in its ability to undergo multiple transformations while retaining its core structural integrity.
One particularly intriguing application of this compound is in the field of metal chelation. The combination of oxygen and sulfur donor atoms in the dioxo-thiane moiety allows it to coordinate with various transition metals, forming stable complexes. These metal complexes have shown promise in applications ranging from catalysis to bioimaging. For example, complexes derived from 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid have been investigated for their ability to act as contrast agents in magnetic resonance imaging (MRI), leveraging their paramagnetic properties to enhance image resolution.
The pharmacological potential of 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid has also been explored in preclinical studies. Initial screenings have revealed that derivatives of this compound exhibit inhibitory activity against certain enzymes implicated in metabolic disorders and cancer progression. The carboxylic acid group has been particularly useful in designing prodrugs that release active species under physiological conditions, enhancing bioavailability and therapeutic efficacy. Furthermore, the sulfur-containing ring system contributes to hydrophobic interactions with biological targets, potentially improving membrane permeability and drug delivery.
From an industrial perspective, the synthesis of 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid presents both challenges and opportunities. While classical methods involving thioether oxidation can be employed to introduce the dioxo functionality, alternative approaches such as transition-metal-catalyzed reactions offer more efficient pathways. Recent reports highlight the use of palladium-catalyzed cross-coupling reactions to construct complex thiane derivatives in high yields. These advances not only streamline the synthesis but also open doors for scalable production processes suitable for pharmaceutical applications.
The role of computational chemistry in optimizing derivatives of 4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid cannot be overstated. Molecular modeling techniques have enabled researchers to predict binding affinities and metabolic stability with remarkable accuracy. By integrating experimental data with computational insights, scientists can rationally design analogs that enhance potency while minimizing off-target effects. This synergy between experimental and computational methods has accelerated the discovery pipeline for novel therapeutics based on thiane scaffolds.
In conclusion,4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid (CAS No. 1713163-23-5) represents a fascinating compound with diverse applications across pharmaceutical chemistry and materials science. Its unique structural features—combining a sulfur-rich heterocycle with multiple reactive sites—make it an invaluable building block for drug discovery and synthetic chemistry endeavors. As research continues to uncover new functionalities and applications for this molecule, 4-methyl - 11 - dioxothi ene - 44 - carbox y lic aci d is poised to play an increasingly important role in addressing global health challenges through innovative chemical solutions.
1713163-23-5 (4-methyl-1,1-dioxo-1λ?-thiane-4-carboxylic acid) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)