Cas no 1697833-06-9 (tert-butyl N-2-(aminomethyl)cyclohexylcarbamate)
tert-butyl N-2-(aminomethyl)cyclohexylcarbamate Chemical and Physical Properties
Names and Identifiers
-
- Carbamic acid, N-[2-(aminomethyl)cyclohexyl]-, 1,1-dimethylethyl ester
- tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate
- tert-butyl N-2-(aminomethyl)cyclohexylcarbamate
-
- Inchi: 1S/C12H24N2O2/c1-12(2,3)16-11(15)14-10-7-5-4-6-9(10)8-13/h9-10H,4-8,13H2,1-3H3,(H,14,15)
- InChI Key: NYPPQRSVUJQKTO-UHFFFAOYSA-N
- SMILES: C(OC(C)(C)C)(=O)NC1CCCCC1CN
tert-butyl N-2-(aminomethyl)cyclohexylcarbamate Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-171979-1g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 1g |
$986.0 | 2023-09-20 | |
| Enamine | EN300-171979-5g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 5g |
$2858.0 | 2023-09-20 | |
| Enamine | EN300-171979-10g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 10g |
$4236.0 | 2023-09-20 | |
| Enamine | EN300-171979-0.05g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 0.05g |
$229.0 | 2023-09-20 | |
| Enamine | EN300-171979-0.1g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 0.1g |
$342.0 | 2023-09-20 | |
| Enamine | EN300-171979-0.25g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 0.25g |
$487.0 | 2023-09-20 | |
| Enamine | EN300-171979-0.5g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 0.5g |
$768.0 | 2023-09-20 | |
| Enamine | EN300-171979-1.0g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 1g |
$986.0 | 2023-06-04 | |
| Enamine | EN300-171979-2.5g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 2.5g |
$1931.0 | 2023-09-20 | |
| Enamine | EN300-171979-5.0g |
tert-butyl N-[2-(aminomethyl)cyclohexyl]carbamate |
1697833-06-9 | 95% | 5g |
$2858.0 | 2023-06-04 |
tert-butyl N-2-(aminomethyl)cyclohexylcarbamate Related Literature
-
Marcin Czapla,Jack Simons Phys. Chem. Chem. Phys., 2018,20, 21739-21745
-
Ziyang Deng,Changwei Chen,Sunliang Cui RSC Adv., 2016,6, 93753-93755
-
Gloria Belén Ramírez-Rodríguez,José Manuel Delgado-López,Jaime Gómez-Morales CrystEngComm, 2013,15, 2206-2212
-
Jason Y. C. Lim,Yong Yu,Guorui Jin,Kai Li,Yi Lu,Jianping Xie Nanoscale Adv., 2020,2, 3921-3932
Additional information on tert-butyl N-2-(aminomethyl)cyclohexylcarbamate
Introduction to Tert-butyl N-2-(aminomethyl)cyclohexylcarbamate (CAS No. 1697833-06-9)
Tert-butyl N-2-(aminomethyl)cyclohexylcarbamate, identified by its Chemical Abstracts Service (CAS) number 1697833-06-9, is a compound of significant interest in the field of pharmaceutical chemistry and medicinal biology. This carbamate derivative features a unique structural motif that has garnered attention for its potential applications in drug discovery and development. The presence of both a tert-butyl group and an N-2-(aminomethyl)cyclohexyl moiety contributes to its distinct chemical properties, making it a valuable candidate for further exploration in synthetic chemistry and biological assays.
The tert-butyl group, known for its steric hindrance and stability, plays a crucial role in modulating the reactivity and selectivity of the compound. This feature is particularly advantageous in designing molecules that require precise interactions with biological targets, such as enzymes or receptors. Meanwhile, the N-2-(aminomethyl)cyclohexyl part introduces a flexible, sterically bulky amine functionality, which can enhance binding affinity and pharmacokinetic profiles. Such structural elements are often employed in the development of novel therapeutic agents to improve solubility, metabolic stability, and overall efficacy.
In recent years, there has been growing interest in carbamate-based compounds due to their diverse biological activities. Carbamates are known to exhibit inhibitory effects on various enzymes and have been explored as intermediates in the synthesis of bioactive molecules. The specific combination of functional groups in Tert-butyl N-2-(aminomethyl)cyclohexylcarbamate positions it as a promising scaffold for further derivatization and optimization. Researchers have been investigating its potential as a lead compound in the development of treatments for neurological disorders, inflammation, and other diseases where enzyme inhibition is a key mechanism.
One of the most compelling aspects of this compound is its versatility in medicinal chemistry. The tert-butyl N-2-(aminomethyl)cyclohexylcarbamate structure provides multiple sites for chemical modification, allowing chemists to fine-tune its properties for specific applications. For instance, the amine group can be further functionalized to introduce additional pharmacophores or linkages, while the cyclohexyl ring offers conformational flexibility. These attributes make it an attractive building block for libraries of compounds designed for high-throughput screening (HTS) to identify novel drug candidates.
Recent advancements in computational chemistry and molecular modeling have enhanced our ability to predict the biological behavior of such compounds. By leveraging these tools, researchers can simulate interactions between Tert-butyl N-2-(aminomethyl)cyclohexylcarbamate and target proteins, gaining insights into its potential mechanisms of action. This approach has accelerated the discovery process by allowing virtual testing of various derivatives before experimental synthesis. Such innovations are critical in modern drug development pipelines, where efficiency and precision are paramount.
The synthesis of Tert-butyl N-2-(aminomethyl)cyclohexylcarbamate involves multi-step organic transformations that highlight the expertise required in pharmaceutical chemistry. Key steps typically include the formation of the carbamate bond through reaction with isocyanates or phosgene derivatives (though safer alternatives are often preferred), followed by functionalization at the cyclohexane ring. The introduction of the N-2-(aminomethyl) group requires careful control to avoid unwanted side reactions. Advances in synthetic methodologies have enabled more efficient and scalable production processes, making this compound more accessible for research purposes.
In terms of biological activity, preliminary studies suggest that Tert-butyl N-2-(aminomethyl)cyclohexylcarbamate may exhibit inhibitory effects on certain enzymes relevant to human health. For example, it has shown promise in assays targeting enzymes involved in pain signaling or inflammatory responses. These findings align with broader trends in drug discovery where modulating enzyme activity is a primary strategy for therapeutic intervention. Further research is needed to fully elucidate its mechanism of action and explore potential clinical applications.
The compound's physicochemical properties also make it an interesting subject for pharmacokinetic studies. Factors such as solubility, permeability, and metabolic stability are critical determinants of drug efficacy and safety. The presence of both hydrophobic (tert-butyl) and hydrophilic (amine) moieties suggests that Tert-butyl N-2-(aminomethyl)cyclohexylcarbamate may exhibit balanced solubility characteristics, which could be advantageous for formulation development. Understanding these properties early in the discovery process helps guide decisions on dosing regimens and delivery systems.
As research continues to evolve, so too do the tools available for studying compounds like Tert-butyl N-2-(aminomethyl)cyclohexylcarbamate. Techniques such as mass spectrometry (MS), nuclear magnetic resonance (NMR) spectroscopy, and X-ray crystallography provide detailed structural information essential for confirming molecular identity and purity. Additionally, biophysical methods like surface plasmon resonance (SPR) and fluorescence quenching assays allow researchers to quantify interactions between this compound and biological targets with high precision.
The integration of interdisciplinary approaches has further enhanced our understanding of carbamate derivatives. Collaboration between synthetic chemists, biochemists, pharmacologists, and computational scientists enables comprehensive investigation into the structure-activity relationships (SAR) of such compounds. This holistic perspective is crucial for optimizing lead compounds into viable drug candidates ready for clinical testing.
In conclusion,Tert-butyl N-2-(aminomethyl)cyclohexylcarbamate (CAS No. 1697833-06-9) represents a fascinating example of how structural complexity can yield biologically relevant molecules with therapeutic potential. Its unique combination of functional groups makes it a versatile scaffold for drug discovery efforts aimed at addressing various human diseases through enzyme modulation or other mechanisms yet to be fully explored. As research progresses using modern synthetic techniques combined with advanced analytical methods,this compound will undoubtedly continue to attract attention from both academic researchers
1697833-06-9 (tert-butyl N-2-(aminomethyl)cyclohexylcarbamate) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)