Cas no 161373-43-9 (4-Amino-6-fluorocinnoline-3-carboxylic acid)
4-Amino-6-fluorocinnoline-3-carboxylic acid Chemical and Physical Properties
Names and Identifiers
-
- 4-Amino-6-fluorocinnoline-3-carboxylic acid
- 3-Cinnolinecarboxylicacid, 4-amino-6-fluoro-
- 4-Amino-6-fluorobenzopyridazine-3-carboxylic acid
- 3-Cinnolinecarboxylicacid,4-amino-6-fluoro-(9CI)
- 3-Cinnolinecarboxylic acid, 4-amino-6-fluoro-, hydrate
- 4-Amino-6-fluoro-3-cinnolinecarboxylic acid hydrate
- AK136304
- AX8257872
- 6-Fluoro-4-aminocinnoline-3-carboxylic acid
- ST24043242
- 4-Amino-6-fluorobenzoxazine-3-carboxylic acid
- 3-Cinnolinecarboxylic acid, 4-ami
- MFCD24395657
- AKOS022171862
- 161373-43-9
- DTXSID20167129
- AS-66484
- SY254044
- 4-Amino-6-fluorocinnoline-3-carboxylicAcid
- 3-Cinnolinecarboxylic acid, 4-amino-6-fluoro-
- A883111
- CS-0060683
- DB-184749
-
- MDL: MFCD24395657
- Inchi: 1S/C9H6FN3O2/c10-4-1-2-6-5(3-4)7(11)8(9(14)15)13-12-6/h1-3H,(H2,11,12)(H,14,15)
- InChI Key: QBUGYSNCFMFXMD-UHFFFAOYSA-N
- SMILES: FC1C=CC2=C(C=1)C(=C(C(=O)O)N=N2)N
Computed Properties
- Exact Mass: 225.05504
- Monoisotopic Mass: 207.04440460g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 2
- Hydrogen Bond Acceptor Count: 6
- Heavy Atom Count: 15
- Rotatable Bond Count: 1
- Complexity: 264
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- Topological Polar Surface Area: 89.1
- XLogP3: 1
Experimental Properties
- PSA: 120.6
4-Amino-6-fluorocinnoline-3-carboxylic acid Security Information
- Storage Condition:Sealed in dry,2-8°C
4-Amino-6-fluorocinnoline-3-carboxylic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| SHANG HAI JI ZHI SHENG HUA Technology Co., Ltd. | Y19205-5g |
4-Amino-6-fluorocinnoline-3-carboxylic acid |
161373-43-9 | 97% | 5g |
¥28509.0 | 2024-07-18 | |
| SHANG HAI JI ZHI SHENG HUA Technology Co., Ltd. | Y19205-1g |
4-Amino-6-fluorocinnoline-3-carboxylic acid |
161373-43-9 | 97% | 1g |
¥10129.0 | 2024-07-18 | |
| SHANG HAI JI ZHI SHENG HUA Technology Co., Ltd. | Y19205-250mg |
4-Amino-6-fluorocinnoline-3-carboxylic acid |
161373-43-9 | 97% | 250mg |
¥4059.0 | 2024-07-18 | |
| Chemenu | CM183074-1g |
4-Amino-6-fluorocinnoline-3-carboxylic acid |
161373-43-9 | 97% | 1g |
$463 | 2021-06-17 | |
| Chemenu | CM183074-5g |
4-Amino-6-fluorocinnoline-3-carboxylic acid |
161373-43-9 | 97% | 5g |
$1619 | 2021-06-17 | |
| eNovation Chemicals LLC | D697106-0.25g |
4-Amino-6-fluorocinnoline-3-carboxylic Acid |
161373-43-9 | 97% | 0.25g |
$330 | 2024-07-20 | |
| eNovation Chemicals LLC | D697106-1g |
4-Amino-6-fluorocinnoline-3-carboxylic Acid |
161373-43-9 | 97% | 1g |
$825 | 2024-07-20 | |
| eNovation Chemicals LLC | D697106-5g |
4-Amino-6-fluorocinnoline-3-carboxylic Acid |
161373-43-9 | 97% | 5g |
$2475 | 2024-07-20 | |
| Chemenu | CM183074-250mg |
4-Amino-6-fluorocinnoline-3-carboxylic acid |
161373-43-9 | 97% | 250mg |
$*** | 2023-03-30 | |
| Chemenu | CM183074-1g |
4-Amino-6-fluorocinnoline-3-carboxylic acid |
161373-43-9 | 97% | 1g |
$*** | 2023-03-30 |
4-Amino-6-fluorocinnoline-3-carboxylic acid Suppliers
4-Amino-6-fluorocinnoline-3-carboxylic acid Related Literature
-
Gloria Belén Ramírez-Rodríguez,José Manuel Delgado-López,Jaime Gómez-Morales CrystEngComm, 2013,15, 2206-2212
-
Nan Fu,Naphaporn Chiewchan,Xiao Dong Chen Food Funct., 2020,11, 211-220
-
Joo Chuan Yeo,Kenry Lab Chip, 2016,16, 4082-4090
-
Gang Pan,Yi-jie Bao,Jie Xu,Tao Liu,Cheng Liu,Yan-yan Qiu,Xiao-jing Shi,Hui Yu,Ting-ting Jia,Xia Yuan,Ze-ting Yuan,Yi-jun Cao RSC Adv., 2016,6, 42109-42119
-
Domenico Lombardo,Gianmarco Munaò,Pietro Calandra,Luigi Pasqua,Maria Teresa Caccamo Phys. Chem. Chem. Phys., 2019,21, 11983-11991
Additional information on 4-Amino-6-fluorocinnoline-3-carboxylic acid
4-Amino-6-fluorocinnoline-3-carboxylic Acid: A Comprehensive Overview
The compound with CAS No. 161373-43-9, commonly referred to as 4-Amino-6-fluorocinnoline-3-carboxylic acid, is a highly specialized organic compound that has garnered significant attention in the fields of pharmaceutical research, material science, and analytical chemistry. This compound is characterized by its unique structure, which combines an amino group, a fluorine atom, and a carboxylic acid group attached to a cinnoline backbone. The cinnoline moiety itself is a bicyclic aromatic system composed of two fused rings: a pyridine ring and a pyrimidine ring. This structural arrangement imparts the compound with distinctive electronic and steric properties, making it a valuable building block in various chemical applications.
Recent advancements in synthetic chemistry have enabled the efficient synthesis of 4-Amino-6-fluorocinnoline-3-carboxylic acid through multi-step reactions involving strategic protection and deprotection strategies. Researchers have employed methodologies such as nucleophilic aromatic substitution, coupling reactions, and oxidation techniques to achieve high yields and purity levels. The incorporation of fluorine in the molecule has been particularly beneficial due to its ability to enhance the lipophilicity and bioavailability of the compound, which are critical factors in drug design.
In terms of applications, 4-Amino-6-fluorocinnoline-3-carboxylic acid has shown promise in the development of novel pharmaceutical agents. Its ability to act as a scaffold for bioactive molecules has been exploited in the creation of potential anti-cancer agents, where the compound's structure allows for selective targeting of cancer cells while minimizing toxicity to healthy tissues. Additionally, the compound's fluorescence properties have made it a candidate for use in biosensing applications, where it can serve as a probe for detecting specific analytes in complex biological systems.
Recent studies have also highlighted the potential of 4-Amino-6-fluorocinnoline-3-carboxylic acid in materials science. Its rigid aromatic structure and functional groups make it an ideal candidate for constructing advanced materials such as organic semiconductors and stimuli-responsive polymers. Researchers have demonstrated that incorporating this compound into polymer frameworks can significantly enhance their mechanical and electronic properties, paving the way for its use in next-generation electronic devices.
The synthesis of 4-Amino-6-fluorocinnoline-3-carboxylic acid involves a series of carefully optimized steps to ensure high purity and yield. One common approach begins with the preparation of cinnoline derivatives through cyclization reactions. The introduction of amino and fluorine groups is typically achieved through nucleophilic substitution or electrophilic substitution reactions, depending on the specific positions desired on the cinnoline ring. Finally, the carboxylic acid group is introduced via oxidation or direct coupling methods, completing the synthesis process.
From an analytical standpoint, 4-Amino-6-fluorocinnoline-3-carboxylic acid has been extensively characterized using modern spectroscopic techniques such as UV-vis spectroscopy, NMR spectroscopy, and mass spectrometry. These analyses have provided valuable insights into its electronic structure, conformational flexibility, and stability under various conditions. Such information is crucial for understanding its behavior in different chemical environments and for optimizing its use in practical applications.
In conclusion, 4-Amino-6-fluorocinnoline-3-carboxylic acid (CAS No. 161373-43-9) stands out as a versatile compound with significant potential across multiple disciplines. Its unique chemical structure, combined with recent advancements in synthetic methodologies and application development, positions it as a key player in future innovations within pharmaceuticals, materials science, and analytical chemistry.
161373-43-9 (4-Amino-6-fluorocinnoline-3-carboxylic acid) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)