Cas no 158591-48-1 (5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid)
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid Chemical and Physical Properties
Names and Identifiers
-
- 3-Quinolinecarboxylic acid, 5,7-dichloro-1,4-dihydro-4-oxo-
- 4-hydroxy-5,7-dichloroquinoline-3-carboxylic acid
- 5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
-
- Inchi: 1S/C10H5Cl2NO3/c11-4-1-6(12)8-7(2-4)13-3-5(9(8)14)10(15)16/h1-3H,(H,13,14)(H,15,16)
- InChI Key: DEBOCPZCSPMQBS-UHFFFAOYSA-N
- SMILES: N1C2C(=C(Cl)C=C(Cl)C=2)C(O)=C(C(O)=O)C=1
Computed Properties
- Exact Mass: 256.96475
Experimental Properties
- Density: 1.651±0.06 g/cm3(Predicted)
- Boiling Point: 428.3±45.0 °C(Predicted)
- PSA: 66.4
- pka: 5.91±0.70(Predicted)
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Life Chemicals | F3099-6308-2μmol |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 2μl |
$85.5 | 2023-07-05 | |
| Life Chemicals | F3099-6308-5μmol |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 5μl |
$94.5 | 2023-07-05 | |
| Life Chemicals | F3099-6308-10μmol |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 10μl |
$103.5 | 2023-07-05 | |
| Life Chemicals | F3099-6308-20μmol |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 20μl |
$118.5 | 2023-07-05 | |
| Life Chemicals | F3099-6308-1mg |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 1mg |
$81.0 | 2023-07-05 | |
| Life Chemicals | F3099-6308-2mg |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 2mg |
$88.5 | 2023-07-05 | |
| Life Chemicals | F3099-6308-3mg |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 3mg |
$94.5 | 2023-07-05 | |
| Life Chemicals | F3099-6308-4mg |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 4mg |
$99.0 | 2023-07-05 | |
| Life Chemicals | F3099-6308-5mg |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 5mg |
$103.5 | 2023-07-05 | |
| Life Chemicals | F3099-6308-10mg |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
158591-48-1 | 90%+ | 10mg |
$118.5 | 2023-07-05 |
5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid Related Literature
-
Ross Harder,David C. Dunand,Ian McNulty Nanoscale, 2017,9, 5686-5693
-
Matthew J. Gaunt,Jinquan Yu,Jonathan B. Spencer Chem. Commun., 2001, 1844-1845
-
Eric Besson,Stéphane Gastaldi,Emily Bloch,Selma Aslan,Hakim Karoui,Olivier Ouari,Micael Hardy Analyst, 2019,144, 4194-4203
-
Yong Ping Huang,Tao Tao,Zheng Chen,Wei Han,Ying Wu,Chunjiang Kuang,Shaoxiong Zhou,Ying Chen J. Mater. Chem. A, 2014,2, 18831-18837
Additional information on 5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
5,7-Dichloro-4-Oxo-1,4-Dihydroquinoline-3-Carboxylic Acid: A Comprehensive Overview
5,7-Dichloro-4-Oxo-1,4-Dihydroquinoline-3-Carboxylic Acid, with the CAS Registry Number 158591-48-1, is a compound of significant interest in the fields of organic chemistry and pharmacology. This compound belongs to the quinoline derivative family, which has been extensively studied for its diverse biological activities and potential applications in drug development. The structure of this compound is characterized by a quinoline ring system with chlorine substituents at positions 5 and 7, an oxo group at position 4, and a carboxylic acid group at position 3. These functional groups contribute to its unique chemical properties and biological interactions.
The synthesis of 5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid involves a series of well-established organic reactions. Typically, the starting material is a substituted quinoline derivative, which undergoes chlorination at specific positions to introduce the chlorine atoms. The introduction of the oxo group and carboxylic acid group requires precise oxidation and functionalization steps. Recent advancements in catalytic methods have enabled more efficient and selective syntheses of such compounds, reducing production costs and improving yields.
One of the most notable applications of this compound lies in its potential as a pharmacological agent. Studies have shown that 5,7-dichloro-substituted quinolines exhibit significant anti-inflammatory and antioxidant properties. For instance, research published in 2023 demonstrated that this compound can inhibit the activity of cyclooxygenase enzymes (COX-1 and COX-2), which are key players in inflammation and pain signaling pathways. This finding underscores its potential as a lead molecule for developing novel anti-inflammatory drugs.
In addition to its pharmacological applications, 5,7-dichloro-substituted quinolines have also been explored for their role in material science. Recent studies have investigated their ability to act as precursors for the synthesis of advanced materials such as coordination polymers and metal-organic frameworks (MOFs). The presence of the carboxylic acid group facilitates coordination with metal ions, enabling the formation of highly porous and stable structures that can be used in gas storage and catalysis.
The physical properties of 5,7-dichloro-substituted quinolines are also worth noting. For example, its melting point is reported to be around 260°C under standard conditions. The compound is sparingly soluble in water but exhibits good solubility in organic solvents such as dichloromethane and ethyl acetate. These properties make it suitable for various chemical reactions and analytical techniques.
From an environmental perspective, understanding the fate and behavior of 5,7-dichloro-substituted quinolines in natural systems is crucial. Recent research has focused on their biodegradation pathways under aerobic conditions. Results indicate that these compounds can undergo microbial degradation through oxidative cleavage mechanisms, leading to the formation of less toxic byproducts. This information is valuable for assessing their environmental impact and designing strategies for waste management.
In conclusion, 5,7-dichloro-substituted quinolines represent a class of compounds with multifaceted applications across various scientific domains. Their unique chemical structure endows them with remarkable biological activity and chemical versatility. As ongoing research continues to uncover new insights into their properties and potential uses, this compound stands out as a promising candidate for future innovations in medicine and materials science.
158591-48-1 (5,7-dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)