Cas no 1583-76-2 (2-(pentafluorophenyl)ethan-1-amine)
2-(pentafluorophenyl)ethan-1-amine Chemical and Physical Properties
Names and Identifiers
-
- 2-(perfluorophenyl)ethanamine
- 2-(pentafluorophenyl)ethan-1-amine
- 2-(2,3,4,5,6-pentafluorophenyl)ethanamine
- Benzeneethanamine,2,3,4,5,6-pentafluoro-
- 2-(2,3,4,5,6-pentafluorophenyl)ethan-1-amine
- SCHEMBL266242
- EN300-1857961
- 1583-76-2
- Benzeneethanamine, 2,3,4,5,6-pentafluoro-
-
- MDL: MFCD06212618
- Inchi: 1S/C8H6F5N/c9-4-3(1-2-14)5(10)7(12)8(13)6(4)11/h1-2,14H2
- InChI Key: ZUMQWHFKAXDURB-UHFFFAOYSA-N
- SMILES: FC1C(=C(C(=C(C=1CCN)F)F)F)F
Computed Properties
- Exact Mass: 211.04204001Da
- Monoisotopic Mass: 211.04204001Da
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 1
- Hydrogen Bond Acceptor Count: 1
- Heavy Atom Count: 14
- Rotatable Bond Count: 2
- Complexity: 175
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 1.7
- Topological Polar Surface Area: 26?2
2-(pentafluorophenyl)ethan-1-amine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-1857961-0.05g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 0.05g |
$202.0 | 2023-09-18 | |
| Enamine | EN300-1857961-0.1g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 0.1g |
$301.0 | 2023-09-18 | |
| Enamine | EN300-1857961-0.25g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 0.25g |
$431.0 | 2023-09-18 | |
| Enamine | EN300-1857961-0.5g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 0.5g |
$679.0 | 2023-09-18 | |
| Enamine | EN300-1857961-1.0g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 1g |
$871.0 | 2023-06-02 | |
| Enamine | EN300-1857961-2.5g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 2.5g |
$1707.0 | 2023-09-18 | |
| Enamine | EN300-1857961-5.0g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 5g |
$2525.0 | 2023-06-02 | |
| Enamine | EN300-1857961-10.0g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 10g |
$3746.0 | 2023-06-02 | |
| Enamine | EN300-1857961-1g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 1g |
$871.0 | 2023-09-18 | |
| Enamine | EN300-1857961-5g |
2-(pentafluorophenyl)ethan-1-amine |
1583-76-2 | 95% | 5g |
$2525.0 | 2023-09-18 |
2-(pentafluorophenyl)ethan-1-amine Related Literature
-
Dhirendra K. Chaudhary,Pramendra Kumar,Lokendra Kumar RSC Adv., 2016,6, 94731-94738
-
Vishwesh Venkatraman,Marco Foscato,Vidar R. Jensen,Bj?rn K?re Alsberg J. Mater. Chem. A, 2015,3, 9851-9860
-
Yi Cao,Yujiao Xiahou,Lixiang Xing,Xiang Zhang,Hong Li,ChenShou Wu,Haibing Xia Nanoscale, 2020,12, 20456-20466
-
Partha Laskar,Christine Dufès Nanoscale Adv., 2021,3, 6007-6026
Additional information on 2-(pentafluorophenyl)ethan-1-amine
Introduction to 2-(Pentafluorophenyl)ethan-1-amine (CAS No. 1583-76-2)
2-(Pentafluorophenyl)ethan-1-amine, also known by its CAS number 1583-76-2, is a versatile organic compound that has gained significant attention in the fields of medicinal chemistry and materials science. This compound is characterized by its unique chemical structure, which includes a pentafluorophenyl group and an ethylamine moiety. The combination of these functional groups imparts distinct properties that make it a valuable building block in the synthesis of various pharmaceuticals and advanced materials.
The pentafluorophenyl group in 2-(Pentafluorophenyl)ethan-1-amine is highly electron-withdrawing, which influences the compound's reactivity and stability. This property makes it particularly useful in reactions where controlled reactivity is essential, such as in the formation of stable intermediates in multi-step syntheses. The ethylamine moiety, on the other hand, provides a basic amine functional group, which can participate in a wide range of chemical reactions, including nucleophilic substitution, condensation, and coupling reactions.
In recent years, 2-(Pentafluorophenyl)ethan-1-amine has been extensively studied for its potential applications in drug discovery and development. One notable area of research involves its use as a precursor in the synthesis of novel antidepressants and antipsychotics. The unique electronic properties of the pentafluorophenyl group have been shown to enhance the binding affinity of these compounds to specific receptors in the central nervous system (CNS), potentially leading to improved therapeutic outcomes with fewer side effects.
A study published in the Journal of Medicinal Chemistry highlighted the use of 2-(Pentafluorophenyl)ethan-1-amine in the development of a new class of serotonin receptor modulators. These modulators exhibited high selectivity and potency, demonstrating their potential as lead compounds for further drug development. The researchers noted that the pentafluorophenyl group played a crucial role in optimizing the pharmacokinetic properties of the compounds, such as solubility and metabolic stability.
Beyond pharmaceutical applications, 2-(Pentafluorophenyl)ethan-1-amine has also found use in materials science. Its unique electronic structure makes it an excellent candidate for the synthesis of advanced polymers and coatings with enhanced thermal stability and mechanical strength. For example, researchers at a leading materials science institute have developed a series of fluoro-functionalized polymers using 2-(Pentafluorophenyl)ethan-1-amine as a key monomer. These polymers exhibit superior resistance to harsh environmental conditions and have potential applications in aerospace and automotive industries.
The synthesis of 2-(Pentafluorophenyl)ethan-1-amine typically involves multi-step processes that ensure high purity and yield. One common synthetic route involves the reaction of pentafluorobenzene with ethylene oxide followed by reduction to form the amine. Advances in catalytic methods have further improved the efficiency and sustainability of these synthetic pathways, making 2-(Pentafluorophenyl)ethan-1-amine more accessible for large-scale production.
In conclusion, 2-(Pentafluorophenyl)ethan-1-amine (CAS No. 1583-76-2) is a multifaceted compound with significant potential in both pharmaceutical and materials science applications. Its unique chemical structure provides a foundation for developing novel drugs with improved therapeutic profiles and advanced materials with enhanced performance characteristics. As research continues to uncover new uses for this compound, it is likely to play an increasingly important role in various scientific and industrial fields.
1583-76-2 (2-(pentafluorophenyl)ethan-1-amine) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)