Cas no 1542274-12-3 (2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid)
2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid Chemical and Physical Properties
Names and Identifiers
-
- [1,?1':4',?1''-?Terphenyl]?-?2',?3,?3'',?5,?5',?5''-?hexacarboxylic acid
- [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid
- 1,1':4',1''-Terbenzene-2',3,3'',5,5',5''-hexacarboxylic acid
- 2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid
- Terphenyl]-2',3,3'',5,5',5''-hexacarboxylicacid1542274-12-3
- CS-0110229
- [1,1':4',1'-Terphenyl]-2',3,3',5,5',5'-hexacarboxylic acid
- E81320
- 4-(3,5-dicarboxyphenyl)-[1,1'-biphenyl]-2,3',5,5'-tetracarboxylic acid
- 1542274-12-3
- BS-52330
- YSWG372
-
- Inchi: 1S/C24H14O12/c25-19(26)11-1-9(2-12(5-11)20(27)28)15-7-18(24(35)36)16(8-17(15)23(33)34)10-3-13(21(29)30)6-14(4-10)22(31)32/h1-8H,(H,25,26)(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36)
- InChI Key: WCMYVQOLWBUDDQ-UHFFFAOYSA-N
- SMILES: O([H])C(C1C([H])=C(C2C([H])=C(C(=O)O[H])C([H])=C(C(=O)O[H])C=2[H])C(C(=O)O[H])=C([H])C=1C1C([H])=C(C(=O)O[H])C([H])=C(C(=O)O[H])C=1[H])=O
Computed Properties
- Exact Mass: 494.04852588g/mol
- Monoisotopic Mass: 494.04852588g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 6
- Hydrogen Bond Acceptor Count: 12
- Heavy Atom Count: 36
- Rotatable Bond Count: 8
- Complexity: 810
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- Topological Polar Surface Area: 224
- XLogP3: 2.3
2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| SHANG HAI MAI KE LIN SHENG HUA Technology Co., Ltd. | T887365-1g |
[1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid |
1542274-12-3 | 98% | 1g |
¥788.40 | 2022-09-28 | |
| SHANG HAI MAI KE LIN SHENG HUA Technology Co., Ltd. | T887365-250mg |
[1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid |
1542274-12-3 | 98% | 250mg |
¥291.60 | 2022-09-28 | |
| Ambeed | A662475-100mg |
[1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid |
1542274-12-3 | 98% | 100mg |
$24.0 | 2025-02-20 | |
| Ambeed | A662475-250mg |
[1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid |
1542274-12-3 | 98% | 250mg |
$45.0 | 2025-02-20 | |
| Ambeed | A662475-1g |
[1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid |
1542274-12-3 | 98% | 1g |
$128.0 | 2025-02-20 | |
| eNovation Chemicals LLC | Y3210795-100mg |
Terphenyl]-2',3,3'',5,5',5''-hexacarboxylicacid(1542274-12-3) |
1542274-12-3 | 98% | 100mg |
$60 | 2024-06-05 | |
| eNovation Chemicals LLC | Y3210795-250mg |
Terphenyl]-2',3,3'',5,5',5''-hexacarboxylicacid(1542274-12-3) |
1542274-12-3 | 98% | 250mg |
$75 | 2024-06-05 | |
| eNovation Chemicals LLC | Y3210795-1g |
Terphenyl]-2',3,3'',5,5',5''-hexacarboxylicacid(1542274-12-3) |
1542274-12-3 | 98% | 1g |
$130 | 2024-06-05 | |
| eNovation Chemicals LLC | Y3210795-100mg |
Terphenyl]-2',3,3'',5,5',5''-hexacarboxylicacid(1542274-12-3) |
1542274-12-3 | 98% | 100mg |
$60 | 2025-02-20 | |
| eNovation Chemicals LLC | Y3210795-1g |
Terphenyl]-2',3,3'',5,5',5''-hexacarboxylicacid(1542274-12-3) |
1542274-12-3 | 98% | 1g |
$130 | 2025-02-20 |
2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid Suppliers
2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid Related Literature
-
Xinhuan Wang,Shuangfei Cai,Cui Qi Analyst, 2017,142, 2500-2506
-
Yi Cao,Yujiao Xiahou,Lixiang Xing,Xiang Zhang,Hong Li,ChenShou Wu,Haibing Xia Nanoscale, 2020,12, 20456-20466
-
Huading Zhang,Lee R. Moore,Maciej Zborowski,P. Stephen Williams,Shlomo Margel,Jeffrey J. Chalmers Analyst, 2005,130, 514-527
-
Domenico Lombardo,Gianmarco Munaò,Pietro Calandra,Luigi Pasqua,Maria Teresa Caccamo Phys. Chem. Chem. Phys., 2019,21, 11983-11991
-
Xing Zhao,Lu Bai,Rui-Ying Bao,Zheng-Ying Liu,Ming-Bo Yang,Wei Yang RSC Adv., 2017,7, 46297-46305
Additional information on 2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid
2,5-Bis(3,5-dicarboxyphenyl)terephthalic Acid (CAS No. 1542274-12-3): A Comprehensive Overview
2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid (CAS No. 1542274-12-3) is a multifunctional organic compound that has garnered significant attention in recent years due to its unique structural properties and potential applications in various fields, including materials science, pharmaceuticals, and chemical synthesis. This compound is characterized by its complex molecular structure, which features two 3,5-dicarboxyphenyl groups attached to a central terephthalic acid core. The presence of multiple carboxylic acid functional groups endows this compound with high reactivity and versatility, making it a valuable building block for the synthesis of advanced materials and pharmaceutical intermediates.
The chemical structure of 2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid (C26H16O10) is particularly noteworthy for its ability to form stable and robust supramolecular assemblies through hydrogen bonding and π-π stacking interactions. These interactions are crucial for the development of self-assembling materials with tailored properties, such as high thermal stability, mechanical strength, and optical transparency. Recent studies have explored the use of this compound in the fabrication of functional polymers and nanomaterials, highlighting its potential in advanced technological applications.
In the realm of pharmaceutical research, 2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid has shown promise as a versatile scaffold for the design of novel drug candidates. The presence of multiple carboxylic acid groups allows for the introduction of various functional moieties through esterification or amide formation reactions. This flexibility is particularly advantageous in the development of prodrugs and targeted drug delivery systems. For instance, recent studies have demonstrated the use of this compound as a linker in the synthesis of conjugates that enhance the solubility and bioavailability of poorly soluble drugs.
The synthetic accessibility of 2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid has also been a subject of extensive research. Several efficient synthetic routes have been developed to produce this compound on a large scale. One notable approach involves the condensation reaction between terephthaloyl chloride and 3,5-dihydroxybenzoic acid followed by oxidative decarboxylation. This method offers high yields and excellent purity, making it suitable for industrial applications. Additionally, green chemistry principles have been applied to optimize these synthetic processes, reducing environmental impact and improving sustainability.
The physical and chemical properties of 2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid have been extensively characterized using various analytical techniques such as nuclear magnetic resonance (NMR), mass spectrometry (MS), and X-ray crystallography. These studies have provided detailed insights into the molecular structure and conformational behavior of the compound. For example, NMR spectroscopy has revealed the presence of intramolecular hydrogen bonding interactions that contribute to the overall stability and rigidity of the molecule.
In terms of safety and handling, 2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid is generally considered safe when appropriate precautions are taken. However, it is important to handle this compound in well-ventilated areas and use personal protective equipment (PPE) such as gloves and safety goggles to prevent skin contact and inhalation. Storage should be in tightly sealed containers away from heat sources and incompatible materials.
The future prospects for 2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid are promising across multiple industries. In materials science, ongoing research is focused on developing new supramolecular architectures that can be used in applications such as sensors, catalysts, and electronic devices. In pharmaceuticals, efforts are being directed towards optimizing the pharmacokinetic properties of drug candidates derived from this scaffold to improve therapeutic outcomes.
In conclusion, 2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid (CAS No. 1542274-12-3) is a highly versatile organic compound with a wide range of potential applications. Its unique structural features and reactivity make it an attractive candidate for further exploration in both academic research and industrial settings. As new synthetic methods and application areas continue to emerge, this compound is poised to play a significant role in advancing various fields of science and technology.
1542274-12-3 (2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid) Related Products
- 482-05-3(Diphenic acid)
- 158144-54-8(2-4-(Hydroxymethyl)phenylbenzoic Acid)
- 107412-71-5(3'-Methylbiphenyl-2-carboxylic Acid)
- 7148-03-0(4’-Methylbiphenyl-2-carboxylic Acid)
- 18773-63-2(2-(2-Hydroxymethylphenyl)benzoic Acid)
- 947-84-2(2-Phenylbenzoic acid)
- 21991-02-6([1,1':2',1''-Terphenyl]-3',5'-dicarboxylicacid)
- 100538-35-0(3'-formyl-[1,1'-biphenyl]-2-carboxylic acid)
- 112804-58-7(4'-Formyl-1,1'-biphenyl-2-carboxylic Acid)
- 27873-89-8([1,1':2',1''-Terphenyl]-3',4'-dicarboxylicacid, 5',6'-diphenyl- (9CI))