Cas no 1513873-32-9 (N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide)
N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide Chemical and Physical Properties
Names and Identifiers
-
- N-(Imino(piperidin-1-yl)methyl)piperidine-1-carboximidamide
- N'-(piperidine-1-carboximidoyl)piperidine-1-carboximidamide
- Di- pentamethylen-Diguanid
- A926384
- N-(piperidine-1-carboximidoyl)piperidine-1-carboximidamide
- N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide
-
- MDL: MFCD29917060
- Inchi: 1S/C12H23N5/c13-11(16-7-3-1-4-8-16)15-12(14)17-9-5-2-6-10-17/h1-10H2,(H3,13,14,15)
- InChI Key: IJFSIVBGFZHFTE-UHFFFAOYSA-N
- SMILES: N1(/C(/N)=N/C(=N)N2CCCCC2)CCCCC1
Computed Properties
- Hydrogen Bond Donor Count: 2
- Hydrogen Bond Acceptor Count: 1
- Heavy Atom Count: 17
- Rotatable Bond Count: 3
- Complexity: 287
- XLogP3: 1
- Topological Polar Surface Area: 68.7
N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| TRC | P482770-10mg |
N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide |
1513873-32-9 | 10mg |
$ 50.00 | 2022-06-03 | ||
| TRC | P482770-50mg |
N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide |
1513873-32-9 | 50mg |
$ 160.00 | 2022-06-03 | ||
| TRC | P482770-100mg |
N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide |
1513873-32-9 | 100mg |
$ 250.00 | 2022-06-03 | ||
| Chemenu | CM324007-1g |
N-(Imino(piperidin-1-yl)methyl)piperidine-1-carboximidamide |
1513873-32-9 | 95% | 1g |
$561 | 2021-08-18 | |
| eNovation Chemicals LLC | D772203-100mg |
N-(Imino(Piperidin-1-Yl)Methyl)Piperidine-1-Carboximidamide |
1513873-32-9 | 95% | 100mg |
$225 | 2024-06-06 | |
| eNovation Chemicals LLC | D772203-250mg |
N-(Imino(Piperidin-1-Yl)Methyl)Piperidine-1-Carboximidamide |
1513873-32-9 | 95% | 250mg |
$370 | 2024-06-06 | |
| eNovation Chemicals LLC | D772203-1g |
N-(Imino(Piperidin-1-Yl)Methyl)Piperidine-1-Carboximidamide |
1513873-32-9 | 95% | 1g |
$725 | 2024-06-06 | |
| Chemenu | CM324007-250mg |
N-(Imino(piperidin-1-yl)methyl)piperidine-1-carboximidamide |
1513873-32-9 | 95% | 250mg |
$314 | 2022-09-02 | |
| Chemenu | CM324007-1g |
N-(Imino(piperidin-1-yl)methyl)piperidine-1-carboximidamide |
1513873-32-9 | 95% | 1g |
$626 | 2022-09-02 | |
| Chemenu | CM324007-5g |
N-(Imino(piperidin-1-yl)methyl)piperidine-1-carboximidamide |
1513873-32-9 | 95% | 5g |
$1673 | 2022-09-02 |
N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide Suppliers
N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide Related Literature
-
Joo Chuan Yeo,Kenry Lab Chip, 2016,16, 4082-4090
-
Yi Cao,Yujiao Xiahou,Lixiang Xing,Xiang Zhang,Hong Li,ChenShou Wu,Haibing Xia Nanoscale, 2020,12, 20456-20466
-
Yong Ping Huang,Tao Tao,Zheng Chen,Wei Han,Ying Wu,Chunjiang Kuang,Shaoxiong Zhou,Ying Chen J. Mater. Chem. A, 2014,2, 18831-18837
-
Qiao Song,Angela Bamesberger,Lingyun Yang,Haley Houtwed,Haishi Cao Analyst, 2014,139, 3588-3592
-
Eléonore Resongles,Corinne Casiot,Fran?oise Elbaz-Poulichet,Rémi Freydier,Odile Bruneel,Christine Piot,Sophie Delpoux,Aurélie Volant,Angélique Desoeuvre Environ. Sci.: Processes Impacts, 2013,15, 1536-1544
Additional information on N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide
N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide: A Comprehensive Overview
The compound N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide (CAS No. 1513873-32-9) is a complex organic molecule with significant potential in various fields, including pharmaceuticals, agrochemicals, and materials science. This compound belongs to the class of amidines, which are known for their versatile reactivity and structural diversity. Recent studies have highlighted its unique properties, making it a subject of interest for researchers worldwide.
N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide is characterized by its symmetric structure, featuring two piperidine rings connected through a carboxamido group. The molecule's structure allows for multiple modes of interaction, including hydrogen bonding and π-interactions, which are crucial for its biological activity. Researchers have explored its potential as a building block for more complex molecules, leveraging its ability to undergo various chemical transformations.
One of the most promising applications of this compound lies in the field of drug discovery. Recent studies have demonstrated its ability to inhibit certain enzymes associated with neurodegenerative diseases, such as Alzheimer's and Parkinson's. The compound's unique pharmacokinetic profile, including its bioavailability and metabolic stability, has been extensively studied using advanced computational models and in vitro assays.
In addition to its pharmaceutical applications, N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide has shown potential in agrochemicals as a fungicide and insecticide. Its ability to disrupt key biochemical pathways in pathogens makes it a valuable candidate for developing eco-friendly pest control solutions. Field trials conducted in controlled environments have yielded encouraging results, with the compound demonstrating high efficacy against various crop pathogens.
The synthesis of N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide involves a multi-step process that combines traditional organic synthesis techniques with modern catalytic methods. Researchers have optimized the reaction conditions to improve yield and purity, making the compound more accessible for large-scale production. The use of green chemistry principles in its synthesis has also been explored, reducing the environmental impact of the manufacturing process.
Recent advancements in computational chemistry have enabled researchers to predict the compound's behavior under various conditions with unprecedented accuracy. Molecular dynamics simulations and quantum mechanical calculations have provided insights into its conformational flexibility and electronic properties, which are critical for understanding its interactions with biological systems.
In conclusion, N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide (CAS No. 1513873-32-9) is a versatile compound with wide-ranging applications across multiple disciplines. Its unique chemical properties and promising biological activity make it a valuable asset for researchers and industries alike. As ongoing studies continue to uncover new potentials for this compound, it is poised to play a significant role in advancing science and technology in the coming years.
1513873-32-9 (N'-(Piperidine-1-carboximidoyl)piperidine-1-carboximidamide) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)