Cas no 1503582-46-4 (2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid)
2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid Chemical and Physical Properties
Names and Identifiers
-
- 2-(1-methylcyclopropyl)-4-(propan-2-yl)pyrimidine-5-carboxylic acid
- 2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid
-
- Inchi: 1S/C12H16N2O2/c1-7(2)9-8(10(15)16)6-13-11(14-9)12(3)4-5-12/h6-7H,4-5H2,1-3H3,(H,15,16)
- InChI Key: KNSCJZDVHAOJPP-UHFFFAOYSA-N
- SMILES: OC(C1C=NC(C2(C)CC2)=NC=1C(C)C)=O
Computed Properties
- Hydrogen Bond Donor Count: 1
- Hydrogen Bond Acceptor Count: 4
- Heavy Atom Count: 16
- Rotatable Bond Count: 3
- Complexity: 287
- XLogP3: 2
- Topological Polar Surface Area: 63.1
2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-685552-0.05g |
2-(1-methylcyclopropyl)-4-(propan-2-yl)pyrimidine-5-carboxylic acid |
1503582-46-4 | 95.0% | 0.05g |
$1068.0 | 2025-03-12 | |
| Enamine | EN300-685552-0.1g |
2-(1-methylcyclopropyl)-4-(propan-2-yl)pyrimidine-5-carboxylic acid |
1503582-46-4 | 95.0% | 0.1g |
$1119.0 | 2025-03-12 | |
| Enamine | EN300-685552-0.25g |
2-(1-methylcyclopropyl)-4-(propan-2-yl)pyrimidine-5-carboxylic acid |
1503582-46-4 | 95.0% | 0.25g |
$1170.0 | 2025-03-12 | |
| Enamine | EN300-685552-0.5g |
2-(1-methylcyclopropyl)-4-(propan-2-yl)pyrimidine-5-carboxylic acid |
1503582-46-4 | 95.0% | 0.5g |
$1221.0 | 2025-03-12 | |
| Enamine | EN300-685552-1.0g |
2-(1-methylcyclopropyl)-4-(propan-2-yl)pyrimidine-5-carboxylic acid |
1503582-46-4 | 95.0% | 1.0g |
$1272.0 | 2025-03-12 | |
| Enamine | EN300-685552-2.5g |
2-(1-methylcyclopropyl)-4-(propan-2-yl)pyrimidine-5-carboxylic acid |
1503582-46-4 | 95.0% | 2.5g |
$2492.0 | 2025-03-12 | |
| Enamine | EN300-685552-5.0g |
2-(1-methylcyclopropyl)-4-(propan-2-yl)pyrimidine-5-carboxylic acid |
1503582-46-4 | 95.0% | 5.0g |
$3687.0 | 2025-03-12 | |
| Enamine | EN300-685552-10.0g |
2-(1-methylcyclopropyl)-4-(propan-2-yl)pyrimidine-5-carboxylic acid |
1503582-46-4 | 95.0% | 10.0g |
$5467.0 | 2025-03-12 |
2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid Related Literature
-
Lei Yang,Yuan Zeng,Haibo Wu,Chunwu Zhou,Lei Tao J. Mater. Chem. B, 2020,8, 1383-1388
-
Stephen P. Fletcher,Richard B. C. Jagt,Ben L. Feringa Chem. Commun., 2007, 2578-2580
-
3. An integrated chip for immunofluorescence and its application to analyze lysosomal storage disordersJie Shen,Ying Zhou,Tu Lu,Junya Peng,Zhixiang Lin,Yuhong Pang,Li Yu Lab Chip, 2012,12, 317-324
-
4. An all-solid-state imprinted polymer-based potentiometric sensor for determination of bisphenol S?Rongning Liang,Tanji Yin,Ruiqing Yao,Wei Qin RSC Adv., 2016,6, 73308-73312
-
Xin Fu,Qing-rong Liang,Rong-guang Luo,Yan-shu Li,Xiao-ping Xiao,Lu-lu Yu,Wen-zhe Shan,Guang-qin Fan J. Mater. Chem. B, 2019,7, 3088-3099
Additional information on 2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid
2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic Acid: A Comprehensive Overview
The compound with CAS No. 1503582-46-4, known as 2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid, is a fascinating molecule that has garnered significant attention in the fields of organic chemistry and pharmacology. This compound belongs to the class of pyrimidine derivatives, which are well-known for their diverse biological activities and applications in drug discovery. The pyrimidine ring serves as a central scaffold, with substituents at positions 2 and 4 that contribute to its unique chemical properties and potential therapeutic effects.
Recent studies have highlighted the importance of cyclopropane-containing compounds in medicinal chemistry. The 1-methylcyclopropyl group attached to the pyrimidine ring introduces strain and rigidity, which can enhance molecular interactions with target proteins. This structural feature is particularly advantageous in designing molecules with high selectivity and potency. Researchers have explored the use of such strained rings in inhibiting enzymes involved in cancer progression, inflammation, and neurodegenerative diseases.
The propan-2-yl group at position 4 of the pyrimidine ring adds bulkiness to the molecule, potentially influencing its pharmacokinetic properties such as absorption, distribution, metabolism, and excretion (ADME). This substituent also plays a role in modulating the hydrophobicity of the compound, which is crucial for its solubility and bioavailability. Recent advancements in computational chemistry have enabled scientists to predict these properties more accurately, facilitating the optimization of lead compounds like this one.
One of the most promising applications of 2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid lies in its potential as a lead compound for anti-cancer drug development. Preclinical studies have demonstrated that pyrimidine derivatives with similar structural motifs exhibit potent anti-proliferative activity against various cancer cell lines. The carboxylic acid group at position 5 can be further modified to enhance its bioactivity or to enable conjugation with other therapeutic agents, opening avenues for targeted drug delivery systems.
In addition to its therapeutic potential, this compound has also been studied for its role in agrochemicals. The ability of pyrimidine derivatives to inhibit key enzymes in plant pathogens has led to their exploration as potential fungicides or herbicides. Recent research has focused on improving the stability and environmental compatibility of such compounds, ensuring sustainable agricultural practices while maintaining efficacy.
The synthesis of 2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid involves a multi-step process that combines principles from organic synthesis and catalysis. Key steps include the formation of the pyrimidine ring through cyclization reactions, followed by selective substitution at positions 2 and 4. The use of transition metal catalysts has significantly streamlined these processes, making large-scale production more feasible while maintaining high purity standards.
From a structural standpoint, the compound's molecular geometry is influenced by both the cyclopropane ring and the bulky propan-2-yl group. These features create a three-dimensional arrangement that can be exploited for designing molecules with enhanced binding affinities to specific biological targets. Computational modeling tools have been instrumental in predicting these interactions, allowing researchers to fine-tune the molecule's properties before experimental validation.
Looking ahead, ongoing research aims to explore the bioavailability and toxicological profile of this compound further. Understanding how it interacts with biological systems at different levels will be crucial for determining its suitability as a therapeutic agent or agrochemical. Collaborative efforts between academia and industry are expected to accelerate this process, bringing innovative solutions closer to real-world applications.
In conclusion, 2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid represents a compelling example of how structural diversity can be harnessed to develop novel compounds with wide-ranging applications. Its unique combination of a strained cyclopropane ring and a bulky substituent positions it as a valuable lead compound in multiple areas of research. As scientific advancements continue to unfold, this molecule will undoubtedly play a pivotal role in shaping future innovations in chemistry and medicine.
1503582-46-4 (2-(1-Methylcyclopropyl)-4-propan-2-ylpyrimidine-5-carboxylic acid) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)