Cas no 14916-62-2 (2,6-Dinitropyridine)
2,6-Dinitropyridine Chemical and Physical Properties
Names and Identifiers
-
- MFCD04114201
- SCHEMBL3294386
- AB93195
- CS-0447033
- DTXSID40603054
- DTXCID70553811
- 14916-62-2
- Pyridine, 2,6-dinitro-
- 2,6-Dinitropyridine
-
- MDL: MFCD04114201
- Inchi: 1S/C5H3N3O4/c9-7(10)4-2-1-3-5(6-4)8(11)12/h1-3H
- InChI Key: YHIZCHYBKFHHTB-UHFFFAOYSA-N
- SMILES: [O-][N+](C1C=CC=C([N+](=O)[O-])N=1)=O
Computed Properties
- Exact Mass: 169.01235559Da
- Monoisotopic Mass: 169.01235559Da
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 1
- Heavy Atom Count: 12
- Rotatable Bond Count: 2
- Complexity: 176
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 1.2
- Topological Polar Surface Area: 105?2
2,6-Dinitropyridine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Matrix Scientific | 187970-500mg |
2,6-Dinitropyridine |
14916-62-2 | 500mg |
$1200.00 | 2023-09-07 | ||
| Matrix Scientific | 187970-1g |
2,6-Dinitropyridine |
14916-62-2 | 1g |
$1800.00 | 2023-09-07 | ||
| Alichem | A029198800-250mg |
2,6-Dinitropyridine |
14916-62-2 | 95% | 250mg |
631.12 USD | 2021-06-01 | |
| Alichem | A029198800-1g |
2,6-Dinitropyridine |
14916-62-2 | 95% | 1g |
1,577.80 USD | 2021-06-01 | |
| Advanced ChemBlocks | O32165-100MG |
2,6-dinitropyridine |
14916-62-2 | 95% | 100MG |
$405 | 2023-09-15 | |
| Advanced ChemBlocks | O32165-250MG |
2,6-dinitropyridine |
14916-62-2 | 95% | 250MG |
$650 | 2023-09-15 | |
| Advanced ChemBlocks | O32165-1G |
2,6-dinitropyridine |
14916-62-2 | 95% | 1G |
$1,620 | 2023-09-15 | |
| 1PlusChem | 1P001LW5-100mg |
Pyridine, 2,6-dinitro- |
14916-62-2 | 95% | 100mg |
$600.00 | 2024-06-20 | |
| 1PlusChem | 1P001LW5-250mg |
Pyridine, 2,6-dinitro- |
14916-62-2 | 95% | 250mg |
$935.00 | 2024-06-20 | |
| A2B Chem LLC | AA74229-100mg |
Pyridine, 2,6-dinitro- |
14916-62-2 | 95% | 100mg |
$473.00 | 2024-04-20 |
2,6-Dinitropyridine Related Literature
-
Dhamodaran Manikandan,S. Amirthapandian,I. S. Zhidkov,A. I. Kukharenko,S. O. Cholakh,Ramaswamy Murugan Phys. Chem. Chem. Phys., 2018,20, 6500-6514
-
Karl Crowley,Eimer O'Malley,Aoife Morrin,Malcolm R. Smyth,Anthony J. Killard Analyst, 2008,133, 391-399
-
3. An autonomous self-optimizing flow machine for the synthesis of pyridine–oxazoline (PyOX) ligands?Eric Wimmer,Daniel Cortés-Borda,Solène Brochard,Elvina Barré,Charlotte Truchet,Fran?ois-Xavier Felpin React. Chem. Eng., 2019,4, 1608-1615
-
Kanjun Sun,Fengting Hua,Shuzhen Cui,Yanrong Zhu,Hui Peng,Guofu Ma RSC Adv., 2021,11, 37631-37642
Additional information on 2,6-Dinitropyridine
2,6-Dinitropyridine (CAS No: 14916-62-2)
2,6-Dinitropyridine is a highly reactive and versatile compound with significant applications in various fields of chemistry and materials science. Its CAS number, 14916-62-2, uniquely identifies it in chemical databases and regulatory systems worldwide. This compound is a derivative of pyridine, a six-membered aromatic heterocycle with one nitrogen atom, which forms the backbone of numerous organic molecules with diverse functionalities.
The structure of 2,6-dinitropyridine consists of a pyridine ring substituted with two nitro groups at the 2 and 6 positions. The nitro groups (-NO?) are strong electron-withdrawing substituents, which significantly influence the electronic properties of the molecule. This substitution pattern imparts unique reactivity and stability to the compound, making it a valuable precursor in organic synthesis and a key intermediate in the production of advanced materials.
Recent studies have highlighted the importance of 2,6-dinitropyridine in the development of high-performance polymers and coatings. Researchers have demonstrated that its ability to undergo various nucleophilic aromatic substitutions makes it an ideal building block for constructing functional polymers with tailored properties such as high thermal stability, mechanical strength, and resistance to environmental degradation.
In addition to its role in polymer chemistry, 2,6-dinitropyridine has found applications in pharmaceutical research. The compound serves as a valuable intermediate in the synthesis of bioactive molecules, including antibiotics and anticancer agents. Its ability to act as an electrophilic acceptor in Diels-Alder reactions has been exploited to design complex molecular architectures with potential therapeutic applications.
The synthesis of 2,6-dinitropyridine typically involves nitration of pyridine derivatives under controlled conditions to achieve selective substitution at the desired positions. Recent advancements in catalytic methods have enabled more efficient and environmentally friendly routes to this compound, reducing production costs and minimizing waste generation.
From an environmental perspective, understanding the fate and behavior of 2,6-dinitropyridine in natural systems is crucial for assessing its potential impact on ecosystems. Studies have shown that under certain conditions, the compound can undergo biodegradation or photodegradation, leading to the formation of less toxic byproducts. These findings are essential for developing strategies to manage industrial waste streams containing this compound.
In conclusion, 2,6-dinitropyridine (CAS No: 14916-62-2) is a multifaceted compound with significant implications across various scientific disciplines. Its unique chemical properties and versatile reactivity make it an indispensable tool in modern organic synthesis and materials science.
14916-62-2 (2,6-Dinitropyridine) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)