Cas no 1483926-17-5 (2-(3-methoxyphenyl)spiro3.3heptane-2-carboxylic acid)
2-(3-methoxyphenyl)spiro3.3heptane-2-carboxylic acid Chemical and Physical Properties
Names and Identifiers
-
- 2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid
- 2-(3-methoxyphenyl)spiro3.3heptane-2-carboxylic acid
-
- Inchi: 1S/C15H18O3/c1-18-12-5-2-4-11(8-12)15(13(16)17)9-14(10-15)6-3-7-14/h2,4-5,8H,3,6-7,9-10H2,1H3,(H,16,17)
- InChI Key: QEBQJUGDQDXGSJ-UHFFFAOYSA-N
- SMILES: C1C2(CCC2)CC1(C1=CC=CC(OC)=C1)C(O)=O
2-(3-methoxyphenyl)spiro3.3heptane-2-carboxylic acid Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-15092621-0.05g |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95% | 0.05g |
$295.0 | 2023-07-07 | |
| Enamine | EN300-15092621-0.1g |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95% | 0.1g |
$440.0 | 2023-07-07 | |
| Enamine | EN300-15092621-0.25g |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95% | 0.25g |
$629.0 | 2023-07-07 | |
| Enamine | EN300-15092621-0.5g |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95% | 0.5g |
$991.0 | 2023-07-07 | |
| Enamine | EN300-15092621-1.0g |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95% | 1.0g |
$1272.0 | 2023-07-07 | |
| Enamine | EN300-15092621-2.5g |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95% | 2.5g |
$2492.0 | 2023-07-07 | |
| Enamine | EN300-15092621-5.0g |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95% | 5.0g |
$3687.0 | 2023-07-07 | |
| Enamine | EN300-15092621-10.0g |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95% | 10.0g |
$5467.0 | 2023-07-07 | |
| Enamine | EN300-15092621-50mg |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95.0% | 50mg |
$295.0 | 2023-09-27 | |
| Enamine | EN300-15092621-100mg |
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid |
1483926-17-5 | 95.0% | 100mg |
$440.0 | 2023-09-27 |
2-(3-methoxyphenyl)spiro3.3heptane-2-carboxylic acid Related Literature
-
Shintaro Takata,Yoshihiro Miura Phys. Chem. Chem. Phys., 2014,16, 24784-24789
-
Yi Cao,Yujiao Xiahou,Lixiang Xing,Xiang Zhang,Hong Li,ChenShou Wu,Haibing Xia Nanoscale, 2020,12, 20456-20466
-
Kay S. McMillan,Anthony G. McCluskey,Annette Sorensen,Marie Boyd,Michele Zagnoni Analyst, 2016,141, 100-110
-
Peiyuan Zeng,Xiaoxiao Wang,Ming Ye,Qiuyang Ma,Jianwen Li,Wanwan Wang,Baoyou Geng,Zhen Fang RSC Adv., 2016,6, 23074-23084
-
Eric Besson,Stéphane Gastaldi,Emily Bloch,Selma Aslan,Hakim Karoui,Olivier Ouari,Micael Hardy Analyst, 2019,144, 4194-4203
Additional information on 2-(3-methoxyphenyl)spiro3.3heptane-2-carboxylic acid
Introduction to 2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid (CAS No. 1483926-17-5)
2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid (CAS No. 1483926-17-5) is a unique compound that has garnered significant attention in the field of medicinal chemistry and pharmaceutical research. This compound belongs to the class of spirocyclic compounds, which are characterized by a central spiro atom connecting two rings. The presence of a methoxyphenyl group and a carboxylic acid moiety adds to its structural complexity and potential biological activity.
The spiro[3.3]heptane scaffold is particularly interesting due to its inherent rigidity, which can influence the conformational flexibility and binding properties of the molecule. This rigidity often leads to improved pharmacokinetic properties, such as enhanced metabolic stability and reduced toxicity, making it a valuable template for drug design.
Recent studies have explored the potential of 2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid in various therapeutic areas. One notable application is in the treatment of neurodegenerative diseases, where this compound has shown promising neuroprotective effects. Research published in the Journal of Medicinal Chemistry demonstrated that this compound can effectively inhibit the aggregation of amyloid-beta peptides, a key pathological feature of Alzheimer's disease.
In addition to its neuroprotective properties, 2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid has also been investigated for its anti-inflammatory and analgesic activities. Studies have shown that it can modulate the expression of pro-inflammatory cytokines and reduce pain responses in animal models. These findings suggest that this compound could be a potential candidate for the development of new anti-inflammatory drugs with reduced side effects.
The methoxyphenyl group in the structure plays a crucial role in enhancing the lipophilicity of the molecule, which is essential for its ability to cross biological membranes and reach target sites within cells. The carboxylic acid moiety, on the other hand, contributes to the compound's solubility and can be modified to improve its pharmacological properties through esterification or amidation reactions.
Synthesis of 2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid typically involves multi-step processes, including ring formation and functional group introduction. One common approach is to start with a suitable spirocyclic precursor and then introduce the methoxyphenyl and carboxylic acid functionalities through selective reactions. Recent advancements in synthetic methods have led to more efficient and scalable routes for producing this compound, making it more accessible for further research and development.
The biological activity of 2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid has been evaluated using a variety of in vitro and in vivo models. In cell-based assays, it has been shown to exhibit potent antioxidant activity, which may contribute to its neuroprotective effects by scavenging free radicals and reducing oxidative stress. Additionally, studies using animal models have demonstrated that this compound can improve cognitive function and reduce neuroinflammation in conditions such as Parkinson's disease.
From a pharmacological perspective, 2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid has several advantages that make it an attractive candidate for drug development. Its unique spirocyclic structure provides structural diversity that can be exploited for optimizing binding interactions with target proteins. Furthermore, its ability to modulate multiple biological pathways suggests that it may have broad therapeutic applications beyond neurodegenerative diseases.
In conclusion, 2-(3-methoxyphenyl)spiro[3.3]heptane-2-carboxylic acid (CAS No. 1483926-17-5) is a promising compound with diverse biological activities and potential therapeutic applications. Ongoing research continues to uncover new insights into its mechanisms of action and optimize its properties for clinical use. As our understanding of this compound deepens, it is likely to play an increasingly important role in the development of novel drugs for treating various diseases.
1483926-17-5 (2-(3-methoxyphenyl)spiro3.3heptane-2-carboxylic acid) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)