Cas no 1433222-91-3 (4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate)
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate Chemical and Physical Properties
Names and Identifiers
-
- 4-(tert-butyl)3-methyl(S)-3-methylmorpholine-3,4-dicarboxylate
- (S)-Methyl N-Boc-3-methylmorpholine-3-carboxylate
- (S)-4-TERT-BUTYL 3-METHYL 3-METHYLMORPHOLINE-3,4-DICARBOXYLATE
- 3,4-Morpholinedicarboxylic acid, 3-methyl-, 4-(1,1-dimethylethyl) 3-methyl ester, (3S)-
- 4-tert-Butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate
- 4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate
-
- MDL: MFCD26406808
- Inchi: 1S/C12H21NO5/c1-11(2,3)18-10(15)13-6-7-17-8-12(13,4)9(14)16-5/h6-8H2,1-5H3/t12-/m0/s1
- InChI Key: NAPZVCIFIQJJOJ-LBPRGKRZSA-N
- SMILES: N1(C(OC(C)(C)C)=O)CCOC[C@@]1(C)C(OC)=O
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Alichem | A449037185-1g |
(S)-4-Tert-butyl 3-methyl 3-methylmorpholine-3,4-dicarboxylate |
1433222-91-3 | 95% | 1g |
649.35 USD | 2021-06-15 | |
| Chemenu | CM504429-1g |
(S)-4-tert-Butyl3-methyl3-methylmorpholine-3,4-dicarboxylate |
1433222-91-3 | 98% | 1g |
$683 | 2022-09-29 | |
| abcr | AB542442-250 mg |
(S)-4-t-Butyl 3-methyl 3-methylmorpholine-3,4-dicarboxylate; . |
1433222-91-3 | 250mg |
€532.40 | 2023-06-14 | ||
| abcr | AB542442-1 g |
(S)-4-t-Butyl 3-methyl 3-methylmorpholine-3,4-dicarboxylate; . |
1433222-91-3 | 1g |
€1245.30 | 2023-06-14 | ||
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PB08269-100MG |
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate |
1433222-91-3 | 95% | 100MG |
¥ 937.00 | 2023-04-04 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PB08269-250MG |
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate |
1433222-91-3 | 95% | 250MG |
¥ 1,498.00 | 2023-04-04 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PB08269-500MG |
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate |
1433222-91-3 | 95% | 500MG |
¥ 2,494.00 | 2023-04-04 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PB08269-1G |
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate |
1433222-91-3 | 95% | 1g |
¥ 3,742.00 | 2023-04-04 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PB08269-5G |
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate |
1433222-91-3 | 95% | 5g |
¥ 11,226.00 | 2023-04-04 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PB08269-10G |
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate |
1433222-91-3 | 95% | 10g |
¥ 18,711.00 | 2023-04-04 |
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate Related Literature
-
Partha Laskar,Christine Dufès Nanoscale Adv., 2021,3, 6007-6026
-
Yong Ping Huang,Tao Tao,Zheng Chen,Wei Han,Ying Wu,Chunjiang Kuang,Shaoxiong Zhou,Ying Chen J. Mater. Chem. A, 2014,2, 18831-18837
-
J. Zagora,M. Vosla?,L. Schreiberová,I. Schreiber Phys. Chem. Chem. Phys., 2002,4, 1284-1291
-
Dhirendra K. Chaudhary,Pramendra Kumar,Lokendra Kumar RSC Adv., 2016,6, 94731-94738
-
Tengfei Yu,Yuehan Wu,Wei Li,Bin Li RSC Adv., 2014,4, 34134-34143
Additional information on 4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate
Introduction to 4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate (CAS No. 1433222-91-3)
4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate, identified by its Chemical Abstracts Service (CAS) number 1433222-91-3, is a specialized organic compound that has garnered significant attention in the field of pharmaceutical chemistry and biomedicine. This compound belongs to a class of molecules characterized by its complex stereochemistry and functional groups, which make it a promising candidate for various therapeutic applications. The presence of a tert-butyl group, a methyl group, and a (3S)-methylmorpholine moiety contributes to its unique chemical properties, making it an intriguing subject for further research and development.
The (3S)-configuration of the morpholine ring is particularly noteworthy, as stereochemistry plays a crucial role in the biological activity of many pharmaceutical agents. This specific arrangement can influence the compound's interactions with biological targets, potentially leading to enhanced efficacy or selectivity in drug design. The 3,4-dicarboxylate functional groups further enhance the compound's reactivity, making it a versatile intermediate in synthetic chemistry and a potential building block for more complex molecules.
In recent years, there has been growing interest in the development of chiral auxiliaries and ligands for asymmetric synthesis, where compounds like 4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate play a pivotal role. The morpholine scaffold, with its rigid stereocenter, is often employed in catalytic systems to achieve high enantioselectivity in reactions such as hydrogenation and oxidation. The tert-butyl group provides steric hindrance, which can be exploited to control reaction pathways and improve yields.
One of the most exciting applications of this compound is in the field of drug discovery. Researchers are exploring its potential as a precursor for novel therapeutic agents targeting various diseases. For instance, studies have shown that derivatives of morpholine have shown promise in inhibiting enzymes involved in inflammatory pathways. The (3S)-configuration may enhance binding affinity to these targets, leading to more effective treatments with fewer side effects.
The dicarboxylate groups present in this molecule also make it an attractive candidate for polymer chemistry and material science. These functional groups can undergo various reactions such as esterification or amidation, allowing for the synthesis of polymers with tailored properties. Such materials could find applications in drug delivery systems, where controlled release profiles are essential for optimal therapeutic outcomes.
Recent advancements in computational chemistry have enabled researchers to predict the behavior of complex molecules like 4-tert-butyl 3-methyl (3S)-methylmorpholine-3,4-dicarboxylate with unprecedented accuracy. Molecular dynamics simulations and quantum mechanical calculations are being used to understand how this compound interacts with biological targets at the atomic level. This computational approach has accelerated the drug discovery process by allowing researchers to screen large libraries of compounds virtualy before conducting costly wet-lab experiments.
The synthesis of this compound presents several challenges due to its complex stereochemistry. Traditional synthetic routes often require multiple steps and careful control of reaction conditions to achieve high enantiomeric purity. However, recent innovations in asymmetric catalysis have made it possible to streamline these processes, reducing both cost and environmental impact. For example, transition metal-catalyzed reactions have been employed to construct the morpholine ring with high selectivity.
In conclusion,4-tert-butyl 3-methyl (3S)-methylmorpholine-3,4-dicarboxylate (CAS No. 1433222-91-3) is a multifaceted compound with significant potential in pharmaceuticals and materials science. Its unique structural features make it an excellent candidate for further research into drug development and advanced materials. As our understanding of molecular interactions continues to grow,this compound will likely play an increasingly important role in addressing some of the most pressing challenges in modern medicine.
1433222-91-3 (4-tert-butyl 3-methyl (3S)-3-methylmorpholine-3,4-dicarboxylate) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)