Cas no 1378260-25-3 (methyl 8-bromoquinoxaline-6-carboxylate)
methyl 8-bromoquinoxaline-6-carboxylate Chemical and Physical Properties
Names and Identifiers
-
- methyl 8-bromoquinoxaline-6-carboxylate
- 8-Bromo-quinoxaline-6-carboxylic acid methyl ester
-
- Inchi: 1S/C10H7BrN2O2/c1-15-10(14)6-4-7(11)9-8(5-6)12-2-3-13-9/h2-5H,1H3
- InChI Key: FPHVJQGDEZIMJR-UHFFFAOYSA-N
- SMILES: N1C2C(=CC(C(OC)=O)=CC=2Br)N=CC=1
methyl 8-bromoquinoxaline-6-carboxylate Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Chemenu | CM221985-1g |
Methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 97% | 1g |
$954 | 2021-08-04 | |
| Chemenu | CM221985-1g |
Methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 97% | 1g |
$*** | 2023-03-30 | |
| Enamine | EN300-716244-0.05g |
methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 95.0% | 0.05g |
$67.0 | 2025-03-12 | |
| Enamine | EN300-716244-0.1g |
methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 95.0% | 0.1g |
$101.0 | 2025-03-12 | |
| Enamine | EN300-716244-0.25g |
methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 95.0% | 0.25g |
$144.0 | 2025-03-12 | |
| Enamine | EN300-716244-0.5g |
methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 95.0% | 0.5g |
$226.0 | 2025-03-12 | |
| Enamine | EN300-716244-1.0g |
methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 95.0% | 1.0g |
$290.0 | 2025-03-12 | |
| Enamine | EN300-716244-2.5g |
methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 95.0% | 2.5g |
$453.0 | 2025-03-12 | |
| Enamine | EN300-716244-5.0g |
methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 95.0% | 5.0g |
$724.0 | 2025-03-12 | |
| Enamine | EN300-716244-10.0g |
methyl 8-bromoquinoxaline-6-carboxylate |
1378260-25-3 | 95.0% | 10.0g |
$1268.0 | 2025-03-12 |
methyl 8-bromoquinoxaline-6-carboxylate Related Literature
-
Gloria Belén Ramírez-Rodríguez,José Manuel Delgado-López,Jaime Gómez-Morales CrystEngComm, 2013,15, 2206-2212
-
Fereshteh Bayat Environ. Sci.: Nano, 2021,8, 367-389
-
Long Deng,Qian Zou,Biao Liu,Wenhui Ye,Chengfei Zhuo,Li Chen,Ze-Yuan Deng,Ya-Wei Fan,Jing Li Food Funct., 2018,9, 4234-4245
-
Marcin Czapla,Jack Simons Phys. Chem. Chem. Phys., 2018,20, 21739-21745
-
Shun-Ze Zhan,Mian Li,Xiao-Ping Zhou,Dan Li,Seik Weng Ng RSC Adv., 2011,1, 1457-1459
Additional information on methyl 8-bromoquinoxaline-6-carboxylate
Methyl 8-Bromoquinoxaline-6-Carboxylate: A Comprehensive Overview
Methyl 8-bromoquinoxaline-6-carboxylate, with the CAS number 1378260-25-3, is a highly specialized organic compound that has garnered significant attention in the fields of organic chemistry, materials science, and drug discovery. This compound belongs to the quinoxaline family, which is known for its unique aromatic properties and versatile applications. The structure of methyl 8-bromoquinoxaline-6-carboxylate features a quinoxaline ring system with a bromine substituent at position 8 and a methyl ester group at position 6, making it a valuable precursor for various functional materials and bioactive molecules.
The synthesis of methyl 8-bromoquinoxaline-6-carboxylate typically involves multi-step organic reactions, including nucleophilic aromatic substitution and esterification processes. Recent advancements in catalytic methodologies have enabled more efficient and selective syntheses of this compound, reducing production costs and improving yields. Researchers have also explored green chemistry approaches to minimize environmental impact during its preparation.
One of the most promising applications of methyl 8-bromoquinoxaline-6-carboxylate lies in its use as a building block for advanced materials. For instance, it has been employed in the construction of coordination polymers and metal-organic frameworks (MOFs), which exhibit exceptional porosity and catalytic activity. These materials are being investigated for their potential in gas storage, separation, and catalysis.
In the realm of drug discovery, methyl 8-bromoquinoxaline-6-carboxylate has shown potential as a lead compound for developing anti-cancer agents. Recent studies have demonstrated that derivatives of this compound can inhibit key enzymes involved in cancer cell proliferation, such as cyclin-dependent kinases (CDKs). Additionally, its ability to modulate cellular signaling pathways makes it a candidate for targeted therapies.
Another area where methyl 8-bromoquinoxaline-6-carboxylate has made an impact is in optoelectronic devices. The compound's electronic properties make it suitable for use in organic light-emitting diodes (OLEDs) and photovoltaic cells. Researchers have reported enhanced device performance when this compound is incorporated into conjugated systems, highlighting its role in next-generation energy technologies.
From an environmental perspective, methyl 8-bromoquinoxaline-6-carboxylate has been studied for its biodegradation potential and eco-toxicological effects. Understanding its environmental fate is crucial for ensuring sustainable practices in its production and application.
In conclusion, methyl 8-bromoquinoxaline-6-carboxylate is a versatile compound with diverse applications across multiple disciplines. Its unique chemical structure, coupled with recent advancements in synthesis and application development, positions it as a key player in modern material science and pharmaceutical research.
1378260-25-3 (methyl 8-bromoquinoxaline-6-carboxylate) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)