Cas no 1360892-08-5 (6-fluoro-5-Methoxy-1H-indazole)
6-fluoro-5-Methoxy-1H-indazole Chemical and Physical Properties
Names and Identifiers
-
- 6-fluoro-5-Methoxy-1H-indazole
-
- Inchi: 1S/C8H7FN2O/c1-12-8-2-5-4-10-11-7(5)3-6(8)9/h2-4H,1H3,(H,10,11)
- InChI Key: XSHUJFLLMHBOKX-UHFFFAOYSA-N
- SMILES: N1C2=C(C=C(OC)C(F)=C2)C=N1
6-fluoro-5-Methoxy-1H-indazole Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLJ1770-100MG |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 95% | 100MG |
¥ 963.00 | 2023-04-06 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLJ1770-250MG |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 95% | 250MG |
¥ 1,537.00 | 2023-04-06 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLJ1770-500MG |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 95% | 500MG |
¥ 2,560.00 | 2023-04-06 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLJ1770-1G |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 95% | 1g |
¥ 3,841.00 | 2023-04-06 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLJ1770-5G |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 95% | 5g |
¥ 11,523.00 | 2023-04-06 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLJ1770-10G |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 95% | 10g |
¥ 19,206.00 | 2023-04-06 | |
| SHANG HAI BI DE YI YAO KE JI GU FEN Co., Ltd. | BD00785490-1g |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 98% | 1g |
¥5705.0 | 2023-04-10 | |
| Ambeed | A525100-1g |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 98% | 1g |
$831.0 | 2024-04-24 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLJ1770-100mg |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 95% | 100mg |
¥962.0 | 2024-04-24 | |
| NAN JING YAO SHI KE JI GU FEN Co., Ltd. | PBLJ1770-250mg |
6-fluoro-5-methoxy-1H-indazole |
1360892-08-5 | 95% | 250mg |
¥1537.0 | 2024-04-24 |
6-fluoro-5-Methoxy-1H-indazole Related Literature
-
Thi Thu Tram Nguyen,Thanh Binh Nguyen Org. Biomol. Chem., 2021,19, 6015-6020
-
Erika A. Cobar,Paul R. Horn,Robert G. Bergman,Martin Head-Gordon Phys. Chem. Chem. Phys., 2012,14, 15328-15339
-
Joseph W. Bennett,Diamond T. Jones,Blake G. Hudson,Joshua Melendez-Rivera,Robert J. Hamers,Sara E. Mason Environ. Sci.: Nano, 2020,7, 1642-1651
Additional information on 6-fluoro-5-Methoxy-1H-indazole
6-Fluoro-5-Methoxy-1H-Indazole: A Comprehensive Overview
The compound 6-fluoro-5-methoxy-1H-indazole (CAS No. 1360892-08-5) is a fascinating molecule with significant potential in various fields of research and application. This indazole derivative has garnered attention due to its unique structural properties and promising biological activities. In this article, we delve into the chemical structure, synthesis methods, biological activities, and potential applications of this compound, while incorporating the latest research findings to provide a comprehensive understanding.
6-Fluoro-5-methoxy-1H-indazole belongs to the indazole family, a class of heterocyclic compounds characterized by a bicyclic structure consisting of a benzene ring fused with an imidazole ring. The substitution pattern in this compound is particularly noteworthy: a fluorine atom at position 6 and a methoxy group at position 5. These substituents significantly influence the molecule's electronic properties, reactivity, and bioavailability. Recent studies have highlighted the importance of such substitutions in modulating the pharmacokinetic profiles of indazole derivatives, making them promising candidates for drug development.
The synthesis of 6-fluoro-5-methoxy-1H-indazole involves a series of well-established organic reactions. Typically, the process begins with the preparation of an appropriate indazole precursor, followed by nucleophilic substitution or electrophilic aromatic substitution to introduce the fluorine and methoxy groups. Researchers have explored various catalysts and reaction conditions to optimize yield and purity. For instance, recent advancements in transition-metal catalysis have enabled more efficient syntheses, reducing reaction times and enhancing selectivity. These improvements are crucial for scaling up production, especially for potential pharmaceutical applications.
One of the most exciting aspects of 6-fluoro-5-methoxy-1H-indazole is its diverse biological activities. Studies have demonstrated its potent inhibitory effects on several key enzymes and receptors involved in disease pathways. For example, it has shown significant activity as a kinase inhibitor, which is particularly relevant in cancer therapy. Additionally, its ability to modulate G-protein coupled receptors (GPCRs) suggests potential applications in treating neurological disorders such as Alzheimer's disease or Parkinson's disease. Recent research has also explored its anti-inflammatory and antioxidant properties, further broadening its therapeutic potential.
The pharmacokinetic profile of 6-fluoro-5-methoxy-1H-indazole is another area of active investigation. Researchers are examining its absorption, distribution, metabolism, and excretion (ADME) properties to assess its suitability as an orally available drug. Preliminary studies indicate favorable bioavailability, though further optimization may be required to enhance stability and reduce potential toxicity. Computational modeling techniques, such as molecular docking and pharmacophore modeling, are being employed to predict interactions with biological targets and guide future modifications.
Looking ahead, the applications of 6-fluoro-5-methoxy-1H-indazole extend beyond pharmacology. Its unique electronic properties make it a valuable component in materials science, particularly in the development of organic electronics and sensors. Recent breakthroughs in nanotechnology have highlighted its potential as a building block for advanced materials with tailored optoelectronic properties. Furthermore, its role as an intermediate in organic synthesis continues to be explored, offering new avenues for constructing complex molecular architectures.
In conclusion, 6-fluoro-5-methoxy-1H-indazole (CAS No. 1360892-08-5) is a multifaceted compound with immense potential across various scientific domains. Its unique structure, coupled with recent advancements in synthesis and biological studies, positions it as a promising candidate for future innovations in medicine and materials science. As research progresses, we can expect further elucidation of its properties and expanded applications that will contribute significantly to scientific advancement.
1360892-08-5 (6-fluoro-5-Methoxy-1H-indazole) Related Products
- 1082041-61-9(5-fluoro-1H-indazol-6-ol)
- 688781-69-3(BENZENAMINE, 3-FLUORO-4-(1H-INDAZOL-5-YLOXY)-)
- 1082041-57-3(5-Fluoro-6-methoxy (1H)indazole)
- 885522-57-6(6-Fluoro-4-methoxy-(1H)indazole)
- 688781-73-9(BENZENAMINE, 3-FLUORO-4-(1H-INDAZOL-6-YLOXY)-)
- 478838-63-0(4-fluoro-1H-indazol-5-ol)
- 887569-13-3(4-Fluoro-6-methoxy-1H-indazole)
- 1000341-74-1(4-fluoro-7-methoxy-1H-indazole)
- 1253791-66-0(4-Fluoro-1H-indazol-6-ol)
- 864500-65-2(1H-INDAZOLE, 6-(2-FLUOROPHENOXY)-)