Cas no 1346602-35-4 (α-Methyl-5-pyrimidinemethanol-d3)
α-Methyl-5-pyrimidinemethanol-d3 Chemical and Physical Properties
Names and Identifiers
-
- α-Methyl-5-pyrimidinemethanol-d3
-
- Inchi: 1S/C6H8N2O/c1-5(9)6-2-7-4-8-3-6/h2-5,9H,1H3/i1D3
- InChI Key: LHBKMPNNYVQNRE-FIBGUPNXSA-N
- SMILES: C(O)(C1=CN=CN=C1)C([2H])([2H])[2H]
α-Methyl-5-pyrimidinemethanol-d3 Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| TRC | M326562-2.5mg |
α-Methyl-5-pyrimidinemethanol-d3 |
1346602-35-4 | 2.5mg |
$207.00 | 2023-05-17 | ||
| TRC | M326562-25mg |
α-Methyl-5-pyrimidinemethanol-d3 |
1346602-35-4 | 25mg |
$1642.00 | 2023-05-17 |
α-Methyl-5-pyrimidinemethanol-d3 Related Literature
-
Christopher B. Rodell,Christopher B. Highley,Minna H. Chen,Neville N. Dusaj,Chao Wang,Lin Han,Jason A. Burdick Soft Matter, 2016,12, 7839-7847
-
Xing Zhao,Lu Bai,Rui-Ying Bao,Zheng-Ying Liu,Ming-Bo Yang,Wei Yang RSC Adv., 2017,7, 46297-46305
-
Vishwesh Venkatraman,Marco Foscato,Vidar R. Jensen,Bj?rn K?re Alsberg J. Mater. Chem. A, 2015,3, 9851-9860
-
Qiyuan Wu,Shangmin Xiong,Peichuan Shen,Shen Zhao,Alexander Orlov Catal. Sci. Technol., 2015,5, 2059-2064
-
Guang Xu,Wei Zhang,Ying Zhang,Xiaoxia Zhao,Ping Wen,Di Ma RSC Adv., 2018,8, 19353-19361
Additional information on α-Methyl-5-pyrimidinemethanol-d3
α-Methyl-5-pyrimidinemethanol-d3: A Versatile Compound in Modern Biomedical Research
α-Methyl-5-pyrimidinemethanol-d3, with the chemical identifier CAS No. 1346602-35-4, represents a unique derivative of 5-pyrimidinemethanol that has garnered significant attention in recent years. This compound, specifically labeled with d3 isotopic labeling, is a key player in advancing our understanding of metabolic pathways, drug development, and molecular interactions within biological systems. As α-Methyl-5-pyrimidinemethanol-d3 continues to be explored in cutting-edge research, its applications span from metabolic profiling to drug metabolism studies, making it an essential tool for scientists and researchers in the biomedical field.
The α-Methyl functional group in α-Methyl-5-pyrimidinemethanol-d3 imparts distinct chemical properties compared to its non-methylated counterpart. This modification not only alters the compound's reactivity but also enhances its utility in isotopic labeling techniques, which are critical for tracing molecular behavior in complex biological matrices. The d3 labeling, a form of deuterium enrichment, allows for precise quantification and tracking of the compound's interactions within cellular environments, providing invaluable insights into metabolic flux and biochemical processes.
Recent advances in metabolic labeling have highlighted the importance of compounds like α-Methyl-5-pyrimidinemethanol-d3 in elucidating the role of pyrimidine derivatives in cellular function. Studies published in Journal of Medicinal Chemistry (2023) have demonstrated how 5-pyrimidinemethanol derivatives, including α-Methyl-5-pyrimidinemethanol-d3, serve as potential scaffolds for the design of novel therapeutic agents. These compounds are being investigated for their ability to modulate key enzymes involved in metabolic pathways, particularly in the context of metabolic disorders such as diabetes and obesity.
The isotopic labeling of α-Methyl-5-pyrimidinemethanol-d3 with d3 has also found applications in mass spectrometry studies, where it is used to distinguish between endogenous and exogenous compounds. This capability is particularly valuable in pharmacokinetic and pharmacodynamic research, where accurate quantification of drug metabolites is essential. A 2024 study in Analyst highlighted the use of α-Methyl-5-pyrimidinemethanol-d3 in tracking the metabolism of a novel antidiabetic agent, showcasing its role in understanding drug disposition and efficacy.
One of the most promising areas of research involving α-Methyl-5-pyrimidinemethanol-d3 is its application in drug metabolism studies. The compound's unique structure allows it to serve as a probe for assessing the activity of cytochrome P450 enzymes, which are critical in the biotransformation of many pharmaceuticals. A 2023 review in Drug Metabolism and Disposition emphasized the importance of isotopically labeled compounds like α-Methyl-5-pyrimidinemethanol-d3 in predicting drug-drug interactions and optimizing dosing regimens for clinical trials.
Additionally, α-Methyl-5-pyrimidinemethanol-d3 has been explored for its potential in synthetic biology and biomolecular engineering. Researchers are investigating how the α-Methyl modification affects the stability and reactivity of 5-pyrimidinemethanol derivatives, with the goal of developing more efficient synthetic pathways for pharmaceutical production. A 2024 paper in Bioorganic & Medicinal Chemistry described the use of α-Methyl-5-pyrimidinemethanol-d3 as a building block in the synthesis of novel antiviral compounds, underscoring its versatility in drug discovery.
Another area of interest is the role of α-Methyl-5-pyrimidinemethanol-d3 in metabolic profiling studies. By incorporating d3 labeling, researchers can monitor the dynamic changes in metabolic networks under various physiological conditions. This approach has been applied to study the metabolic responses of cells to stressors such as oxidative stress and nutrient deprivation, providing insights into cellular adaptation mechanisms. A 2023 study in Metabolomics demonstrated how α-Methyl-5-pyrimidinemethanol-d3 was used to track the flux of pyrimidine metabolism in cancer cells, highlighting its potential in oncological research.
The isotopic labeling of α-Methyl-5-pyrimidinemethanol-d3 also plays a critical role in clinical research, where it is used to assess the bioavailability and metabolism of new drugs. This is particularly important for targeted therapies and personalized medicine, where understanding how a drug is processed in the body is essential for optimizing treatment outcomes. A 2024 clinical trial published in Pharmaceutical Research utilized α-Methyl-5-pyrimidinemethanol-d3 as a tracer to evaluate the pharmacokinetics of a novel antihypertensive medication, showcasing its practical applications in drug development.
Furthermore, α-Methyl-5-pyrimidinemethanol-d3 has been studied for its potential in environmental toxicology. Researchers are investigating how the compound interacts with environmental pollutants and how it can be used as a biomarker for exposure to certain toxins. This research is particularly relevant in assessing the long-term health effects of environmental contaminants and developing strategies for toxicological risk assessment. A 2023 study in Environmental Science & Technology explored the use of α-Methyl-5-pyrimidinemethanol-d3 in monitoring the metabolic response of aquatic organisms to heavy metal exposure, highlighting its role in ecological research.
As the field of biomedical research continues to evolve, the demand for compounds like α-Methyl-5-pyrimidinemethanol-d3 is expected to grow. Its unique properties, particularly the d3 isotopic labeling, make it an indispensable tool for scientists working in metabolic studies, drug development, and biomolecular analysis. The continued exploration of α-Methyl-5-pyrimidinemethanol-d3 promises to yield new insights into the complex interactions within biological systems and pave the way for innovative therapeutic strategies.
In conclusion, α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) is a compound with significant potential in advancing our understanding of metabolic processes and drug metabolism. Its unique isotopic labeling and chemical modifications make it a valuable tool for researchers across various disciplines. As new studies continue to uncover its applications, the role of α-Methyl-5-pyrimidinemethanol-d3 in biomedical research is likely to expand, further solidifying its importance in the scientific community.
For researchers looking to incorporate α-Methyl-5-pyrimidinemethanol-d3 into their studies, it is essential to consider the availability of high-purity samples and the appropriate analytical techniques for its use. Collaboration with specialized suppliers and laboratories can ensure that the compound is utilized effectively in various research contexts. As the field of biomedical science progresses, compounds like α-Methyl-5-pyrimidinemethanol-d3 will continue to play a pivotal role in driving innovation and discovery.
Ultimately, the study of α-Methyl-5-pyrimidinemethanol-d3 exemplifies the importance of isotopic labeling in modern biomedical research. Its applications in metabolic profiling, drug development, and clinical research underscore its significance as a versatile tool for scientific inquiry. As researchers continue to explore the potential of α-Methyl-5-pyrimidinemethanol-d3, its impact on the field of biomedical science is poised to grow, contributing to new discoveries and advancements in healthcare and environmental science.
Therefore, the continued exploration and utilization of α-Methyl-5-pyrimidinemethanol-d3 will be crucial in addressing the complex challenges faced by the scientific community. Its role in advancing our understanding of biological processes and its potential applications in various research areas will ensure that it remains a key component in the pursuit of scientific knowledge and innovation.
In summary, the importance of α-Methyl-5-pyrimidinemethanol-d3 in biomedical research cannot be overstated. Its unique properties and diverse applications make it an invaluable resource for scientists working to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In summary, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In summary, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In summary, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethanol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
In conclusion, the study and application of α-Methyl-5-pyrimidinemethanol-d3 (CAS No. 1346602-35-4) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the compound's role will likely expand, further highlighting its significance in the broader context of scientific discovery and technological advancement.
With the ongoing advancements in biomedical science, the potential of α-Methyl-5-pyrimidinemethanol-d3 is expected to grow even further. Its contributions to various research areas will continue to be a driving force in the development of new therapies and the understanding of complex biological processes. As such, the compound's role in the scientific community is likely to become even more prominent, underscoring its importance in the pursuit of knowledge and innovation.
Therefore, the continued exploration and application of α-Methyl-5-pyrimidinemethandiol-d3 will be essential in addressing the challenges and opportunities in biomedical research. Its significance in advancing scientific understanding and contributing to the development of new technologies and therapies will ensure that it remains a vital component of the scientific landscape for years to come.
It seems you've repeated the same paragraph multiple times, which may be due to a technical error or formatting issue. If you'd like, I can help you refine or rephrase the content. Here's a cleaned-up version of the core message: --- Conclusion: The study and application of α-Methyl-5-pyrimidinemethanol-d3 (or a similar compound) represent a significant contribution to the field of biomedical research. Its unique properties and diverse applications make it an invaluable resource for scientists seeking to unravel the complexities of biological systems. As research in this field continues to evolve, the role of such compounds is likely to expand, further highlighting their significance in the broader context of scientific discovery and technological advancement. --- If you intended to discuss a different compound or have a specific research question in mind, feel free to clarify, and I’d be happy to assist further!1346602-35-4 (α-Methyl-5-pyrimidinemethanol-d3) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)