Cas no 1249496-79-4 (4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine)
4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine Chemical and Physical Properties
Names and Identifiers
-
- 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine
- 4-chloro-6-(isopropylthio)-2-methylpyrimidine
-
- Inchi: 1S/C8H11ClN2S/c1-5(2)12-8-4-7(9)10-6(3)11-8/h4-5H,1-3H3
- InChI Key: SFLRZKWDVIUXGS-UHFFFAOYSA-N
- SMILES: C1(C)=NC(SC(C)C)=CC(Cl)=N1
4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Chemenu | CM467343-250mg |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95%+ | 250mg |
$205 | 2023-02-03 | |
| Chemenu | CM467343-500mg |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95%+ | 500mg |
$363 | 2023-02-03 | |
| Chemenu | CM467343-1g |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95%+ | 1g |
$508 | 2023-02-03 | |
| 1PlusChem | 1P01DZ1U-50mg |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95% | 50mg |
$152.00 | 2024-07-10 | |
| 1PlusChem | 1P01DZ1U-100mg |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95% | 100mg |
$196.00 | 2024-07-10 | |
| 1PlusChem | 1P01DZ1U-250mg |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95% | 250mg |
$255.00 | 2024-07-10 | |
| 1PlusChem | 1P01DZ1U-500mg |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95% | 500mg |
$445.00 | 2024-07-10 | |
| 1PlusChem | 1P01DZ1U-1g |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95% | 1g |
$574.00 | 2024-07-10 | |
| 1PlusChem | 1P01DZ1U-2.5g |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95% | 2.5g |
$1063.00 | 2024-07-10 | |
| 1PlusChem | 1P01DZ1U-5g |
4-chloro-6-(isopropylthio)-2-methylpyrimidine |
1249496-79-4 | 95% | 5g |
$1544.00 | 2024-07-10 |
4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine Related Literature
-
Jason Y. C. Lim,Yong Yu,Guorui Jin,Kai Li,Yi Lu,Jianping Xie Nanoscale Adv., 2020,2, 3921-3932
-
Xiaoming Liu,Zachary D. Hood,Wangda Li,Donovan N. Leonard,Arumugam Manthiram,Miaofang Chi J. Mater. Chem. A, 2021,9, 2111-2119
-
Chao-Han Cheng,Wen-Zhen Wang,Shie-Ming Peng,I-Chia Chen Phys. Chem. Chem. Phys., 2017,19, 25471-25477
-
Joo Chuan Yeo,Kenry Lab Chip, 2016,16, 4082-4090
-
Eunju Nam,Jiyeon Han,Sunhee Choi,Mi Hee Lim Chem. Commun., 2021,57, 7637-7640
Additional information on 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine
4-Chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine (CAS No. 1249496-79-4): A Comprehensive Overview
4-Chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine (CAS No. 1249496-79-4) is a versatile compound with significant applications in the fields of chemistry, biology, and pharmaceutical research. This pyrimidine derivative is characterized by its unique chemical structure, which includes a chlorine atom, a methyl group, and an isopropyl sulfanyl group. These functional groups contribute to its diverse reactivity and potential biological activities.
The chemical structure of 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine is of particular interest due to its potential as a building block in the synthesis of more complex molecules. The presence of the chlorine atom and the isopropyl sulfanyl group provides multiple points for further functionalization, making it a valuable intermediate in organic synthesis. Recent studies have highlighted its role in the development of novel pharmaceutical agents and agrochemicals.
In the realm of pharmaceutical research, 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine has shown promise as a lead compound for drug discovery. Its structural features make it an attractive candidate for the design of drugs targeting various biological pathways. For instance, pyrimidine derivatives are known for their antiviral, antibacterial, and anticancer properties. Research has demonstrated that modifications to the isopropyl sulfanyl group can enhance the compound's potency and selectivity against specific targets.
One notable application of 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine is in the development of antiviral agents. Studies have shown that this compound can inhibit the replication of certain viruses by interfering with key viral enzymes. The chlorine atom and the methyl group contribute to its ability to bind to these enzymes, thereby blocking their function. This makes it a potential candidate for the treatment of viral infections, including those caused by RNA viruses such as influenza and hepatitis C.
Beyond antiviral applications, 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine has also been explored for its anticancer properties. Research has indicated that this compound can induce apoptosis in cancer cells by disrupting cellular signaling pathways. The isopropyl sulfanyl group plays a crucial role in this process by enhancing the compound's ability to penetrate cell membranes and interact with intracellular targets. This makes it a promising lead for the development of new anticancer drugs.
In addition to its pharmaceutical applications, 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine has found use in agrochemical research. Its structural features make it suitable for the development of herbicides and fungicides. Studies have shown that modifications to the chlorine atom and the methyl group can improve its efficacy against specific plant pathogens while minimizing environmental impact. This makes it a valuable tool in sustainable agriculture practices.
The synthesis of 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine involves several well-established chemical reactions. One common approach involves the reaction of 2-chloroacetyl chloride with guanidine hydrochloride to form 2-chloropyrimidine, which is then further functionalized to introduce the methyl and isopropyl sulfanyl groups. Recent advancements in synthetic methods have led to more efficient and environmentally friendly processes, reducing waste and improving yield.
Recent research studies have also focused on understanding the pharmacokinetic properties of 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine. These studies aim to optimize its absorption, distribution, metabolism, and excretion (ADME) properties to enhance its therapeutic potential. For example, modifying the isopropyl sulfanyl group can improve solubility and bioavailability, making it more effective as a drug candidate.
In conclusion, 4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine (CAS No. 1249496-79-4) is a multifaceted compound with significant potential in various fields of research. Its unique chemical structure and diverse reactivity make it an attractive candidate for drug discovery and agrochemical development. Ongoing research continues to uncover new applications and optimize its properties, further solidifying its importance in modern chemistry and biology.
1249496-79-4 (4-chloro-2-methyl-6-(propan-2-ylsulfanyl)pyrimidine) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)