Cas no 1191545-46-6 (2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride)
2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride Chemical and Physical Properties
Names and Identifiers
-
- 2-Methyl-3-(trifluoromethyl)benzenesulfonylchloride
- Benzenesulfonyl chloride, 2-methyl-3-(trifluoromethyl)-
- 2-Methyl-3-(trifluoromethyl)-benzenesulfonyl chloride
- 2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride
- SCHEMBL22489744
- BQIPHYPNVYOSER-UHFFFAOYSA-N
- MFCD12026169
- JS-5182
- 2-Methyl-3-trifluoromethylbenzenesulfonyl chloride
- CS-0335056
- 2-Methyl-3-(trifluoromethyl)benzene-1-sulfonylchloride
- 2-methyl-3-(trifluoromethyl)benzenesulfonyl chloride
- EN300-109598
- 2-Methyl-3-trifluoromethylbenzenesulfonylchloride
- G28330
- DB-150120
- AKOS017565708
- 1191545-46-6
-
- MDL: MFCD12026169
- Inchi: 1S/C8H6ClF3O2S/c1-5-6(8(10,11)12)3-2-4-7(5)15(9,13)14/h2-4H,1H3
- InChI Key: BQIPHYPNVYOSER-UHFFFAOYSA-N
- SMILES: C1(S(Cl)(=O)=O)=CC=CC(C(F)(F)F)=C1C
Computed Properties
- Exact Mass: 257.9729128g/mol
- Monoisotopic Mass: 257.9729128g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 2
- Heavy Atom Count: 15
- Rotatable Bond Count: 2
- Complexity: 320
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 3.2
- Topological Polar Surface Area: 42.5?2
2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Fluorochem | 037951-1g |
2-Methyl-3-trifluoromethylbenzenesulfonylchloride |
1191545-46-6 | 1g |
£335.00 | 2022-02-28 | ||
| Fluorochem | 037951-5g |
2-Methyl-3-trifluoromethylbenzenesulfonylchloride |
1191545-46-6 | 5g |
£1005.00 | 2022-02-28 | ||
| Apollo Scientific | PC303182-1g |
2-Methyl-3-(trifluoromethyl)benzenesulfonyl chloride |
1191545-46-6 | 97% | 1g |
£274.00 | 2025-02-21 | |
| Apollo Scientific | PC303182-5g |
2-Methyl-3-(trifluoromethyl)benzenesulfonyl chloride |
1191545-46-6 | 97% | 5g |
£731.00 | 2025-02-21 | |
| abcr | AB404152-1 g |
2-Methyl-3-(trifluoromethyl)benzenesulfonyl chloride; . |
1191545-46-6 | 1 g |
€369.00 | 2023-07-19 | ||
| Enamine | EN300-109598-0.05g |
2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride |
1191545-46-6 | 95% | 0.05g |
$70.0 | 2023-10-27 | |
| Enamine | EN300-109598-0.1g |
2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride |
1191545-46-6 | 95% | 0.1g |
$105.0 | 2023-10-27 | |
| Enamine | EN300-109598-0.25g |
2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride |
1191545-46-6 | 95% | 0.25g |
$149.0 | 2023-10-27 | |
| Enamine | EN300-109598-0.5g |
2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride |
1191545-46-6 | 95% | 0.5g |
$235.0 | 2023-10-27 | |
| Enamine | EN300-109598-1.0g |
2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride |
1191545-46-6 | 95% | 1g |
$301.0 | 2023-05-24 |
2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride Related Literature
-
Pavel Karásek,Jakub Grym,Michal Roth,Josef Planeta,Franti?ek Foret Lab Chip, 2015,15, 311-318
-
Qiyuan Wu,Shangmin Xiong,Peichuan Shen,Shen Zhao,Alexander Orlov Catal. Sci. Technol., 2015,5, 2059-2064
-
Craig A. Kelly,David R. Rosseinsky Phys. Chem. Chem. Phys., 2001,3, 2086-2090
-
Matthew J. Gaunt,Jinquan Yu,Jonathan B. Spencer Chem. Commun., 2001, 1844-1845
Additional information on 2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride
Introduction to 2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride (CAS No. 1191545-46-6)
2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride, identified by the CAS number 1191545-46-6, is a specialized organic compound that has garnered significant attention in the field of pharmaceutical and chemical research. This compound belongs to the class of sulfonyl chlorides, which are widely recognized for their utility as intermediates in the synthesis of various biologically active molecules. The presence of both a methyl group and a trifluoromethyl group in its aromatic structure imparts unique electronic and steric properties, making it a valuable building block for further chemical modifications.
The trifluoromethyl group, in particular, is a key feature that enhances the compound's reactivity and stability under various conditions. This moiety is frequently employed in medicinal chemistry due to its ability to influence metabolic pathways and improve pharmacokinetic profiles of drug candidates. The sulfonyl chloride functional group further contributes to the compound's versatility, enabling its use in nucleophilic substitution reactions to form sulfonamides, which are prevalent in many therapeutic agents.
In recent years, there has been a surge in research focused on the development of novel compounds with enhanced bioavailability and reduced toxicity. The 2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride has emerged as a promising intermediate in this context. For instance, studies have demonstrated its utility in the synthesis of potent inhibitors targeting enzyme-catalyzed pathways relevant to inflammation and cancer. The compound's ability to undergo selective functionalization has allowed researchers to explore diverse structural analogs with tailored biological activities.
One notable application of this compound is in the field of oncology. Researchers have leveraged its sulfonyl chloride moiety to develop small-molecule inhibitors that disrupt key signaling pathways involved in tumor growth. The trifluoromethyl group has been shown to improve binding affinity and selectivity, leading to more effective therapeutic outcomes. Additionally, preclinical studies have highlighted the compound's potential in modulating immune responses, suggesting its relevance beyond traditional chemotherapy approaches.
The synthetic methodologies for preparing 2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride have also seen significant advancements. Modern techniques, such as catalytic fluorination and sulfonylation reactions, have enabled more efficient and scalable production processes. These innovations not only reduce costs but also minimize environmental impact, aligning with the growing emphasis on sustainable chemistry practices. The compound's robustness under various reaction conditions makes it an attractive choice for industrial applications where reproducibility and yield are critical.
Another area where this compound has made a significant impact is in the development of agrochemicals. The unique combination of functional groups allows for the creation of derivatives with herbicidal and pesticidal properties. By modifying the aromatic core or introducing additional substituents, chemists can fine-tune the biological activity of these compounds to target specific pests or plant pathogens. This has led to the discovery of new generation agrochemicals that offer improved efficacy and environmental safety.
The role of computational chemistry in optimizing derivatives of 2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride cannot be overstated. Advanced modeling techniques have enabled researchers to predict the structural and electronic properties of potential analogs before conducting experimental synthesis. This approach has significantly accelerated the drug discovery process by identifying promising candidates with high confidence. Moreover, machine learning algorithms have been employed to analyze large datasets containing structural activity relationships (SAR), further guiding the design of novel compounds with enhanced pharmacological profiles.
In conclusion, 2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride (CAS No. 1191545-46-6) represents a versatile and valuable intermediate in modern chemical synthesis. Its unique structural features make it indispensable in pharmaceutical research, particularly for developing innovative therapeutics targeting complex diseases such as cancer and inflammation. As research continues to evolve, this compound is expected to remain at the forefront of molecular innovation, driving advancements across multiple scientific disciplines.
1191545-46-6 (2-methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride) Related Products
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)