Cas no 1158209-10-9 (1-methyl-1H-indole-3-sulfonyl chloride)
1-methyl-1H-indole-3-sulfonyl chloride Chemical and Physical Properties
Names and Identifiers
-
- 1H-Indole-3-sulfonyl chloride, 1-methyl-
- 1-methyl-1H-indole-3-sulfonyl chloride
- EN300-120727
- SCHEMBL630954
- 1-methylindole-3-sulfonyl chloride
- AKMBTZLSBMNKPJ-UHFFFAOYSA-N
- 1158209-10-9
- G51138
- 1-methyl-1H-indole-3-sulfonylchloride
- AKOS006335485
- ZSA17261
- 860-737-6
-
- Inchi: 1S/C9H8ClNO2S/c1-11-6-9(14(10,12)13)7-4-2-3-5-8(7)11/h2-6H,1H3
- InChI Key: AKMBTZLSBMNKPJ-UHFFFAOYSA-N
- SMILES: ClS(C1=CN(C)C2C=CC=CC=21)(=O)=O
Computed Properties
- Exact Mass: 228.9964274g/mol
- Monoisotopic Mass: 228.9964274g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 2
- Heavy Atom Count: 14
- Rotatable Bond Count: 1
- Complexity: 311
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 2.3
- Topological Polar Surface Area: 47.4?2
1-methyl-1H-indole-3-sulfonyl chloride Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| Enamine | EN300-120727-0.05g |
1-methyl-1H-indole-3-sulfonyl chloride |
1158209-10-9 | 95% | 0.05g |
$101.0 | 2023-02-15 | |
| Enamine | EN300-120727-0.1g |
1-methyl-1H-indole-3-sulfonyl chloride |
1158209-10-9 | 95% | 0.1g |
$152.0 | 2023-02-15 | |
| Enamine | EN300-120727-0.25g |
1-methyl-1H-indole-3-sulfonyl chloride |
1158209-10-9 | 95% | 0.25g |
$216.0 | 2023-02-15 | |
| Enamine | EN300-120727-0.5g |
1-methyl-1H-indole-3-sulfonyl chloride |
1158209-10-9 | 95% | 0.5g |
$407.0 | 2023-02-15 | |
| Enamine | EN300-120727-1.0g |
1-methyl-1H-indole-3-sulfonyl chloride |
1158209-10-9 | 95% | 1g |
$0.0 | 2023-06-08 | |
| Enamine | EN300-120727-2.5g |
1-methyl-1H-indole-3-sulfonyl chloride |
1158209-10-9 | 95% | 2.5g |
$1034.0 | 2023-02-15 | |
| Enamine | EN300-120727-5.0g |
1-methyl-1H-indole-3-sulfonyl chloride |
1158209-10-9 | 95% | 5.0g |
$1530.0 | 2023-02-15 | |
| Enamine | EN300-120727-10.0g |
1-methyl-1H-indole-3-sulfonyl chloride |
1158209-10-9 | 95% | 10.0g |
$2269.0 | 2023-02-15 | |
| Aaron | AR028XOH-50mg |
1-methyl-1H-indole-3-sulfonylchloride |
1158209-10-9 | 95% | 50mg |
$164.00 | 2025-02-17 | |
| Aaron | AR028XOH-100mg |
1-methyl-1H-indole-3-sulfonylchloride |
1158209-10-9 | 95% | 100mg |
$234.00 | 2025-02-17 |
1-methyl-1H-indole-3-sulfonyl chloride Related Literature
-
Christopher J. Harrison,Kyle J. Berean,Enrico Della Gaspera,Jian Zhen Ou,Richard B. Kaner,Kourosh Kalantar-zadeh,Torben Daeneke Nanoscale, 2016,8, 16276-16283
-
2. Excimer emission and magnetoluminescence of radical-based zinc(ii) complexes doped in host crystals?Shojiro Kimura,Tetsuro Kusamoto Chem. Commun., 2020,56, 11195-11198
-
Ross Harder,David C. Dunand,Ian McNulty Nanoscale, 2017,9, 5686-5693
-
Craig A. Kelly,David R. Rosseinsky Phys. Chem. Chem. Phys., 2001,3, 2086-2090
-
Jacob S. Jordan,Evan R. Williams Analyst, 2021,146, 2617-2625
Additional information on 1-methyl-1H-indole-3-sulfonyl chloride
Introduction to CAS No. 1158209-10-9: 1-Methyl-1H-Indole-3-Sulfonyl Chloride
CAS No. 1158209-10-9, commonly referred to as 1-methyl-1H-indole-3-sulfonyl chloride, is a highly specialized organic compound that has garnered significant attention in the fields of pharmaceutical chemistry, materials science, and organic synthesis. This compound is characterized by its unique structure, which combines the indole moiety with a sulfonyl chloride group, making it a versatile building block for various chemical reactions. The indole ring, a heterocyclic structure with nitrogen and aromaticity, is a fundamental component in many bioactive molecules, while the sulfonyl chloride group introduces reactivity and functional diversity.
Recent advancements in organocatalysis and click chemistry have highlighted the potential of CAS No. 1158209-10-9 as a key intermediate in the synthesis of complex molecules. Researchers have explored its role in constructing biologically active compounds, such as kinase inhibitors and GPCR modulators, due to its ability to participate in both nucleophilic aromatic substitution and coupling reactions. The methyl group at the 1-position of the indole ring enhances the compound's stability and solubility, making it an ideal candidate for large-scale synthesis.
The synthesis of CAS No. 1158209-10-9 typically involves multi-step processes that emphasize precision and control over steric and electronic factors. One common approach is the sulfonation of indole derivatives followed by chlorination to introduce the sulfonyl chloride functionality. This method ensures high purity and reproducibility, which are critical for downstream applications in drug discovery and materials development.
In terms of applications, CAS No. 1158209-10-9 has been extensively utilized in the development of bioconjugates and nanomaterials. Its reactivity allows for the formation of stable bonds with various biomolecules, such as peptides and proteins, enabling the creation of targeted drug delivery systems. Additionally, its use in polymer chemistry has led to the development of novel materials with tailored mechanical and electronic properties.
Recent studies have also focused on the environmental impact of CAS No. 1158209-10-9 and its degradation pathways under different conditions. Understanding its stability and biodegradability is crucial for ensuring sustainable practices in chemical manufacturing and reducing ecological footprint.
In conclusion, CAS No. 1158209-10-9: 1-Methyl-1H-indole-3-sulfonyl chloride stands as a pivotal compound in modern chemical research, offering a wide range of applications across multiple disciplines. Its unique structure, reactivity, and versatility continue to drive innovation in drug discovery, materials science, and beyond.
1158209-10-9 (1-methyl-1H-indole-3-sulfonyl chloride) Related Products
- 2098070-20-1(2-(3-(Pyridin-3-yl)-1H-pyrazol-1-yl)acetimidamide)
- 2680771-01-9(4-cyclopentyl-3-{(prop-2-en-1-yloxy)carbonylamino}butanoic acid)
- 1444113-98-7(N-(3-cyanothiolan-3-yl)-2-[(2,2,2-trifluoroethyl)sulfanyl]pyridine-4-carboxamide)
- 332062-08-5(Fmoc-S-3-amino-4,4-diphenyl-butyric acid)
- 1270529-38-8(1,2,3,4,5,6-Hexahydro-[2,3]bipyridinyl-6-ol)
- 941977-17-9(N'-(3-chloro-2-methylphenyl)-N-2-(dimethylamino)-2-(naphthalen-1-yl)ethylethanediamide)
- 2138166-62-6(2,2-Difluoro-3-[methyl(2-methylbutyl)amino]propanoic acid)
- 89640-58-4(2-Iodo-4-nitrophenylhydrazine)
- 1449132-38-0(3-Fluoro-5-(2-fluoro-5-methylbenzylcarbamoyl)benzeneboronic acid)
- 2034271-14-0(2-(1H-indol-3-yl)-N-{[6-(thiophen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}acetamide)