Cas no 103342-27-4 (Methyl 2-(Chlorosulfonyl)methylbenzoate)
Methyl 2-(Chlorosulfonyl)methylbenzoate Chemical and Physical Properties
Names and Identifiers
-
- Benzoic acid, 2-[(chlorosulfonyl)methyl]-, methyl ester
- o-methoxycarbonyl benzyl sulfonyl chloride
- methyl 2-((chlorosulfonyl)methyl)benzoate
- methyl 2-(chlorosulfonylmethyl)benzoate
- 2-CHLOROSULFONYLMETHYL-BENZOIC ACID METHYL ESTER
- AB56170
- CTK8G4699
- EN300-59510
- methyl 2-[(chlorosulfonyl)methyl]benzoate
- MolPort-013-745-269
- S663
- DZNIVKJHYLMSST-UHFFFAOYSA-N
- 103342-27-4
- DA-16107
- SCHEMBL2884550
- o-methoxycarbonylbenzyl sulfonyl chloride
- o-(carbomethoxy)phenylmethanesulfonyl chloride
- methyl2-[(chlorosulfonyl)methyl]benzoate
- AKOS011309094
- MFCD10566386
- Methyl 2-(Chlorosulfonyl)methylbenzoate
-
- MDL: MFCD10566386
- Inchi: 1S/C9H9ClO4S/c1-14-9(11)8-5-3-2-4-7(8)6-15(10,12)13/h2-5H,6H2,1H3
- InChI Key: DZNIVKJHYLMSST-UHFFFAOYSA-N
- SMILES: ClS(CC1C=CC=CC=1C(=O)OC)(=O)=O
Computed Properties
- Exact Mass: 247.99107
- Monoisotopic Mass: 247.9910076g/mol
- Isotope Atom Count: 0
- Hydrogen Bond Donor Count: 0
- Hydrogen Bond Acceptor Count: 4
- Heavy Atom Count: 15
- Rotatable Bond Count: 4
- Complexity: 320
- Covalently-Bonded Unit Count: 1
- Defined Atom Stereocenter Count: 0
- Undefined Atom Stereocenter Count : 0
- Defined Bond Stereocenter Count: 0
- Undefined Bond Stereocenter Count: 0
- XLogP3: 2.3
- Topological Polar Surface Area: 68.8?2
Experimental Properties
- PSA: 60.44
- LogP: 2.62260
Methyl 2-(Chlorosulfonyl)methylbenzoate Pricemore >>
| Related Categories | No. | Product Name | Cas No. | Purity | Specification | Price | update time | Inquiry |
|---|---|---|---|---|---|---|---|---|
| TRC | B495145-100mg |
Methyl 2-[(Chlorosulfonyl)methyl]benzoate |
103342-27-4 | 100mg |
$ 190.00 | 2023-04-18 | ||
| TRC | B495145-250mg |
Methyl 2-[(Chlorosulfonyl)methyl]benzoate |
103342-27-4 | 250mg |
$ 316.00 | 2023-04-18 | ||
| TRC | B495145-500mg |
Methyl 2-[(Chlorosulfonyl)methyl]benzoate |
103342-27-4 | 500mg |
$ 506.00 | 2023-04-18 | ||
| abcr | AB336842-250mg |
o-Methoxycarbonyl benzyl sulfonyl chloride, 90%; . |
103342-27-4 | 90% | 250mg |
€685.00 | 2025-02-20 | |
| abcr | AB336842-1g |
o-Methoxycarbonyl benzyl sulfonyl chloride, 90%; . |
103342-27-4 | 90% | 1g |
€1313.50 | 2025-02-20 | |
| abcr | AB336842-250 mg |
o-Methoxycarbonyl benzyl sulfonyl chloride, 90%; . |
103342-27-4 | 90% | 250 mg |
€685.00 | 2023-07-19 | |
| abcr | AB336842-1 g |
o-Methoxycarbonyl benzyl sulfonyl chloride, 90%; . |
103342-27-4 | 90% | 1 g |
€1,313.50 | 2023-07-19 | |
| Ambeed | A1114131-1g |
Methyl 2-[(chlorosulfonyl)methyl]benzoate |
103342-27-4 | 95% | 1g |
$675.0 | 2024-04-26 | |
| A2B Chem LLC | AE27297-2.5g |
o-methoxycarbonyl benzyl sulfonyl chloride |
103342-27-4 | 93% | 2.5g |
$1832.00 | 2024-04-20 | |
| A2B Chem LLC | AE27297-5g |
o-methoxycarbonyl benzyl sulfonyl chloride |
103342-27-4 | 93% | 5g |
$2693.00 | 2024-04-20 |
Methyl 2-(Chlorosulfonyl)methylbenzoate Related Literature
-
Huabin Zhang,Shaowu Du CrystEngComm, 2014,16, 4059-4068
-
Ravi Kumar Yadav,R. Govindaraj Phys. Chem. Chem. Phys., 2020,22, 26876-26886
-
Haitao Li,Yu Pan,Zhizhi Wang,Shan Chen,Ruixin Guo,Jianqiu Chen RSC Adv., 2015,5, 100775-100782
-
Huiying Xu,Lu Zheng,Yu Zhou,Bang-Ce Ye Analyst, 2021,146, 5542-5549
Additional information on Methyl 2-(Chlorosulfonyl)methylbenzoate
Methyl 2-(Chlorosulfonyl)methylbenzoate (CAS No. 103342-27-4): A Comprehensive Overview in Modern Chemical Research
Methyl 2-(Chlorosulfonyl)methylbenzoate, identified by its unique chemical identifier CAS No. 103342-27-4, is a compound of significant interest in the realm of organic chemistry and pharmaceutical research. This compound, characterized by its complex molecular structure, has garnered attention due to its versatile applications and potential in various chemical syntheses. The presence of both a benzoate moiety and a chlorosulfonyl group makes it a valuable intermediate in the development of novel synthetic pathways and functional materials.
The molecular formula of Methyl 2-(Chlorosulfonyl)methylbenzoate can be expressed as C9H7ClO5S, highlighting its composition of carbon, hydrogen, chlorine, oxygen, and sulfur atoms. This specific arrangement of atoms endows the compound with distinct chemical properties that are exploited in various industrial and research applications. The benzoate group, known for its stability and reactivity, plays a crucial role in the compound's interactions with other molecules, while the chlorosulfonyl group introduces a high degree of electrophilicity, making it an attractive candidate for further functionalization.
In recent years, the study of Methyl 2-(Chlorosulfonyl)methylbenzoate has been closely linked to advancements in medicinal chemistry. Researchers have been exploring its potential as a precursor in the synthesis of bioactive molecules. The compound's ability to undergo various transformations, such as nucleophilic substitution and condensation reactions, makes it a valuable building block for constructing more complex structures. For instance, its derivatives have been investigated for their antimicrobial and anti-inflammatory properties, underscoring the importance of this compound in drug discovery efforts.
One of the most compelling aspects of Methyl 2-(Chlorosulfonyl)methylbenzoate is its role in catalytic processes. The chlorosulfonyl group can act as a leaving group in certain reactions, facilitating the formation of new bonds and enabling the synthesis of larger molecules. This property has been particularly useful in cross-coupling reactions, where it serves as an effective mediator for connecting different molecular fragments. Such reactions are fundamental to modern synthetic organic chemistry and have wide-ranging applications in both academic research and industrial settings.
The compound's significance extends beyond its use as an intermediate. Methyl 2-(Chlorosulfonyl)methylbenzoate has also been studied for its potential applications in material science. Its unique chemical structure allows it to interact with a variety of materials, making it suitable for use in polymer synthesis and surface modifications. For example, researchers have explored its incorporation into polymer matrices to enhance thermal stability and mechanical strength. These findings highlight the compound's versatility and its potential to contribute to advancements across multiple scientific disciplines.
Recent studies have also delved into the environmental impact of Methyl 2-(Chlorosulfonyl)methylbenzoate. Understanding how this compound behaves in different environments is crucial for ensuring its safe and sustainable use. Investigations have focused on its degradation pathways and interactions with biological systems. These studies not only provide insights into the compound's environmental footprint but also inform best practices for handling and disposal. By addressing these concerns, researchers aim to maximize the benefits of this compound while minimizing any potential risks.
The synthesis of Methyl 2-(Chlorosulfonyl)methylbenzoate itself is a testament to the ingenuity of modern chemical methods. The process typically involves multi-step reactions that require precise control over reaction conditions. Advances in synthetic techniques have made it possible to produce this compound with high yields and purity, ensuring its suitability for various applications. Techniques such as flow chemistry and automated synthesis have further streamlined the production process, making it more efficient and scalable.
In conclusion, Methyl 2-(Chlorosulfonyl)methylbenzoate (CAS No. 103342-27-4) is a multifaceted compound with significant implications in chemical research and industrial applications. Its unique structure and reactivity make it a valuable tool for synthesizing complex molecules, while its potential uses in material science and environmental studies add to its importance. As research continues to uncover new applications for this compound, it is likely to remain at the forefront of scientific innovation.
103342-27-4 (Methyl 2-(Chlorosulfonyl)methylbenzoate) Related Products
- 221631-54-5(ethyl 2-(chlorosulfonyl)methylbenzoate)
- 446847-82-1(Ethyl 4-(Chlorosulfonyl)methylbenzoate)
- 221156-65-6(Benzyl 3-[(Chlorosulfonyl)methyl]benzoate)
- 616888-41-6(Benzoic acid, 3-chloro-4-[(chlorosulfonyl)methyl]-, methyl ester)
- 1292209-81-4(2-(Chlorosulfonylmethyl)benzoic acid)
- 130047-14-2(Methyl 4-(Chlorosulfonyl)methylbenzoate)
- 415916-08-4(BENZOIC ACID, 2-[(CHLOROSULFONYL)METHYL]-, 3-CARBOXYPROPYL ESTER)
- 31910-71-1((2-formylphenyl)methanesulfonyl chloride)
- 92614-57-8(4-(Chlorosulfonyl)methylbenzoic Acid)
- 174961-63-8(Methyl 3-(chlorosulfonylmethyl)benzoate)